| Lithium perfluorooctane sulfonate |
(Also known as: LPOS; 1-perfluorooctanesulfonic acid, lithium salt) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability; Drainflow: Mobile
 Warning: Significant data are missing |
Ecotoxicity High alert: Birds acute ecotoxicity: High; Bees acute oral ecotoxicity: High
 |
Human health High alert: Carcinogen; Reproduction/development effects
 |
|
|
An obsolete insecticide mainly for non-agricultural uses |
|
|
Wasps; Hornets |
|
|
Non-food applications; Public health situations; Non-cropped land; Residential situations |
|
|
- |
|
|
Considered obsolete but may be available in some countries |
|
|
1985, discovered |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₈F₁₇LiO₃S |
|
|
[Li+].C(C(C(C(C(F)(F)S(=O)(=O)[O-])(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
|
|
- |
|
|
XVCUGNWRDDNCRD-UHFFFAOYSA-M |
|
|
InChI=1S/C8HF17O3S.Li/c9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)29(26,27)28;/h(H,26,27,28);/q;+1/p-1 |
|
|
Yes |
|
|
Insecticide, Adjuvant |
|
|
Unclassified pesticide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
As yet unclear |
|
|
29457-72-5 |
|
|
249-644-6 |
|
|
None allocated |
|
|
075004 |
|
|
23677927 |
|
|
607-624-00-8 |
|
|
506.06 |
|
|
- |
|
|
lithium perfluorooctane sulfonate |
|
|
lithium perfluorooctane sulfonate |
|
|
POP; Global pollutant |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not known |
|
|
Not applicable |
|
|
- |
|
|
Pale straw coloured powder |
|
|
|
|
|
|
|
|
|
|
|
Usually supplied in formulations suitable for use in wasp/hornet bait stations. |
|
|
|
|
|
|
|
570 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
High |
|
|
- |
- |
- |
|
|
400 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
- |
|
|
Decomposes before boiling |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
308 |
|
- |
|
|
- |
- |
- |
|
|
|
1.07 X 1007 |
Calculated |
- |
|
|
7.03 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.56 |
|
- |
|
|
- |
- |
- |
| - |
|
|
0.331 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
Low volatility |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
500 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
Very persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Stable |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
Stable |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Stable |
|
|
- |
|
|
|
Stable |
|
Stable |
|
|
Stableat pH 5, 7 and 9 |
|
|
Stable |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Stable |
|
|
Stable |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Stable |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Mobile |
|
|
50 |
|
|
Estimated |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
6.21 |
Calculated |
High leachability |
|
|
|
2.65 X 1001 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Mobile |
Calculated |
- |
|
|
|
2567 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Threshold for concern |
|
|
116 |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
154 |
Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
42 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Colinus virginianus |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 316 |
Eisenia foetida |
Moderate |
|
|
77 |
Eisenia foetida |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
0.40 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
4.2 |
Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
67.0 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 108 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Lemna gibba |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
154 |
Rat |
Moderate |
|
|
2000 |
Rat |
- |
|
|
0.16 |
Rat |
- |
|
|
- |
- |
- |
|
|
Not allocated |
|
- |
|
|
Not allocated |
|
- |
|
|
- |
- |
- |
|
|
Not allocated |
|
- |
|
|
- |
- |
- |
|
|
List II |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
✓Yes, known to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E2 E = Unspecified genotoxicity type (miscellaneous data source) 2 = Mixed/ambiguous results |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Highly toxic Liver toxicant Suppresses hematopoiesis |
|
|
|
|
|
Not expected to autoignite; Not highly flammable |
|
|
- |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
lithium perfluorooctane sulfonate |
|
|
heptadecafluorooctanesulfonate de lithium |
|
|
Lithiumheptadecafluoroctansulfonat |
|
|
- |
|
|
- |
|
|
heptadecafluorooctanosulfonato de litio |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |