| Isotianil (Ref: BYF1047) |
(Also known as: S-2310) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Potential for particle bound transport: High
 |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate
 |
Human health Low alert
 |
|
|
A fungicide to control rice blast |
|
|
Rice blast |
|
|
Rice |
|
|
- |
|
|
Current |
|
|
2007 |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₁H₅Cl₂N₃OS |
|
|
C1=CC=C(C(=C1)C#N)NC(=O)C2=C(C(=NS2)Cl)Cl |
|
|
- |
|
|
WLPCAERCXQSYLQ-UHFFFAOYSA-N |
|
|
InChI=1S/C11H5Cl2N3OS/c12-8-9(18-16-10(8)13)11(17)15-7-4-2-1-3-6(7)5-14/h1-4H,(H,15,17)/f/h15H |
|
|
Yes |
|
|
Fungicide |
|
|
Thiazole fungicide; Anilide fungicide; Plant activator |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Systemic Activated Resistance (SAR). Induces host plant defence. |
|
|
224049-04-1 |
|
|
619-682-1 |
|
|
None allocated |
|
|
- |
|
|
9796266 |
|
|
No data found |
|
|
298.15 |
|
|
3,4-dichloro-N-(2-cyanophenyl)-1,2-thiazole-5-carboxamide |
|
|
3,4-dichloro-2'-cyano-1,2-thiazole-5-carboxanilide |
|
|
3,4-dichloro-N-(2-cyanophenyl)-5-isothiazolecarboxamide |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
P03 |
|
|
- |
|
|
White powder |
|
|
|
|
|
- Bayer CropScience
- Sumitomo
|
|
|
|
|
|
- |
|
|
|
|
|
|
|
0.5 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
9.12 X 1002 |
Calculated |
- |
|
|
2.96 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
2.36 X 10-04 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Low volatility |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
75.0 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderately persistent |
|
|
75.0 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderately persistent |
|
|
7.0 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Lab DT₅₀ in aqueous soil layer 0.3-3.3 days, in soil layer 69.3-92.4 days and whole soil system 61.9-73.7 days; Field studies DT₅₀ 0.5 to 13 days |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
8 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderately fast |
|
|
- |
|
|
|
60.8 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderately persistent |
|
|
Stable at pH 4; DT₅₀ = 71.4 days at pH 9 |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
|
- |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Slightly mobile |
|
|
1046 |
|
|
- |
|
|
Literature Kfoc range 497-1596 mL g⁻¹ |
|
|
- |
|
|
|
|
|
|
|
0.83 |
Calculated |
Low leachability |
|
|
|
7.75 X 10-03 |
Calculated |
- |
|
|
- |
|
|
High |
Calculated |
- |
|
|
Slightly mobile |
Calculated |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 2000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 2250 |
R4 R = Peer reviewed scientific publications 4 = Verified data Colinus virginianus |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 1.0 |
R4 R = Peer reviewed scientific publications 4 = Verified data Cyprinus carpio |
Moderate |
|
|
- |
- |
- |
|
|
> 1.0 |
R4 R = Peer reviewed scientific publications 4 = Verified data Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1.0 |
R4 R = Peer reviewed scientific publications 4 = Verified data Pseudokirchneriella subcapitata |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 2000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
Low |
|
|
2000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
- |
|
|
> 4.75 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Rapidly metabolised in rats |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
XNo, known not to cause a problem |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
No information available |
|
|
None allocated at this time |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
isotianil |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |