| EPTC (Ref: R 1608) |
(Also known as: ethyl dipropylthiocarbamate; epthame; eptam) |
| EPTC is a selective herbicide. It is moderately soluble in water and is highly volatile. It is not expected to be persistent in soil systems but may be in water depending on local conditions. There may be a risk of drift. EPTC is moderately toxic to most biodiversity. This substance is also moderateoly toxic to mammals via the oral route. EPTC is an acetyl cholinesterase inhibitor, a neurotoxin and an irritant. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: GUS: Transition state; Drainflow: Moderately mobile
 |
Ecotoxicity Moderate alert: Birds acute ecotoxicity: Moderate; Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Daphnia chronic ecotoxicity: Moderate; Bees acute oral ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health High alert: Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
|
A herbicide used for pre-emergence control of annual and perennial grasses plus some broad-leaved weeds |
|
|
Couch; Sedges; Bermudagrass; Pigweed; Lambsquarters; Nightshade; Foxtails; Barnyard grass; bents |
|
|
Vegetables including peas, beans; Alfalfa; Forage legumes; Potatoes; Corn; Sweet potatoes |
|
|
- |
|
|
Current |
|
|
circa 1957 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₉H₁₉NOS |
|
|
CCCN(CCC)C(=O)SCC |
|
|
No data |
|
|
GUVLYNGULCJVDO-UHFFFAOYSA-N |
|
|
InChI=1S/C9H19NOS/c1-4-7-10(8-5-2)9(11)12-6-3/h4-8H2,1-3H3 |
|
|
Yes |
|
|
Herbicide |
|
|
Thiocarbamate herbicide; Carbamate herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Selective, systemic absorbed by roots and shoots. Lipid synthesis inhibitor. |
|
|
759-94-4 |
|
|
212-073-8 |
|
|
155 |
|
|
041401 |
|
|
12968 |
|
|
006-030-00-0 |
|
|
189.3 |
|
|
S-ethyl dipropylcarbamothioate |
|
|
S-ethyl dipropyl(thiocarbamate) |
|
|
S-ethyl dipropylcarbamothioate |
|
|
Potential groundwater contaminant; PAN listed Highly Hazardous Chemical; Risk of drift. |
|
|
- |
|
|
K3 |
|
|
15 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Pale yellow liquid |
|
|
|
|
|
|
|
|
- Eradicane
- Eptam
- Genep
- Shortstop
|
|
|
Usually formulated as an emulsifiable concentrate or as granules |
|
|
|
|
|
|
|
370 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderate |
|
|
Miscible |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Acetone |
- |
| Miscible |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Benzene |
- |
| Miscible |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Xylene |
- |
| Miscible |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Ethanol |
- |
|
|
Not applicable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
127 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
200 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
- |
|
|
110 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
|
1.58 X 1003 |
Calculated |
- |
|
|
3.2 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.96 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
Not applicable |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
| No dissociation |
|
|
4500 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Highly volatile |
|
|
5.00 X 10-06 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
6 |
M3 M = GLEAMS Model database (Groundwater Loading Effects of Agricultural Management Systems). Dataset no longer available. 3 = Unverified data of known source |
Non-persistent |
|
|
- |
- |
- |
|
|
18 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Literature DT₅₀ range 6-30 days in the field; Other sources: DT₅₀ 30-60 days (R3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
300 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data |
Persistent |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Moderately mobile |
|
|
300 |
|
|
Other literature sources: 109-240 mL g⁻¹ (R3) |
|
|
|
0.76 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Moderately mobile |
|
|
187.7 |
|
|
0.905 |
|
|
Literature data: Kf range 0.36-0.47 mL g⁻¹, Kfoc range 153-222 mL g⁻¹, 1/n range 0.826-0.984, soils=2 |
|
|
- |
|
|
|
|
|
|
|
2.17 |
Calculated |
Transition state |
|
|
|
7.50 X 10-02 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
60 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Low potential |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
916 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 21 day |
- |
|
|
326 |
- |
|
|
- |
- |
- |
|
|
1000 |
Anas platyrhynchos |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
267 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
11.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
14 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Lepomis macrochirus |
Moderate |
|
|
- |
- |
- |
|
|
14 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
0.81 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
2.9 |
Lemna gibba 96 hour |
Moderate |
|
|
5.46 |
Pseudokirchneriella subcapitata |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
916 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Moderate |
|
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
3.8 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
IMDG Transport Hazard Class 6,1 |
|
|
Health: H302 |
|
|
II (Moderately hazardous) |
|
|
UN3006 |
|
|
- |
|
|
- |
|
|
|
|
|
EPTC |
|
|
EPTC |
|
|
EPTC |
|
|
EPTC |
|
|
EPTC |
|
|
EPTC |
|
|
EPTC |
|
|
EPTC |
|
|
EPTC |
|
|
EPTC |
|
|
EPTC |
|
|
- |