| Isofenphos (Ref: BAY SRA 12869) |
(Also known as: isophenphos; BAY 92114) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: GUS: Transition state; Drainflow: Slightly mobile; Potential for particle bound transport: Medium
 Warning: Significant data are missing |
Ecotoxicity High alert: Birds acute ecotoxicity: High; Fish chronic ecotoxicity: High; Daphnia acute ecotoxicity: High; Bees acute contact ecotoxicity: High
 |
Human health High alert: Mammals acute toxicity: High; Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
|
An obsolete insecticide once used to control soil-dwelling insects |
|
|
White grubs; Cabbage root flies; Corn roundworms; Wireworms; Mole crickets |
|
|
Turf; Ornamental trees and shrubs; Corn; Maize; Carrots |
|
|
- |
|
|
Considered obsolete but may be available in some countries |
|
|
1974, first reported |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
- |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
A chiral molecule |
|
|
C₁₅H₂₄NO₄PS |
|
|
CCOP(=S)(NC(C)C)OC1=CC=CC=C1C(=O)OC(C)C |
|
|
No data |
|
|
HOQADATXFBOEGG-UHFFFAOYSA-N |
|
|
InChI=1S/C15H24NO4PS/c1-6-18-21(22,16-11(2)3)20-14-10-8-7-9-13(14)15(17)19-12(4)5/h7-12H,6H2,1-5H3,(H,16,22) |
|
|
Yes |
|
|
Insecticide |
|
|
Organophosphate insecticide; Phosporamidothioate insecticide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Selective with contact and stomach action. Acetylcholine esterase inhibitor. |
|
|
25311-71-1 |
|
|
246-814-1 |
|
|
412 |
|
|
109401 |
|
|
32872 |
|
|
015-129-00-8 |
|
|
345.39 |
|
|
- |
|
|
O-ethyl O-2-isopropoxycarbonylphenylisopropylphosphoramidothioate |
|
|
1-methylethyl 2-((ethoxy((1-methylethyl)amino)phosphinothioyl)oxy)benzoate |
|
|
PAN Bad Actor Chemical; Marine Pollutant |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
1B |
|
|
Not applicable |
|
|
Myzus persicae |
|
|
Colourless oily liquid with characteristic odour |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Available in a variety of formulations including emulsifiable concentrate, dry seed treatments, granules and wettable powder formulations |
|
|
|
|
|
|
|
24 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low |
|
|
200000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Isopropanol |
- |
| 200000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Toluene |
- |
| 200000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Dichloromethane |
- |
|
|
-12 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
120 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
115 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
|
1.10 X 1004 |
Calculated |
- |
|
|
4.04 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.13 |
AC4 AC = EC Joint Research Centre ESIS European Chemical Substance Information Systems including EINECS, now integrated with the database provided by the European Chemicals Agency (ECHA) (click here ) 4 = Verified data |
- |
|
|
- |
- |
- |
| - |
|
|
0.53 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low volatility |
|
|
4.20 X 10-03 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
150 |
M4 M = GLEAMS Model database (Groundwater Loading Effects of Agricultural Management Systems). Dataset no longer available. 4 = Verified data |
Persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data |
|
|
|
18.2 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
|
Kentucky bluegrass, blades, n=1 |
|
|
|
3.7 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
|
Turfgrass, n=1 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
365 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Very persistent |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Slightly mobile |
|
|
600 |
|
|
Best available data |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
2.66 |
Calculated |
Transition state |
|
|
|
2.07 X 10-01 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Slightly mobile |
Calculated |
- |
|
|
|
240 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Threshold for concern |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 28 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Rat |
High |
|
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
|
1 |
- |
|
|
- |
- |
- |
|
|
> 13 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Colinus virginianus |
High |
|
|
299 mg kg bw⁻¹ day⁻¹ |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Colinus virginianus |
- |
|
|
- |
- |
- |
|
|
> 404 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Eisenia foetida |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 0.61 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
High |
|
|
- |
- |
- |
|
|
Toxic |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Toxic |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
1.8 |
Lepomis macrochirus |
Moderate |
|
|
0.066 |
Oncorhynchus mykiss 28 day LOEC |
Moderate |
|
|
0.0039 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
High |
|
|
- |
- |
- |
|
|
0.0004 |
Americamysis bahia |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
6.8 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Scenedesmus subspicatus |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 28 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Rat |
High |
|
|
162 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Rabbit |
- |
|
|
0.2 |
AC4 AC = EC Joint Research Centre ESIS European Chemical Substance Information Systems including EINECS, now integrated with the database provided by the European Chemicals Agency (ECHA) (click here ) 4 = Verified data Rat 4 hr |
- |
|
|
- |
- |
- |
|
|
0.001 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List I; List II |
- |
- |
|
|
|
- |
|
|
May be absorbed through the skin |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Toxic in contact with skin or if swallowed Central, peripheral nervous systems and blood toxicant |
|
|
|
|
|
No information available |
|
|
Health: H301, H311 Environment: H400, H410 |
|
|
Ib (Highly hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
isofenphos |
|
|
isophenphos |
|
|
Isofenphos |
|
|
isofenphos |
|
|
isofenfos |
|
|
isofenfos |
|
|
isofenphos |
|
|
izofenfos |
|
|
- |
|
|
- |
|
|
isofenfos |
|
|
- |