| Fensulfothion (Ref: ENT 24945) |
(Also known as: HSDB 1580) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: GUS: Transition state; Drainflow: Moderately mobile
 |
Ecotoxicity High alert: Birds acute ecotoxicity: High; Fish acute ecotoxicity: High; Bees acute unknown ecotoxicity: High
 Warning: Significant data are missing |
Human health High alert: Mammals acute toxicity: High; Acetyl cholinesterase inhibitor; Neurotoxicant
 Warning: Significant data are missing |
|
|
Largely obsolete compound formerly used against soil insects in a wide range of crops |
|
|
Soil nematodes, Soil-borne insects |
|
|
Field crops; Vegetables; Fruit; Turf; Ornamentals |
|
|
- |
|
|
Considered obsolete but may be available in some countries |
|
|
1967, first reported |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Fensulfothion is a chiral molecule. The technical material is a mixture of the cis- and trans-isomers. |
|
|
C₁₁H₁₇O₄PS₂ |
|
|
CCOP(=S)(OCC)OC1=CC=C(C=C1)S(=O)C |
|
|
No data |
|
|
XDNBJTQLKCIJBV-UHFFFAOYSA-N |
|
|
InChI=1S/C11H17O4PS2/c1-4-13-16(17,14-5-2)15-10-6-8-11(9-7-10)18(3)12/h6-9H,4-5H2,1-3H3 |
|
|
Yes |
|
|
Insecticide, Nematicide |
|
|
Organophosphate |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Cholinesterase inhibitor. Contact action. |
|
|
115-90-2 |
|
|
204-114-3 |
|
|
303 |
|
|
032701 |
|
|
8292 |
|
|
015-090-00-7 |
|
|
308.35 |
|
|
O,O-diethyl O-[4-(methanesulfinyl)phenyl] phosphorothioate |
|
|
O,O-diethyl O-4-methylsulfinylphenyl phosphorothioate |
|
|
O,O-diethyl O-(4-(methylsulfinyl)phenyl) phosphorothioate |
|
|
Marine Pollutant |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
1B |
|
|
Not applicable |
|
|
Delia antiqua, Diabrotica undecimpunctata, Culex pipiens |
|
|
Yellow to brown coloured liquid |
|
|
|
|
|
|
|
|
|
|
|
Available in a wide range of formulations including emulsifiable concentrates and granules |
|
|
|
|
|
|
|
1540 |
|
High |
|
|
- |
- |
- |
|
|
25 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
138 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.70 X 1002 |
Calculated |
- |
|
|
2.23 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.20 |
|
- |
|
|
- |
- |
- |
| - |
|
|
6.7 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderately volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
30 |
|
Moderately persistent |
|
|
14 |
|
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
General literature DT₅₀ range 14-180 days |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
3.0 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 2.7-3.3 days, leaves of 2 field grown crops, n=2 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
72.5 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderately persistent |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderately mobile |
|
|
91 |
|
|
General literature Koc range 77-105 mL g⁻¹ |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
2.34 |
Calculated |
Transition state |
|
|
|
7.66 X 10-02 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
2.2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 1.2 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Coturnix japonica |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.337 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.072 |
Lepomis macrochirus |
High |
|
|
> 2.72 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Pimephales promelas 27 day |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
2.2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
High |
|
|
3.0 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
- |
|
|
0.113 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List I |
- |
- |
|
|
|
- |
|
|
Absorbed through the skin, by inhalation and from the gastrointestinal tract |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
| No data found |
No data found |
|
|
|
|
Very toxic |
|
|
|
|
|
No information available |
|
|
- |
|
|
Ia (Extremely hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
fensulfothion |
|
|
fensulfothion |
|
|
Fensulfothion |
|
|
- |
|
|
- |
|
|
fensulfotion |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |