| Hexaflumuron (Ref: XRD 473) |
(Also known as: DE 473) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Persistent; Potential for particle bound transport: High
 |
Ecotoxicity High alert: Daphnia acute ecotoxicity: High; Daphnia chronic ecotoxicity: High
 |
Human health Low alert
 Warning: Significant data are missing |
|
|
An insecticide used to control the larvae of Lepidoptera, Coleoptera, Homopetra and Diptera spp. |
|
|
Termites |
|
|
Wood structures such as buildings, fences, decking |
|
|
- |
|
|
Current |
|
|
1983, first reported |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
- |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₆H₈Cl₂F₆N₂O₃ |
|
|
C1=CC(=C(C(=C1)F)C(=O)NC(=O)NC2=CC(=C(C(=C2)Cl)OC(C(F)F)(F)F)Cl)F |
|
|
- |
|
|
RGNPBRKPHBKNKX-UHFFFAOYSA-N |
|
|
InChI=1S/C16H8Cl2F6N2O3/c17-7-4-6(5-8(18)12(7)29-16(23,24)14(21)22)25-15(28)26-13(27)11-9(19)2-1-3-10(11)20/h1-5,14H,(H2,25,26,27,28) |
|
|
Yes |
|
|
Insecticide, Insect Growth Regulator |
|
|
Benzoylphenylurea insecticide; Phenylurea herbicide; Urea herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Systemic with stomach action. Inhibitor of chitin biosynthesis affecting CHS1. |
|
|
86479-06-3 |
|
|
401-400-1 |
|
|
698 |
|
|
118202 |
|
|
91741 |
|
|
616-221-00-6 |
|
|
461.14 |
|
|
- |
|
|
1-[3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-(2,6-difluorobenzoyl)urea |
|
|
N-(((3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl)amino)carbonyl)-2,6-difluorobenzamide |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
15 |
|
|
Not applicable |
|
|
- |
|
|
Colourless solid |
|
|
|
|
|
- Dow AgroSciences
- FCC Ltd
- AgroCare
|
|
|
- Recruit
- Sonet
- Consult
- Conhex
- Sentricon
|
|
|
Usually supplied as an emulsifiable concentrate or suspension concentrate |
|
|
|
|
|
|
|
0.027 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
162000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
| 100000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethyl acetate |
- |
| 5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Heptane |
- |
| 2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Octanol |
- |
|
|
203.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
Decomposes before boiling |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
300 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
|
4.79 X 1005 |
Calculated |
- |
|
|
5.68 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.68 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
0.059 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
1.01 X 1000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
57 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent |
|
|
- |
- |
- |
|
|
170 |
|
Persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
3.0 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 1.1-4.5 days, 4 field & undercover grown crops, various matrices, n=5 |
|
|
|
6.3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately fast |
|
|
- |
|
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
Stable at pH 5 |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
W3 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 3 = Unverified data of known source |
Non-mobile |
|
|
10391 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
-0.04 |
Calculated |
Low leachability |
|
|
|
5.35 X 10-03 |
Calculated |
- |
|
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW |
|
|
High |
Calculated |
- |
|
|
Non-mobile |
Calculated |
- |
|
|
|
4700 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Threshold for concern |
|
|
Not available |
- |
| Known soil and groundwater metabolites |
|
None
|
|
|
|
|
|
| 3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl urea |
- |
- |
- |
- |
| 3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl amine |
- |
- |
- |
- |
| 2,6-difluorobenzoic acid |
- |
- |
- |
- |
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
|
75 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
High |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Colinus virginianus |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
880 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Eisenia foetida |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
89 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Apis mellifera |
Moderate |
|
|
89 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Apis mellifera |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Moderately harmful |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Typhlodromus pyri |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Lepomis macrochirus |
Low |
|
|
- |
- |
- |
|
|
0.0001 |
J4 J = Pesticide Action Network database (click here ) 4 = Verified data Daphnia magna |
High |
|
|
> 0.000001 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
3.2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Raphidocelis subcapitata |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
|
7.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat 4 hr |
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
- |
- |
- |
|
|
List II |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Potential blood toxicant |
|
|
|
|
|
IMDG Transport Hazard Class 9 |
|
|
Environment: H400, H410 |
|
|
U (Unlikely to present an acute hazard) |
|
|
UN3077 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
hexaflumuron |
|
|
hexaflumuron |
|
|
Hexaflumuron |
|
|
hexaflumuron |
|
|
esaflumuron |
|
|
hexaflumuron |
|
|
- |
|
|
heksaflumuron |
|
|
- |
|
|
- |
|
|
- |
|
|
- |