| Imazalil sulfate |
(Also known as: enilconazole sulfate; enilconazole sulphate) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
|
Human health High alert: Endocrine distrupter; Reproduction/development effects
 |
|
|
A fungicide used to control a wide range of fungi including Tilletia and Helminthosporium spp. on fruit, vegetables and ornamentals |
|
|
Powdery Mildew; Blackspot; Storage rots; Leaf stripe |
|
|
Fruit including citrus, apples, pears bananas; Cucumbers; Roses; Barley; Wheat |
|
|
- |
|
|
Current |
|
|
1977 |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Netherlands/Belgium |
|
|
31/12/2024 |
|
|
No |
|
|
Yes - as the acid |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
✓ |
✓ |
✓ |
✓ |
✓ |
|
✓ |
|
|
|
|
|
|
Isomeric |
|
|
C₁₄H₁₆Cl₂N₂O₅S |
|
|
C=CCOC(CN1C=CN=C1)C2=C(C=C(C=C2)Cl)Cl.OS(=O)(=O)O |
|
|
- |
|
|
XVTXMTOYQVRHSK-UHFFFAOYSA-N |
|
|
InChI=1S/C14H14Cl2N2O.H2O4S/c1-2-7-19-14(9-18-6-5-17-10-18)12-4-3-11(15)8-13(12)16;1-5(2,3)4/h2-6,8,10,14H,1,7,9H2;(H2,1,2,3,4) |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| imazalil |
Parent |
 |
|
|
Fungicide, Veterinary substance |
|
|
Imidazole fungicide; Conazole fungicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Systemic with curative and protective properties. Disrupts membrane function. |
|
|
58594-72-2 |
|
|
261-351-5 |
|
|
335 |
|
|
- |
|
|
173636 |
|
|
No data found |
|
|
395.26 |
|
|
(RS)-1-[β-(allyloxy)-2,4-dichlorophenethyl]imidazole sulfate |
|
|
(RS)-1-[β-(allyloxy)-2,4-dichlorophenethyl]imidazole sulfate |
|
|
1-[2-(2,4-dichlorophenyl)-2-(2-propen-1-yloxy)ethyl]-1H-imidazole sulfate (1:1) |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
3 |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
|
- Bayer CropScience
- Certis
- Gustafson
- Makhteshim-Agan
|
|
|
|
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
|
|
|
|
|
Minor fraction |
- |
- |
|
|
Minor fraction |
- |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.025 |
as imazalil |
- |
|
|
0.05 |
as imazalil |
- |
|
|
- |
- |
- |
|
|
0.05 |
as imazalil |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
No unacceptable risk to bystanders identified Consumers may be exposed via ingestion of contaminated foodstuffs |
|
|
No unacceptable risk for operators or other workers identified |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Extensively metabolised and the main excretion routes are urine and faeces. |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B1 B = DNA damage/repair (EFSA database) 1 = Positive ; C3 C = Gene mutation (EFSA database) 3 = Negative ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
✓Yes, known to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Possible liver and kidney toxicant USEPA - probable human carcinogen |
|
|
|
|
|
Not explosive or oxidising IMDG Transport Hazard Class 6.1 Not expected to autoignite; Not highly flammable |
|
|
Health: H301, H318, H332. H351 Environment: H410 |
|
|
II (Moderately hazardous) |
|
|
UN2811 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
imazalil sulfate |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
imazalilsulfat |