| Flubenzimine (Ref: BAY SLJ 0312) |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
Ecotoxicity Low alert: Birds acute ecotoxicity: Low
 Warning: Significant data are missing |
Human health Low alert
 Warning: Significant data are missing |
|
|
An obsolete mite growth regulating acaricide |
|
|
Spider mites, Panonychus ulmi; Alternaria leaf spot |
|
|
Apples; Pears; Plums; Damsons; Citrus; Aubergines; Cucumbers |
|
|
- |
|
|
Considered obsolete but may be available in some countries |
|
|
1979, first reported |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
- |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Isomeric |
|
|
C₁₇H₁₀F₆N₄S |
|
|
C1=CC=C(C=C1)N=C2N(C(=NC(F)(F)F)C(=NC(F)(F)F)S2)C3=CC=CC=C3 |
|
|
C1=CC=C(C=C1)N=C2N(/C(=N\C(F)(F)F)/C(=N\C(F)(F)F)/S2)C3=CC=CC=C3 |
|
|
IZFZCMFMJKDHJZ-BANPTERESA-N |
|
|
InChI=1S/C17H10F6N4S/c18-16(19,20)25-13-14(26-17(21,22)23)28-15(24-11-7-3-1-4-8-11)27(13)12-9-5-2-6-10-12/h1-10H/b24-15-,25-13-,26-14+ |
|
|
Yes |
|
|
Acaricide, Miticide, Insecticide |
|
|
Thiazolidine insecticide; Thiazolidine acaricide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Reduces mycelial growth by intracellular destruction. Contact action. |
|
|
37893-02-0 |
|
|
253-703-1 |
|
|
428 |
|
|
- |
|
|
91625 |
|
|
613-118-00-8 |
|
|
416.05 |
|
|
(2Z,4E,5Z)-N2,3-diphenyl-N4,N5-bis(trifluoromethyl)-1,3-thiazolidine-2,4,5-triimine |
|
|
(2Z,4E,5Z)-N2,3-diphenyl-N4,N5-bis(trifluoromethyl)-1,3-thiazolidine-2,4,5-triimine |
|
|
[N(Z)]-N-[(4E,5Z)-3-phenyl-4,5-bis[(trifluoromethyl)imino]-2-thiazolidinylidene]benzenamine |
|
|
OSPAR soc |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not known |
|
|
Not known |
|
|
- |
|
|
Orange powder |
|
|
|
|
|
|
|
|
|
|
|
Usually supplied as a wettable or water-dispersible powder |
|
|
|
|
|
|
|
1.6 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
200000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Toluene |
- |
| 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Isoproanol |
- |
|
|
118.7 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
4.57 X 1006 |
Calculated |
- |
|
|
6.66 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.44 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
|
- |
- |
- |
| - |
|
|
1.00 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
2.60 X 10-01 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
10000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
High potential |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
2150 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 4500 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Coturnix japonica |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
Harmless |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Chrysoperla carnea |
- |
|
|
- |
- |
- |
|
|
Moderately harmful |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Typhlodromus pyri |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
2150 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List II |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
No information available |
|
|
Health: H319 Environment: H400, H410 |
|
|
Not classified: Obsolete |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
flubenzimine |
|
|
flubenzimine |
|
|
Flubenzimin |
|
|
flubenzimin |
|
|
flubenzimina |
|
|
fluenzimina |
|
|
- |
|
|
flubenzimina |
|
|
- |
|
|
- |
|
|
- |
|
|
- |