| Furalaxyl (Ref: IPE 134) |
(Also known as: CGA 38140) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Slightly mobile; Potential for particle bound transport: Medium
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Bees acute oral ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health Moderate alert: Mammals acute toxicity: Moderate
 |
|
|
A fungicide used to control diseases cause by phycomycetes especially in ornamental plants |
|
|
phycomycetes> |
|
|
Ornamentals; Flowers |
|
|
- |
|
|
Current |
|
|
1977, first reported |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
- |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
A chiral molecule. Substance is racemic. |
|
|
C₁₇H₁₉NO₄ |
|
|
CC1=C(C(=CC=C1)C)N(C(C)C(=O)OC)C(=O)C2=CC=CO2 |
|
|
- |
|
|
CIEXPHRYOLIQQD-UHFFFAOYSA-N |
|
|
InChI=1S/C17H19NO4/c1-11-7-5-8-12(2)15(11)18(13(3)17(20)21-4)16(19)14-9-6-10-22-14/h5-10,13H,1-4H3 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| furalaxyl |
Unstated isomer |
 |
|
|
Fungicide |
|
|
Acylamino acid fungicide; Furanilide fungicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Systemic with protective and curative action. Disrupts fungal nucleic acid synthesis - RNA ploymerase 1 |
|
|
57646-30-7 |
|
|
260-875-1 |
|
|
433 |
|
|
- |
|
|
42504 |
|
|
612-138-00-4 |
|
|
301.34 |
|
|
- |
|
|
methyl N-(2-furoyl)-N-(2,6-xylyl)-DL-alaninate |
|
|
methyl N-(2,6-dimethylphenyl)-N-(2-furanylcarbonyl)-DL-alaninate |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
4 |
|
|
- |
|
|
White crystals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Usually supplied as wettable powder or as granules |
|
|
|
|
|
|
|
230 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
|
600000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Dichloromethane |
- |
| 520000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
| 500000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
| 4000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
|
|
102 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
5.01 X 1002 |
Calculated |
- |
|
|
2.7 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.22 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
0.07 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
9.30 X 10-05 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
48 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
General literature states DT₅₀ 30-65 days |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
200 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
Persistent |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Slightly mobile |
|
|
888 |
|
|
Estimated |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
1.77 |
Calculated |
Low leachability |
|
|
|
5.69 X 10-02 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Slightly mobile |
Calculated |
- |
|
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
940 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
82 |
- |
|
|
- |
- |
- |
|
|
> 6000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Coturnix japonica |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
510 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
> 5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
32.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
39 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
27 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Scenedesmus subspicatus |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
940 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
3100 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
No information available |
|
|
Health: H302 Environment: H412 |
|
|
III (Slightly hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
furalaxyl |
|
|
furalaxyl |
|
|
Furalaxyl |
|
|
furalaxyl |
|
|
furalaxil |
|
|
furalaxil |
|
|
- |
|
|
furalaksyl |
|
|
- |
|
|
- |
|
|
- |
|
|
- |