| Fenoxaprop-P (Ref: AE-F088406) |
(Also known as: HOE 088406) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Moderately mobile
 |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Fish chronic ecotoxicity: Moderate; Daphnia chronic ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health High alert: Reproduction/development effects
 Warning: Significant data are missing |
|
|
Chemical transformation product, parent of the ethyl derivative |
|
|
Goosegrass; Grabgrass; Bermuda grass; Barnyard grass; Foxtails |
|
|
Turf; Ornamentals; Rice |
|
|
- |
|
|
Current |
|
|
1989, first reported |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Austria/Finland |
|
|
31/12/2023 |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| ✓ |
✓ |
✓ |
✓ |
✓ |
|
✓ |
✓ |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
|
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
|
✓ |
|
|
|
|
|
|
Fenoxaprop is a chiral molecule existing in the R- and S-forms. Fenoxaprop-P is the R-isomer. |
|
|
C₁₆H₁₂ClNO₅ |
|
|
CC(C(=O)O)OC1=CC=C(C=C1)OC2=NC3=C(O2)C=C(C=C3)Cl |
|
|
C[C@H](C(=O)O)OC1=CC=C(C=C1)OC2=NC3=C(O2)C=C(C=C3)Cl |
|
|
MPPOHAUSNPTFAJ-SECBINFHSA-N |
|
|
InChI=1S/C16H12ClNO5/c1-9(15(19)20)21-11-3-5-12(6-4-11)22-16-18-13-7-2-10(17)8-14(13)23-16/h2-9H,1H3,(H,19,20)/t9-/m1/s1/f/h19H |
|
|
Yes |
|
|
Metabolite, Herbicide |
|
|
Soil, Surface water, Sediment, Groundwater |
|
|
Aryloxyphenoxypropionate |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Not applicable |
|
|
113158-40-0 |
|
|
601-237-8 |
|
|
484 |
|
|
Not applicable |
|
|
- |
|
|
No data found |
|
|
333.72 |
|
|
- |
|
|
(R)-2-[4-(6-chloro-1,3-benzoxazol-2-yloxy)phenoxy]propionic acid |
|
|
(2R)-2-[4-[(6-chloro-2-benzoxazolyl)oxy]phenoxy]propanoic acid |
|
|
- |
|
|
- |
|
|
A |
|
|
1 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Pale browm powder |
|
|
|
|
|
|
|
|
- Headland Agrochemicals Limited
|
|
|
|
|
|
- |
|
|
|
|
|
|
|
61000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
6.76 X 1001 |
Calculated |
- |
|
|
1.83 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
0.18 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
5.0 |
|
Non-persistent |
|
|
5.0 |
|
Non-persistent |
|
|
8.0 |
|
Non-persistent |
|
|
24.8 |
|
Non-persistent |
|
|
26.5 |
|
- |
|
|
- |
- |
- |
|
|
EU 2018 dossier lab studies DT₅₀ (normalised) range 2.3-15.3 days, DT₉₀ range 9.8-54.7 days, Soils=8; Field studies DT₅₀ range 7.2-8.8 days, DT₉₀ range 23.8-29.2 days, Soils=2 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
320 |
|
Persistent |
|
|
- |
|
|
125 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Slow |
|
|
10 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderately fast |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
|
3.9 |
|
Moderately mobile |
|
|
282 |
|
|
0.787 |
|
|
EU 2018 dossier Kf range 1.17-8.76 mL g⁻¹, Kfoc range 145-568 mL g⁻¹, 1/n range = 0.719-0.880, Soils=5 |
|
|
No |
|
|
|
|
|
|
|
1.40 |
Calculated |
Low leachability |
|
|
|
1.44 X 10-02 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1000 |
Eisenia foetida 56 days |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
>= 111.6 |
Folsomia candida 28d |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 100 |
Apis mellifera as ethyl variant |
Low |
|
|
> 109.5 |
Apis mellifera as ethyl variant |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
> 100 |
Bombus terrestris as ethyl variant |
Low |
| - |
|
|
> 124.5 |
Bombus terrestris as ethyl variant |
Low |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
72.2 |
Oncorhynchus mykiss |
Moderate |
|
|
3.2 |
Oncorhynchus mykiss |
Moderate |
|
|
126 |
Daphnia magna |
Low |
|
|
1 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
34.2 |
Pseudokirchneriella subcapitata |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.01 |
|
- |
|
|
0.1 |
|
- |
|
|
- |
- |
- |
|
|
0.014 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
No data found |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
?Possibly, status not identified |
✓Yes, known to cause a problem |
| Eye irritant |
Phototoxicant |
|
| No data found |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
No information available |
|
|
Health: H317. H373 Environment: H400, H410 |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
fenoxaprop-P |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
fenoksaprop-P |
|
|
- |
|
|
- |
|
|
- |
|
|
- |