| Haloxyfop (Ref: DOWCO 453) |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability
 |
Ecotoxicity Moderate alert: Daphnia acute ecotoxicity: Moderate
 |
Human health Moderate alert: Mammals acute toxicity: Moderate; Possible Carcinogen; Possible Reproduction/development effects
 Warning: Significant data are missing |
|
|
A post-emergence herbicide used to control annual and perennial grass weeds. Also pesticide transformation product. |
|
|
Annual and perennial grass weeds |
|
|
Sugarbeet; Oilseed rape; Potatoes; Onions; Leafy vegetables; Strawberries; Sunflower |
|
|
- |
|
|
- |
|
|
circa 1980 |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Haloxyfop is a chiral molecule. The haloxyfop technical material is an isomeric mixture but it is only the R-isomer that is herbicidally active. |
|
|
C₁₅H₁₁ClF₃NO₄ |
|
|
CC(C(=O)O)OC1=CC=C(C=C1)OC2=C(C=C(C=N2)C(F)(F)F)Cl |
|
|
No data |
|
|
GOCUAJYOYBLQRH-UHFFFAOYSA-N |
|
|
InChI=1S/C15H11ClF3NO4/c1-8(14(21)22)23-10-2-4-11(5-3-10)24-13-12(16)6-9(7-20-13)15(17,18)19/h2-8H,1H3,(H,21,22) |
|
|
Yes |
|
|
Herbicide, Metabolite |
|
|
Soil |
|
|
Aryloxyphenoxypropionate herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Selective, absorbed by roots and foliage. Inhibition of acetyl CoA carboxylase (ACCase) |
|
|
69806-34-4 |
|
|
No data found |
|
|
438 |
|
|
- |
|
|
50895 |
|
|
No data found |
|
|
361.70 |
|
|
rac-(2R)-2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoic acid |
|
|
(RS)-2-{4-[3-chloro-5-(trifluoromethyl)-2-pyridyloxy]phenoxy}propionic acid |
|
|
2-(4-((3-chloro-5-(trifluoromethyl)-2-pyridinyl)oxy)phenoxy)propanoic acid |
|
|
- |
|
|
- |
|
|
A |
|
|
1 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Colourless crystals |
|
|
|
|
|
|
|
|
|
|
1.6 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
1000000 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Acetone |
- |
| 518000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethyl acetate |
- |
| 74000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Xylene |
- |
| 170 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
|
|
107 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Soluble |
|
- |
|
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
|
1.64 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
2.9 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
| Strong acid |
|
|
0.00133 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
9 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
55 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Other data DT₅₀ 3.78-6.96 days (R3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
5.0 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
|
Onion leaves, n=1 |
|
|
|
12 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately fast |
|
|
- |
|
|
|
Stable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable |
|
|
- |
|
|
40 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately fast |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
Moderately mobile |
|
|
75 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
3.70 |
Calculated |
High leachability |
|
|
|
7.63 X 10-01 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
337 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 2150 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
> 100 |
|
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
Harmless at dose 1500 g ha⁻¹ |
AA3 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 3 = Unverified data of known source Chrysoperla carnea |
- |
|
|
- |
- |
- |
|
|
Harmful at dose 1500 g ha⁻¹ |
AA3 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 3 = Unverified data of known source Typhlodromus pyri |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 800 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Low |
|
|
- |
- |
- |
|
|
> 96.4 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 106.5 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Unknown species |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
337 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.00065 |
EU 2006 |
- |
|
|
0.075 |
EU 2006 |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
7-12 |
EU 2006 concentration dependent |
- |
|
|
List II |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
No data found |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Harmful by inhalation and if swallowed Liver and kidney toxicant |
|
|
|
|
|
No information available |
|
|
Health: H302, H318 Environment: H412 |
|
|
II (Moderately hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
haloxyfop |
|
|
haloxyfop |
|
|
Haloxyfop |
|
|
haloxyfop |
|
|
haloxyfop |
|
|
haloxifop |
|
|
- |
|
|
haloksyfop |
|
|
- |
|
|
haloxyfop |
|
|
- |
|
|
- |