| Mecarbam (Ref: MC 474) |
(Also known as: mecarbame; P-474) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: GUS: Transition state; Drainflow: Moderately mobile
 Warning: Significant data are missing |
Ecotoxicity High alert: Fish acute ecotoxicity: High
 Warning: Significant data are missing |
Human health High alert: Mammals acute toxicity: High; Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
|
An insecticide and acaricide used to control various sucking and chewing insect pests |
|
|
Aphids; Whiteflies; Scale insects; Mites; Mealybugs |
|
|
Fruit including citrus, grapes |
|
|
- |
|
|
- |
|
|
circa 1963 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₀H₂₀NO₅PS₂ |
|
|
CCOC(=O)N(C)C(=O)CSP(=S)(OCC)OCC |
|
|
No data |
|
|
KLGMSAOQDHLCOS-UHFFFAOYSA-N |
|
|
InChI=1S/C10H20NO5PS2/c1-5-14-10(13)11(4)9(12)8-19-17(18,15-6-2)16-7-3/h5-8H2,1-4H3 |
|
|
Yes |
|
|
Insecticide, Acaricide |
|
|
Organophosphate insecticide; Organophosphate acaricide; Organothiophosphate insecticide; Organothiophosphate acaricide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Contact and stomach action with slight systemic properties |
|
|
2595-54-2 |
|
|
219-993-9 |
|
|
224 |
|
|
340100 |
|
|
17434 |
|
|
015-045-00-1 |
|
|
329.37 |
|
|
- |
|
|
S-(N-ethoxycarbonyl-N-methylcarbamoylmethyl) O,O-diethyl phosphorodithioate |
|
|
ethyl 6-ethoxy-2-methyl-3-oxo-7-oxa-5-thia-2-aza-6-phosphanonanoate 6-sulfide |
|
|
Marine Pollutant; Subject to the provisions of the UK Poisons Act 1972 |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
1B |
|
|
Not applicable |
|
|
Boophilus microplus, Rhizoglyphus robini |
|
|
Light brown oil |
|
|
|
|
|
|
|
1000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
Miscible |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.95 X 1002 |
Calculated |
- |
|
|
2.29 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.22 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
Not applicable |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
| No dissociation |
|
|
1.00 X 10-10 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
9.12 X 10-05 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
35 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
10.9 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 1.3-29.5 days, 4 field crops, various matrices, n=4 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderately mobile |
|
|
160 |
|
|
Best available data |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
2.77 |
Calculated |
Transition state |
|
|
|
2.07 X 10-01 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
75 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Low potential |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
36 |
Rat |
High |
|
|
|
1.6 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 6 month |
High |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.006 |
Rasbora heteromorpha |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
36 |
Rat |
High |
|
|
1220 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
0.7 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
0.002 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List I; List II |
- |
- |
|
|
|
- |
|
|
May be absorbed through the skin |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
No data found |
No data found |
| Eye irritant |
Phototoxicant |
|
| No data found |
No data found |
|
|
|
|
Toxic in contact with skin or if swallowed |
|
|
|
|
|
IMDG Transport Hazard Class 6.1 |
|
|
Health: H301; H311 Environment: H400, H410 |
|
|
Ib (Highly hazardous) |
|
|
UN3018 |
|
|
Packaging Group II (moderate danger) |
|
|
- |
|
|
|
|
|
mecarbam |
|
|
mécarbam |
|
|
Mecarbam |
|
|
mecarbam |
|
|
mecarbam |
|
|
mecarbam |
|
|
mecarbam |
|
|
mekarbam |
|
|
- |
|
|
- |
|
|
mecarbam |
|
|
- |