| Fenvalerate (Ref: OMS 2000) |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Potential for particle bound transport: High
 |
Ecotoxicity High alert: Fish acute ecotoxicity: High; Fish chronic ecotoxicity: High; Daphnia acute ecotoxicity: High; Daphnia chronic ecotoxicity: High; Bees acute contact ecotoxicity: High
 |
Human health High alert: Endocrine distrupter
 |
|
|
An insecticide and acaricide used to control a range of pests especially those with resistance to organochlorine, organophosphate and carbamate insecticides |
|
|
Various insects belongs to the Lepidoptera, Diptera, Orthoptera, Hemiptera, and Coleoptera families, Blackfly, Mosquitoes, Termites |
|
|
Cotton; Soybeans; Various vegetables; Fruit including apples, pears, peaches, grapes; Nuts |
|
|
- |
|
|
Current |
|
|
1976 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Portugal |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
A molecule with 2 chiral centres, fenvalerate is a mixture of four optical isomers which have different insecticidal activities. The 2-S alpha (or SS) configuration is the most insecticidally active isomer. |
|
|
C₂₅H₂₂ClNO₃ |
|
|
CC(C)C(C1=CC=C(C=C1)Cl)C(=O)OC(C#N)C2=CC(=CC=C2)OC3=CC=CC=C3 |
|
|
- |
|
|
NYPJDWWKZLNGGM-UHFFFAOYSA-N |
|
|
InChI=1S/C25H22ClNO3/c1-17(2)24(18-11-13-20(26)14-12-18)25(28)30-23(16-27)19-7-6-10-22(15-19)29-21-8-4-3-5-9-21/h3-15,17,23-24H,1-2H3 |
|
|
Yes |
|
|
Insecticide, Acaricide, Termiticide, Veterinary substance |
|
|
Pyrethroid insecticide; Pyrthroid acaricide; Pyrethroid ester insecticide; Pyrethroid ester acaricide |
|
|
92% |
|
|
- |
|
|
Synthetic |
|
|
Non-systemic with contact and stomach action. Sodium channel modulator. |
|
|
51630-58-1 |
|
|
257-326-3 |
|
|
334 |
|
|
109301 |
|
|
3347 |
|
|
No data found |
|
|
419.90 |
|
|
(E)-cyano(3-phenoxyphenyl)methyl (2E)-2-(4-chlorophenyl)-3-methylbutanoate |
|
|
(RS)-α-cyano-3-phenoxybenzyl (RS)-2-(4-chlorophenyl)-3-methylbutyrate |
|
|
cyano(3-phenoxyphenyl)methyl 4-chloro-α-(1-methylethyl)benzeneacetate |
|
|
Chemical subject to PIC regulations |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
3A |
|
|
Not applicable |
|
|
Aphis gossypii, Bemisia tabaci, Blattella germanica, Myzus persicae, Psylla pyricola, Spodoptera litura, many others |
|
|
Viscous yellow-brown liquid |
|
|
|
|
|
- Sumitomo
- Shell
- SDS Biotech
- BOC Sciences
|
|
|
- Sumicidin
- Pydrin
- Belmark
- Ectrin
|
|
|
Supplied in a variety of formulations including emulsifiable concentrates, ULV, wettable powders & granules |
|
|
|
|
|
|
|
0.001 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Low |
|
|
53000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source n-Hexane |
- |
| 200000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Xylene |
- |
| 84000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
|
|
39.5 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
|
Decomposes on distillation |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
230 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
|
1.02 X 1005 |
Calculated |
- |
|
|
5.01 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
|
Soluble |
|
- |
|
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
|
1.175 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
0.0192 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Low volatility |
|
|
4.20 X 10-02 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
40 |
M4 M = GLEAMS Model database (Groundwater Loading Effects of Agricultural Management Systems). Dataset no longer available. 4 = Verified data |
Moderately persistent |
|
|
77 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Other sources: DT₅₀ 35 days (DW4) |
|
|
|
5.7 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 2.8-9.5 days, 7 field crops, various matrices, n=8 |
|
|
|
5.2 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 0.7-15.0 days, 16 field & undercover grown crops, various matrices, n=25 |
|
|
|
9.2 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderately fast |
|
|
- |
|
|
|
115 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Persistent |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Non-mobile |
|
|
5273 |
|
|
- |
|
|
|
13.11 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
- |
|
|
0.96 |
|
|
Soil with 68% loam, 24% silt, 8% clay, pH 6.5, OC=2.1% |
|
|
- |
|
|
|
|
|
|
|
0.52 |
Calculated |
Low leachability |
|
|
|
1.06 X 10-02 |
Calculated |
- |
|
|
- |
|
|
High |
Calculated |
- |
|
|
Non-mobile |
Calculated |
- |
|
|
|
1664 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data (Other literature log BCF range 2.6-3.6 (R3)) |
Threshold for concern |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
451 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
|
250 |
- |
|
|
- |
- |
- |
|
|
9932 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
40 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
0.23 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Apis mellifera |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.09 |
R4 R = Peer reviewed scientific publications 4 = Verified data Trigona spinipes |
Moderate |
|
|
Contact |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Harmful |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Typhlodromus pyri |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.0036 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
High |
|
|
0.002 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Clarias batrachus 14 day |
High |
|
|
0.001 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna |
High |
|
|
> 0.00003 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna |
High |
|
|
0.000005 |
Americamysis bahia |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
50 |
W2 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 2 = Unverified data of unknown source Unknown species |
Low |
|
|
5.0 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Synechococcus elongatus 14 day |
Low |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
451 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
1000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
|
> 0.101 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
0.0125 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
✓Yes, known to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
?Possibly, status not identified |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
May cause abdominal pain, convulsions and vomiting if ingested Cardiovascular and blood toxicant IARC Group 3 carcinogen Endocrine issues - Inhibition of estrogen-sensitive cells proliferation |
|
|
|
|
|
IMDG Transport Hazard Class 6.1 |
|
|
Health: H301, H315, H319, H332, H335 Environment: H400, H410 |
|
|
II (Moderately hazardous) |
|
|
UN2811 |
|
|
- |
|
|
Limited shelf-life |
|
|
|
|
|
fenvalerate |
|
|
fenvalérate |
|
|
Fenvalerat |
|
|
fenvalerat |
|
|
fenvalerate |
|
|
fenvalerato |
|
|
- |
|
|
fenwalerat |
|
|
- |
|
|
- |
|
|
fenvaleraat |
|
|
- |