| Indaziflam |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Potential for particle bound transport: High
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Fish chronic ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Daphnia chronic ecotoxicity: Moderate; Earthworms chronic ecotoxicity: Moderate
 |
Human health High alert: Neurotoxicant
 |
|
|
A pre-emergence herbicide that controls a broad spectrum of weeds, including species which are difficult to eliminate |
|
|
Annual grasses and broad-leaved weeds including annual bluegrass, goosegrass, ryegrass and goosefoot. |
|
|
Residential; Turf & lawns; Sports fields; Field grown ornamentals; Landscapes; Pome and stone fruit; Citrus; Grapes; Tree nuts; Bananas; Tea; Coffee; Olives |
|
|
- |
|
|
Current |
|
|
2010, first registered USA |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Japan; Canada; USA; Indonesia; Argentina; Mexico; Philippines; Vietnam; Australia |
|
|
Indaziflam is a chiral molecule with three asymmetric carbons and two of eight possible isomers (isomer A - IR,2S,1R- and Isomer B - 1R,2S,1S-) are present in the active constituents of indaziflam. |
|
|
C₁₆H₂₀FN₅ |
|
|
CC1CC2=C(C1NC3=NC(=NC(=N3)N)C(C)F)C=C(C=C2)C |
|
|
C[C@H]1CC2=C([C@@H]1NC3=NC(=NC(=N3)N)C(C)F)C=C(C=C2)C |
|
|
YFONKFDEZLYQDH-BOURZNODSA-N |
|
|
InChI=1S/C16H20FN5/c1-8-4-5-11-7-9(2)13(12(11)6-8)19-16-21-14(10(3)17)20-15(18)22-16/h4-6,9-10,13H,7H2,1-3H3,(H3,18,19,20,21,22)/t9-,10?,13+/m0/s1 |
|
|
Yes |
|
|
Herbicide |
|
|
Fluoroalkyltriazine herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Inhibits cellulose biosynthesis (CB Inhibitor). Long lasting action and non-selective. |
|
|
950782-86-2 |
|
|
936-023-6 |
|
|
None allocated |
|
|
080818 |
|
|
44146693 |
|
|
No data found |
|
|
301.36 |
|
|
N2-[(1R,2S)-2,6-dimethyl-2,3-dihydro-1H-inden-1-yl]-6-[(1?)-1-fluoroethyl]-1,3,5-triazine-2,4-diamine |
|
|
N-[(1R,2S)-2,3-dihydro-2,6-dimethyl-1H-inden-1-yl]-6-[(1RS)-1-fluoroethyl]-1,3,5-triazine-2,4-diamine |
|
|
N-[(1R,2S)-2,3-dihydro-2,6-dimethyl-1H-inden-1-yl]-6-(1-fluoroethyl)-1,3,5-triazine-2,4-diamine |
|
|
Potential groundwater contaminant; Marine pollutant |
|
|
- |
|
|
L |
|
|
29 |
|
|
Not applicable |
|
|
Not applicable |
|
|
None identified |
|
|
Beige coloured powdery solid |
|
|
|
|
|
- Bayer CropScience
- Bayer Advanced
|
|
|
- Alion
- Specticle
- Becano
- Esplanade 200SC
|
|
|
Number of different formulations are emerging world-wide including wettable powders, liquid suspensions, water soluble bags, fertiliser additives, ready-to-use products and granules |
|
|
|
|
|
|
|
2.8 |
at pH 9 |
Low |
|
|
55000 |
Acetone |
- |
| 7600 |
Acetonitrile |
- |
| 13000 |
Ethanol |
- |
| 32 |
Heptane |
- |
|
|
183 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
6.31 X 1002 |
Calculated |
- |
|
|
2.8 |
|
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.23 |
|
- |
|
|
3.5 |
|
- |
| - |
|
|
2.5 X 10-05 |
|
Low volatility |
|
|
2.69 X 10-06 |
|
Non-volatile |
|
|
Max @ 213nm, 268nm, 291nm |
|
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
150 |
|
Persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
General literature gives DT₅₀ >150 days (aerobic soil), >200 days (anaerobic soils) |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
5 |
|
Moderately fast |
|
|
Data for clear shallow water |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
- |
Slightly mobile |
|
|
1000 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
2.18 |
Calculated |
Transition state |
|
|
|
1.06 X 10-01 |
Calculated |
- |
|
|
- |
|
|
High |
Calculated |
- |
|
|
Slightly mobile |
Calculated |
- |
|
|
|
Low risk |
Based on LogP < 3 |
Low risk |
|
|
- |
- |
| Known groundwater metabolites |
|
None
|
|
|
|
|
|
| indaziflam-olefin |
- |
Water |
- |
- |
| fluoroethyltriazinanedione |
- |
- |
- |
- |
fluoroethyldiaminotriazine Note: Koc <50 mL/g |
FDAT |
Human |
- |
- |
| triazine-indanone |
- |
- |
- |
- |
| indaziflam-carboxylic acid |
- |
- |
- |
- |
| indaziflam-hydroxyethyl |
- |
Water |
- |
- |
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 2000 |
Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
Colinus virginianus |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1000 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Eisenia foetida |
Low |
|
|
34.0 |
Eisenia foetida for NOAEC |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 100 |
|
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 0.42 |
Oncorhynchus mykiss |
Moderate |
|
|
0.464 |
Pimephales promelas |
Moderate |
|
|
< 9.88 |
Daphnia magna |
Moderate |
|
|
0.34 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.000019 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Lemna gibba NOEC |
High |
|
|
0.75 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Pseudokirchneriella subcapitata as formulation |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 2000 |
Rat |
Low |
|
|
2000 |
Rabbit |
- |
|
|
> 2.3 |
Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Approx. 90% of administered dose is excreted within 24hrs mostly in the faeces and bile |
|
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Possible liver and thyroid toxicant Harmful is swallowed |
|
|
|
|
|
IMDG Transport Hazard Class 9 |
|
|
- |
|
|
Not listed |
|
|
UN3082 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
indaziflam |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |