| MCPA-dimethylammonium |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
|
Human health Moderate alert: Possible Reproduction/development effects
 |
|
|
A herbicide for control of annual and perennial weeds in cereals and other crops. Can also be a pesticide transformation product. |
|
|
Annual and perennial broad-leaved weeds including Charlock, Wild radish, Dandylion, Capeweed, Fat hen and Hedge mustards |
|
|
Wheat; Oats; Tritical; Rye; Establish grass; Lindseed; Asparagus |
|
|
- |
|
|
Current |
|
|
circa 1950 |
|
|
Approved |
|
|
31/10/2029 |
|
|
Check label - may vary with formulation |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Poland/Netherlands |
|
|
31/10/2023 |
|
|
No |
|
|
Yes - as the acid |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
|
|
|
|
|
|
None |
|
|
C₁₁H₁₆ClNO₃ |
|
|
CC1=C(C=CC(=C1)Cl)OCC(=O)O.CNC |
|
|
- |
|
|
PKAUICCNAWQPAU-UHFFFAOYSA-N |
|
|
InChI=1S/C9H9ClO3.C2H7N/c1-6-4-7(10)2-3-8(6)13-5-9(11)12;1-3-2/h2-4H,5H2,1H3,(H,11,12);3H,1-2H3 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| MCPA |
Parent |
 |
|
|
Herbicide |
|
|
Aryloxyalkanoic acid herbicide; Phenoxyacetic herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Selective, systemic with translocation. Synthetic auxin. |
|
|
2039-46-5 |
|
|
218-014-2 |
|
|
2 |
|
|
- |
|
|
62420 |
|
|
607-051-00-3 |
|
|
245.70 |
|
|
(4-chloro-2-methylphenoxy)acetic acid—N-methylmethanamine (1/1) |
|
|
[(4-chloro-o-tolyl)oxy]acetic acid - dimethylamine (1:1) |
|
|
2-(4-chloro-2-methylphenoxy)acetic acid compound with N-methylmethanamine (1:1) |
|
|
Potential groundwater contaminant |
|
|
UK Environment Agency non-statutory standard for the protection of freshwater aquatic life pH <7: 12 µg l⁻¹, pH >7 80 µg l⁻¹ as annual average; pH <7: 120 µg l⁻¹, pH >7 800 µg l⁻¹ as max acceptable conc. Data as the acid. For salt water 80 µg l⁻¹ as annual average, 800 µg l⁻¹ as max acceptable conc. Non-statutory WHO drinking water guideline 0.002 mg l⁻¹ |
|
|
O |
|
|
4 |
|
|
Not applicable |
|
|
Not applicable |
|
|
Raphanus raphanistrum, Sisymbrium orientale |
|
|
- |
|
|
|
|
|
|
|
|
- BASF
- Bayer Environ
- Dow AgroSciences
- DuPont
- Headland Agrochemicals
- Luxan
- Nufarm
- Scotts
|
|
|
- |
|
|
Often supplied as soluble concentrate, wettable powder or emulsifiable concentrate |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Soluble |
|
- |
|
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.05 |
as MCPA |
- |
|
|
0.15 |
as MCPA |
- |
|
|
- |
- |
- |
|
|
0.04 |
as MCPA |
- |
|
|
- |
- |
- |
|
|
List II |
- |
- |
|
|
|
May be absorbed through the skin |
|
|
Occupational exposure may occur through inhalation and dermal contact |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E2 E = Unspecified genotoxicity type (miscellaneous data source) 2 = Mixed/ambiguous results |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Highly toxic May cause hypotension Possible liver toxicant |
|
|
|
|
|
IMDG Transport Hazard Class 6.1 Not expected to autoignite; Not highly flammable |
|
|
Health: H302, H315, H318 Environment: H400, H410 |
|
|
II (Moderately hazardous) |
|
|
UN3345 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
MCPA-dimethylammonium |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |