| Fluacrypyrim |
(Also known as: NA 83) |
| Fluacrypyrim is an acaricide. It has a low water solubility and is volatile. Little is known about its persistence in soils but it can be persistent in aquatic systems. It has a low level of toxicity to mammals. It shows a moderate to high level of toxicity to most aquatic species, earthworms and birds. It is not particularly toxic to honey bees. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
Ecotoxicity High alert: Daphnia acute ecotoxicity: High
 |
Human health Low alert
 Warning: Significant data are missing |
|
|
A strobilurin analog effective against various spider mites at low concentrations on fruit and vegetable crops |
|
|
Various mites |
|
|
Fruit; Vegetables |
|
|
- |
|
|
Current |
|
|
2000, USA registered |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Isomeric. Fluacrypyrim has one E/Z centre |
|
|
C₂₀H₂₁F₃N₂O₅ |
|
|
CC(C)OC1=NC(=CC(=N1)OCC2=CC=CC=C2C(=COC)C(=O)OC)C(F)(F)F |
|
|
CC(C)OC1=NC(=CC(=N1)OCC2=CC=CC=C2/C(=C\OC)/C(=O)OC)C(F)(F)F |
|
|
MXWAGQASUDSFBG-RVDMUPIBSA-N |
|
|
InChI=1S/C20H21F3N2O5/c1-12(2)30-19-24-16(20(21,22)23)9-17(25-19)29-10-13-7-5-6-8-14(13)15(11-27-3)18(26)28-4/h5-9,11-12H,10H2,1-4H3/b15-11+ |
|
|
Yes |
|
|
Acaricide, Miticide, Insecticide |
|
|
Methoxyacrylate strobilurin acaricide; Methoxyacrylate strobilurin insecticide; Strobilurin insecticide; Strobilurin acaricide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Mitochondrial complex III electron transport inhibitor - at Qo site. |
|
|
229977-93-9 |
|
|
607-186-8 |
|
|
None allocated |
|
|
- |
|
|
9954185 |
|
|
No data found |
|
|
426.39 |
|
|
methyl (2E)-3-methoxy-2-[2-({[2-(propan-2-yloxy)-6-(trifluoromethyl)pyrimidin-4-yl]oxy}methyl)phenyl]prop-2-enoate |
|
|
methyl (E)-2-{α-[2-isopropoxy-6-(trifluoromethyl)pyrimidin-4-yloxy]-o-tolyl}-3-methoxyacrylate |
|
|
methyl (αE)-α-(methoxymethylene)-2-[[[2-(1-methylethoxy)-6-trifluoromethyl)-4-pyrimidinyl]oxy]methyl]benzeneacetate |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
20C |
|
|
Not applicable |
|
|
- |
|
|
White powder |
|
|
|
|
|
|
|
0.344 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Low |
|
|
278000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Acetone |
- |
| 27100 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Methanol |
- |
| 15100 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Ethanol |
- |
| 119000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Xylene |
- |
|
|
108 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
3.16 X 1004 |
Calculated |
- |
|
|
4.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.26 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
|
- |
- |
- |
| - |
|
|
0.006 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
Low volatility |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
26 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Slow |
|
|
- |
|
|
|
Stable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable |
|
|
Stable pH 4 to pH 7, DT₅₀ 574 days at pH 9 |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
2250 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Colinus virginianus |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
23 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 10 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Apis mellifera |
Moderate |
|
|
15 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Apis mellifera |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.195 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Cyprinus carpio |
Moderate |
|
|
- |
- |
- |
|
|
0.09 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.017 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Pseudokirchneriella subcapitata |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
|
5.09 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat 4 hr |
- |
|
|
- |
- |
- |
|
|
0.059 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Japan |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List II |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
No data found |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
No information available |
|
|
- |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
fluacrypyrim |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |