| Ethiofencarb (Ref: BAY 108594) |
(Also known as: ethiophencarbe; HOX 1901) |
| Ethiofencarb is a carbamate insecticide. It is highly soluble in water and has a low volatility. Depending on local conditions it may be moderately persistent in soils but it is not expected to be persistent in water systems. Based on its physicochemical properties there is a high risk of ethiofencarb leaching to groundwater. It is highly toxic to bumblebees via the oral route but moderately toxic to most other biodiversity. Ethiofencarb is moderately toxic to mammals if ingested and is an acetylecholinesterase inhibitor. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability; Drainflow: Mobile
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Birds acute ecotoxicity: Moderate; Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Bees acute contact ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health High alert: Acetyl cholinesterase inhibitor
 Warning: Significant data are missing |
|
|
A phenyl methylcarbamate insecticide used mainly to control aphids |
|
|
Aphids |
|
|
Fruit; Vegetables; Sugarbeet; Cotton; Maize; Potatoes; Tobacco; Ornamentals |
|
|
- |
|
|
- |
|
|
circa 1975 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₁H₁₅NO₂S |
|
|
CCSCC1=CC=CC=C1OC(=O)NC |
|
|
- |
|
|
HEZNVIYQEUHLNI-UHFFFAOYSA-N |
|
|
InChI=1S/C11H15NO2S/c1-3-15-8-9-6-4-5-7-10(9)14-11(13)12-2/h4-7H,3,8H2,1-2H3,(H,12,13)/f/h12H |
|
|
Yes |
|
|
Insecticide |
|
|
Carbamate insecticide; Phenyl methylcarbamate insecticide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Systemic with contact and stomach action. Acetylcholinesterase (AChE) inhibitor. |
|
|
29973-13-5 |
|
|
249-981-9 |
|
|
363 |
|
|
112101 |
|
|
34766 |
|
|
006-048-00-9 |
|
|
225.31 |
|
|
2-[(ethylsulfanyl)methyl]phenyl methylcarbamate |
|
|
α-ethylthio-o-tolyl methylcarbamate |
|
|
2-[(ethylthio)methyl]phenyl methylcarbamate |
|
|
Possible groundwater contaminant. |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
1A |
|
|
Not applicable |
|
|
Myzus persicae, Phorodon humuli |
|
|
Colourless crystals |
|
|
|
|
|
|
|
|
|
|
|
Usually formulated as granules or as an emulsifiable concentrate |
|
|
|
|
|
|
|
1900 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
High |
|
|
7500 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
| 200000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Toluene |
- |
| 200000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Dichloromethane |
- |
|
|
33.4 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
Decomposes on distillation |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
- |
|
|
- |
- |
- |
|
|
123 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
|
1.10 X 1002 |
Calculated |
- |
|
|
2.04 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.23 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
0.5 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Low volatility |
|
|
1.17 X 10-04 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
37 |
K5 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 5 = Verified data used for regulatory purposes |
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
General literature DT₅₀ range 34-131 days (R3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
Rapid in sunlight |
|
|
|
16 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Non-persistent |
|
|
- |
|
|
52 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderately fast |
|
|
21 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Slow |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
Mobile |
|
|
52 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
3.58 |
Calculated |
High leachability |
|
|
|
5.89 X 10-01 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Mobile |
Calculated |
- |
|
|
|
75 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Low potential |
|
|
Not available |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
200 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
155 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Phasianidae |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
120 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
1.54 |
Apis mellifera |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
> 0.205 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Bombus terrestris |
High |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
Harmful at dose 300 g ha⁻¹ |
AA3 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 3 = Unverified data of known source Chrysoperla carnea |
- |
|
|
- |
- |
- |
|
|
Harmful at dose 300 g ha⁻¹ |
AA3 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 3 = Unverified data of known source Typhlodromus pyri |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
3.4 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Unknown species |
Moderate |
|
|
- |
- |
- |
|
|
0.22 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Unknown species |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
200 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Moderate |
|
|
1000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
0.2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
0.1 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
✓Yes, known to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
No data found |
No data found |
| Eye irritant |
Phototoxicant |
|
| No data found |
No data found |
|
|
|
|
Highly toxic |
|
|
|
|
|
IMDG Transport Hazard Class 6,1 |
|
|
Health: H302 Environment: H400, H410 |
|
|
Ib (Highly hazardous) |
|
|
UN2757 |
|
|
- |
|
|
- |
|
|
|
|
|
ethiofencarb |
|
|
ethiofencarbe |
|
|
Ethiofencarb |
|
|
ethiofencarb |
|
|
etiofencarb |
|
|
etiofencarb |
|
|
ethiofencarb |
|
|
etiofenkarb |
|
|
- |
|
|
- |
|
|
ethiofencarb |
|
|
- |