| Heptenophos (Ref: OMS 1845) |
(Also known as: HOE 02982; AE F002982) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Moderately mobile
 |
Ecotoxicity High alert: Birds acute ecotoxicity: High; Fish acute ecotoxicity: High; Daphnia acute ecotoxicity: High
 |
Human health High alert: Mammals acute toxicity: High; Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
|
An insecticide and acaricide used to control sucking insects and certain insects belonging to the Diptera family |
|
|
Aphids; Leafhopper (Hauptidia maroccana); Thrips (Thrips tabaci); Cherry fruit fly; Mealybugs |
|
|
Tomatoes; Cucumber; Mushrooms; Ornamental crops |
|
|
- |
|
|
- |
|
|
1971, first reported |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
A racemic molecule with 2 chiral centres |
|
|
C₉H₁₂ClO₄P |
|
|
COP(=O)(OC)OC1=C(C2C1CC=C2)Cl |
|
|
- |
|
|
GBAWQJNHVWMTLU-UHFFFAOYSA-N |
|
|
InChI=1S/C9H12ClO4P/c1-12-15(11,13-2)14-9-7-5-3-4-6(7)8(9)10/h3-4,6-7H,5H2,1-2H3 |
|
|
Yes |
|
|
Insecticide, Acaricide, Veterinary substance |
|
|
Organophosphate insecticide; Organophosphate acaricide |
|
|
>93 |
|
|
- |
|
|
Synthetic |
|
|
Systemic with stomach, contact and respiratory action. Cholinesterase inhibitor |
|
|
23560-59-0 |
|
|
245-737-0 |
|
|
527 |
|
|
215600 |
|
|
62773 |
|
|
015-126-00-1 |
|
|
250.6 |
|
|
- |
|
|
7-chlorobicyclo[3.2.0]hepta-2,6-dien-6-yl dimethyl phosphate |
|
|
7-chlorobicyclo[3.2.0]hepta-2,6-dien-6-yl dimethyl phosphate |
|
|
Marine Pollutant |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
1B |
|
|
Not applicable |
|
|
Myzus persicae |
|
|
Light brown liquid |
|
|
|
|
|
- Bayer CropScience
- AgrEvo
- Hoechst
|
|
|
- Hostaquick
- Ragadan
- Decisquick
|
|
|
Usually supplied as an emulsifiable concentrate. |
|
|
|
|
|
|
|
2200 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
Miscible |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
| Miscible |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
| 130 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
| 1000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Xylene |
- |
|
|
Not applicable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
64 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
152 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source (closed cup) |
- |
|
|
|
2.09 X 1002 |
Calculated |
- |
|
|
2.32 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.28 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
65 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Highly volatile |
|
|
5.73 X 10-05 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
1.4 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
- |
- |
- |
|
|
1.4 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
General literature DT₅₀ range 0.07-1.8 days (R3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
13 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Non-persistent |
|
|
- |
|
|
7 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Fast |
|
|
2.1 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderately fast |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
N2 N = Various trusts, NGOs & charities data 2 = Unverified data of unknown source |
Moderately mobile |
|
|
163 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
0.26 |
Calculated |
Low leachability |
|
|
|
7.10 X 10-04 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
96 |
Rat |
High |
|
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
|
15 |
- |
|
|
- |
- |
- |
|
|
> 17 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Coturnix japonica |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 98 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Eisenia foetida |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
> 2.19 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Bombus terrestris 72hr |
Moderate |
| - |
|
|
0.53 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Bombus terrestris 72hr |
High |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
Harmful at dose 340 g ha⁻¹ |
AA3 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 3 = Unverified data of known source Chrysoperla carnea |
- |
|
|
- |
- |
- |
|
|
Harmful at dose 340 g ha⁻¹ |
AA3 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 3 = Unverified data of known source Typhlodromus pyri |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.056 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Salmonidae |
High |
|
|
- |
- |
- |
|
|
0.0022 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
35 |
K2 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 2 = Unverified data of unknown source Unknown species |
Low |
|
|
25 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Unknown species |
Low |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
96 |
Rat |
High |
|
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
0.95 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List I; List II |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
No data found |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
IMDG Transport Hazard Class 6.1 |
|
|
Health: H301 Environment: H400, H410 |
|
|
Ib (Highly hazardous) |
|
|
UN2810 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
heptenophos |
|
|
heptenophos |
|
|
Heptenophos |
|
|
heptenophos |
|
|
eptenofos |
|
|
heptenofos |
|
|
heptenophos |
|
|
heptenofos |
|
|
- |
|
|
- |
|
|
heptenofos |
|
|
- |