| Maleic hydrazide potassium |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
Ecotoxicity Moderate alert: Fish chronic ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health High alert: Neurotoxicant
 |
|
|
A plant growth regulator used to suppress growth and to induce dormancy in some crops |
|
|
Growth; Suckers; Sprout suppression |
|
|
Lawns; Amenity turf; Non-cropped areas; Fruit including citrus; Potatoes; Carrots; Onions, shallots & garlic; Tobacco; Ornamental shrubs |
|
|
- |
|
|
Current |
|
|
after 1950 |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Denmark/Belgium |
|
|
31/10/2032 |
|
|
No |
|
|
Yes as hydrazide acid |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| ✓ |
✓ |
|
|
✓ |
✓ |
✓ |
|
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
|
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
✓ |
✓ |
|
✓ |
|
✓ |
|
|
|
|
|
|
None |
|
|
C₄H₃KN₂O₂ |
|
|
C1=CC(=O)NNC1=O.[K+] |
|
|
- |
|
|
ONFPEXMNTHPYGN-UHFFFAOYSA-M |
|
|
InChI=1S/C4H4N2O2.K/c7-3-1-2-4(8)6-5-3;/h1-2H,(H,5,7)(H,6,8);/q;+1/p-1 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
|
Plant Growth Regulator, Herbicide |
|
|
Pyridazine PGR |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Suppresses sprout and bud growth, absorbed by leaves and roots and translocated. Enhances chlorophyll production. |
|
|
28382-15-2 |
|
|
249-000-4 |
|
|
310 |
|
|
- |
|
|
62830 |
|
|
No data found |
|
|
151.19 |
|
|
potassium 6-oxo-1,6-dihydropyridazin-3-olate |
|
|
potassium 6-oxo-1,6-dihydropyridazin-3-olate |
|
|
1,2-dihydro-3,6-pyridazinedione potassium salt (1:1) |
|
|
Chemical subject to PIC regulations |
|
|
- |
|
|
Not known |
|
|
Not known |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
White crystalline solid |
|
|
|
|
|
|
|
|
- |
|
|
- |
|
|
Usually supplied in liquid formulations |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 10760 |
Q4 Q = Miscellaneous data from online sources 4 = Verified data Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 1000 |
Oncorhynchus mykiss |
Low |
|
|
9.6 |
Pimephales promelas 32 day |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 10760 |
Q4 Q = Miscellaneous data from online sources 4 = Verified data Rat |
Low |
|
|
2000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.25 |
as maleic hydrazide |
- |
|
|
None allocated |
as maleic hydrazide |
- |
|
|
- |
- |
- |
|
|
0.25 |
as maleic hydrazide |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
No unacceptable risks to bystanders identified |
|
|
No unacceptable risks to operators or other workers identified |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E2 E = Unspecified genotoxicity type (miscellaneous data source) 2 = Mixed/ambiguous results |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
|
|
|
|
Potential liver toxicant Possible mutagen Ingestion might cause tremors and muscle spasms IARC group 3 carcinogen |
|
|
|
|
|
IMDG Transport Hazard Class 9 Not explosive or oxidising Not expected to autoignite; Not highly flammable |
|
|
Health: H315, H319, H341, H335 |
|
|
U (Unlikely to present an acute hazard) |
|
|
UN3077 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
maleic hydrazide potassium |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |