| Heptachlor (Ref: ENT 15152) |
(Also known as: heptachlore; E3314; H-34; OMS 193) |
| Heptachlor in an insecticide. It has a low aqueous solubility but is highly soluble in most organic solvents. It is volatile and has low potential for leaching to groundwater. heptachlor can be persistent in soil systems but is not generally persistent in water systems. It is moderately toxic to mammals and may bioaccumulate. heptachlor may also cause adverse reproduction/development effects and is a neurotoxin. It is moderately toxic to birds but highly toxic to honeybees and most aquatic species. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Persistent; Potential for particle bound transport: High
 |
Ecotoxicity High alert: Fish acute ecotoxicity: High; Daphnia acute ecotoxicity: High; Bees acute contact ecotoxicity: High
 |
Human health High alert: Endocrine distrupter; Reproduction/development effects; Neurotoxicant
 |
|
|
An obsolete insecticide once used to kill termites, ants and other insects in agricultural and domestic situations |
|
|
Ants; Termites; Cutworms; Maggots; Spittlebugs; Weevils; Wireworms; Japanese beetles; Mosquitoes |
|
|
Corn; Sorghum; Small grains |
|
|
- |
|
|
Considered obsolete but may be available in some countries; Banned in many countries |
|
|
1951, first reported |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
- |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
A molecule with 5 chiral centres. Substance is racemic. |
|
|
C₁₀H₅Cl₇ |
|
|
C1=CC(C2C1C3(C(=C(C2(C3(Cl)Cl)Cl)Cl)Cl)Cl)Cl |
|
|
- |
|
|
FRCCEHPWNOQAEU-UHFFFAOYSA-N |
|
|
InChI=1S/C10H5Cl7/c11-4-2-1-3-5(4)9(15)7(13)6(12)8(3,14)10(9,16)17/h1-5H |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
|
Insecticide |
|
|
Organochloride insecticide; Cyclodiene insecticide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Persistent, non-systemic contact and stomach poison with some fumigant action. Is a chloride channel-blocking agent. |
|
|
76-44-8 |
|
|
200-962-3 |
|
|
36 |
|
|
044801 |
|
|
3589 |
|
|
602-046-00-2 |
|
|
373.32 |
|
|
- |
|
|
1,4,5,6,7,8,8-heptachloro-3a,4,7,7a-tetrahydro-4,7-methanoindene |
|
|
1,4,5,6,7,8,8-heptachloro-3a,4,7,7a-tetrahydro-4,7-methano-1H-indene |
|
|
Chemical subject to PIC regulations; POP - regulated by Stockholm Convention; LRTAP Annex 1; OSPAR soc; Severe Marine Pollutant; Rotterdam Convention (Class O) |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
2A |
|
|
Not applicable |
|
|
Anthonomus grandis, Delia brassicae, Diabrotica longicornis, Psilia rosae, Conoderus falli, Diabrotica virgifera, many others |
|
|
White to tan coloured crystals |
|
|
|
|
|
|
|
|
- Gold crest
- Heptamul
- Heptox
- Drinox
|
|
|
Available in a wide variety of formulations including wettable powders, emulsifiable concentrates, dusts and oil solutions |
|
|
|
|
|
|
|
0.056 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low |
|
|
750000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
| 1060000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Benzene |
- |
| 1020000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Xylene |
- |
| 45000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethanol |
- |
|
|
95 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
135 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
2.75 X 1005 |
Calculated |
- |
|
|
5.44 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
High |
|
|
|
Soluble |
|
- |
|
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
|
1.58 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
53 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Highly volatile |
|
|
3.53 X 1002 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
285 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Persistent |
|
|
- |
- |
- |
|
|
250 |
|
Persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Other sources: DT₅₀ around 2 yrs (R3), 9-10 months (R3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
4.8 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 1.0-13.5 days, 4 field crops, various matrices, n=5 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
1 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Non-persistent |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Non-mobile |
|
|
24000 |
|
|
Other sources: 21878 mL g⁻¹ (R3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
-0.91 |
Calculated |
Low leachability |
|
|
|
5.35 X 10-03 |
Calculated |
- |
|
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW |
|
|
High |
Calculated |
- |
|
|
Non-mobile |
Calculated |
- |
|
|
|
2430 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Whole body |
Threshold for concern |
|
|
Not available |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 147 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
L1 L = Pesticide manuals and hard copy reference books / other sources 1 = Estimated data with little or no verification Rat |
- |
|
|
5 |
- |
|
|
- |
- |
- |
|
|
> 2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 0.526 |
|
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
0.0168 |
R4 R = Peer reviewed scientific publications 4 = Verified data Trigona spinipes |
High |
|
|
Contact |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.007 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
High |
|
|
- |
- |
- |
|
|
0.042 |
Daphnia magna |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.027 |
Pseudokirchneriella subcapitata |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 147 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
195 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Rat |
- |
|
|
2.0 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List I; List II |
- |
- |
|
|
|
Risk of exposure via food is now considered negligible |
|
|
May be absorbed through intact skin |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
UK statutory standard for protection of drinking water: 0.030 µg l⁻¹; EU Directive 2008/105/EC standard for protection of drinking water: 0.030 µg l⁻¹ |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes UK EA QS database 2018 |
- |
|
|
0.03 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes UK EA QS database 2018 |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
✓Yes, known to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Bioaccumulates Liver toxicant Endocrine issues - Binding to cellular estrogen and androgen receptors |
|
|
|
|
|
Incompatible with alkaline substances |
|
|
Health: H301, H311, H351, H373 Environment: H400, H410 |
|
|
II (Moderately hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
heptachlor |
|
|
heptachlore |
|
|
Heptachlor |
|
|
heptachlor |
|
|
eptaclor |
|
|
heptaclor |
|
|
heptachlor |
|
|
heptachlor |
|
|
- |
|
|
- |
|
|
heptachloor |
|
|
- |