| Hexaconazole (Ref: PP 523) |
(Not known by any other names) |
| Hexaconazole is a fungicide used to control powdery mildew, scabs and rusts. It has a low aqueous solubility and a low viscosity. It tends to be environmentally persistent in both soil and aquatic systrems. It is moderately toxic to birds, fish, aquatic invertebrates, algae and earthworms but has a low toxicity to honeybees. It has a low mammalian toxicity and no information on other health issues has been identified although it my be a skin and eye irritant |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Persistent; Potential for particle bound transport: High
 |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Daphnia chronic ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health High alert: Endocrine distrupter
 |
|
|
A conazole (imidazole) fungicide used to control both seed-borne and soil-borne diseases especially Ascomycetes and Basidiomycetes spp. |
|
|
Powdery mildew, Scabs, Rusts |
|
|
Vines; Apples; Pears,; Bananas; Vegetables; Some small grain cereals |
|
|
- |
|
|
Current |
|
|
1986 |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Italy |
|
|
Not applicable |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
A chiral molecule existing in the R- and S-forms. The R-enantiomer exhibits the greatest fungicial activity. |
|
|
C₁₄H₁₇Cl₂N₃O |
|
|
CCCCC(CN1C=NC=N1)(C2=C(C=C(C=C2)Cl)Cl)O |
|
|
- |
|
|
STMIIPIFODONDC-UHFFFAOYSA-N |
|
|
InChI=1S/C14H17Cl2N3O/c1-2-3-6-14(20,8-19-10-17-9-18-19)12-5-4-11(15)7-13(12)16/h4-5,7,9-10,20H,2-3,6,8H2,1H3 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| hexaconazole |
Unstated isomerism |
 |
|
|
Fungicide, Other substance |
|
|
Wood preservative |
|
|
Triazole fungicide; Conazole fungicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Broad spectrum, systemic with protective and curative action. Disrupts membrane function. Sterol biosynthesis inhibitor. |
|
|
79983-71-4 |
|
|
413-050-7 |
|
|
465 |
|
|
128925 |
|
|
66461 |
|
|
613-171-00-7 |
|
|
314.21 |
|
|
- |
|
|
(RS)-2-(2,4-dichlorophenyl)-1-(1H-1,2,4-triazol-1-yl)hexan-2-ol |
|
|
α-butyl-α-(2,4-dichlorophenyl)-1H-1,2,4-triazole-1-ethanol |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
3 |
|
|
- |
|
|
White crystalline solid |
|
|
|
|
|
|
|
|
|
|
|
- Passport
- Manage
- Anvil
- Planete Aster
|
|
|
Available in a variety of formulations including oil miscible liquids, soluble grains and suspension concentrates. |
|
|
|
|
|
|
|
18 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Low |
|
|
120000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Ethyl acetate |
- |
| 164000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Acetone |
- |
| 810 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Hexane |
- |
| 246000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Methanol |
- |
|
|
111 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
7.94 X 1003 |
Calculated |
- |
|
|
3.9 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
High |
|
|
|
Likely to be soluble |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
Based on chemical group |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
1.29 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
2.3 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
- |
| Strong acid |
|
|
0.018 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Low volatility |
|
|
3.33 X 10-04 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
122 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Persistent |
|
|
- |
- |
- |
|
|
225 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
Persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Sandy loam DT₅₀ ~ 10 months, clay loam ~ 5 months; General literature DT₅₀ range 49-200 days (R3) |
|
|
|
5.3 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
|
Mango, n=1 |
|
|
|
5.5 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 1.7-7.8 days, 7 field crops, various matrices, n=9 |
|
|
|
10 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderately fast |
|
|
- |
|
|
|
Stable |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Stable |
|
|
Not greatly sensitive to pH |
|
|
112 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Slow |
|
|
112 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Stable |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
DW3 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 3 = Unverified data of known source |
Slightly mobile |
|
|
1040 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
2.31 |
Calculated |
Transition state |
|
|
|
1.29 X 10-01 |
Calculated |
- |
|
|
- |
|
|
High |
Calculated |
- |
|
|
Slightly mobile |
Calculated |
- |
|
|
|
412 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Threshold for concern |
|
|
Not available |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
2189 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Rat |
Low |
|
|
|
5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
High |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 4000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
414 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 100 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Apis mellifera |
Low |
|
|
> 100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Apis mellifera |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
Harmless at dose 120 g ha⁻¹ |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Chrysoperla carnea |
- |
|
|
- |
- |
- |
|
|
Harmless at dose 120 g ha⁻¹ |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Typhlodromus pyri |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
3.4 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
> 2.9 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Daphnia magna |
Moderate |
|
|
0.226 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 0.1 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Chlorella pyrenoidosa |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
2189 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Rat |
Low |
|
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
5.9 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
0.005 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
✓Yes, known to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
USEPA - possible human carcinogen Endocrine issues - Inhibition of aromatase activity, decrease of the estrogens production |
|
|
|
|
|
No information available |
|
|
Health: H302, H317 Environment: H411 |
|
|
III (Slightly hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
hexaconazole |
|
|
hexaconazole |
|
|
Hexaconazol |
|
|
hexaconazol |
|
|
esaconozolo |
|
|
hexaconazol |
|
|
- |
|
|
heksakonazol |
|
|
- |
|
|
hexakonazol |
|
|
- |
|
|
- |