| Endothal |
(Also known as: endothall; endothal acid) |
| Endothal is a selective, contact herbicide. It is highly soluble in water and semi-volatile. Based on its chemical properties it is not expected to leach to groundwater. It is generally non-persistent in soils. Endothal is highly toxic to mammals but is not expected to bioaccumulate. It is a recognised irritant. It is moderately toxic to fish and aquatic organisms but is less toxic to birds. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Moderately mobile
 |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Fish chronic ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Daphnia chronic ecotoxicity: Moderate
 |
Human health High alert: Mammals acute toxicity: High
 |
|
|
A erbicide, defoliant plant growth regulator and algicide used to control annual grasses, broad-leaved and aquatic weeds |
|
|
Plankton; Pondweed; Coontail; Milfoil; Algae; Fathen; Chickweed |
|
|
Aquatic situations; Sugarbeet; Spinach; Turf; Alfalfa; Potatoes; Cotton |
|
|
- |
|
|
Current |
|
|
circa 1952 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
A chiral molecule with 4 theoretical stereoisomers. The rel-(1R,2S,3R,4S)- isomer is the most effective herbicide. |
|
|
C₈H₁₀O₅ |
|
|
C1CC2C(C(C1O2)C(=O)O)C(=O)O |
|
|
No data |
|
|
GXEKYRXVRROBEV-UHFFFAOYSA-N |
|
|
InChI=1S/C8H10O5/c9-7(10)5-3-1-2-4(13-3)6(5)8(11)12/h3-6H,1-2H2,(H,9,10)(H,11,12) |
|
|
Yes |
|
|
Herbicide, Algicide, Plant Growth Regulator |
|
|
Dicarboxylic acid |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Selective, contact, absorbed through leaves and roots |
|
|
145-73-3 |
|
|
205-660-5 |
|
|
154 |
|
|
038901 |
|
|
3225 |
|
|
607-150-00-1 |
|
|
186.16 |
|
|
(1E,2E,3E,4E)-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
|
|
7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
|
|
7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
|
|
- |
|
|
- |
|
|
R |
|
|
31 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Colourless to white crystals |
|
|
|
|
|
|
|
|
- Hydout
- Herbicide 273
- Tribetol
- Des-I-Cate
- Aquathol
|
|
|
Usually supplied as an aquatic suspension or a granular formulation. |
|
|
|
|
|
|
|
100000 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
High |
|
|
280000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
| 76000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Dioxane |
- |
| 70000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
| 100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Benzene |
- |
|
|
144 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
8.13 X 1001 |
Calculated |
- |
|
|
1.91 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.43 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
3.4 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
| pKa(2) 6.7 |
|
|
2.09 X 10-05 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low volatility |
|
|
3.90 X 10-11 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
5 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Non-persistent |
|
|
- |
- |
- |
|
|
7 |
|
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Moderately mobile |
|
|
85 |
|
|
Other sources: Koc 124 mL g⁻¹ (US3, DW3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
1.75 |
Calculated |
Low leachability |
|
|
|
1.22 X 10-02 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
0.4 |
Whole fish |
Low potential |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
51 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Rat |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 5000 |
Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 78 |
Oncorhynchus mykiss |
Moderate |
|
|
1.3 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Pimephales promelas 31 day |
Moderate |
|
|
> 32.5 |
Daphnia magna |
Moderate |
|
|
< 2.2 |
Daphnia magna |
Moderate |
|
|
> 150 |
Americamysis bahia |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
50 |
Pseudokirchneriella subcapitata 10 day |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
51 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Rat |
High |
|
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
|
0.68 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
?Possibly, status not identified |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Toxic Corrosive effects on gastrointestinal tract |
|
|
|
|
|
Not explected to autoignite, Not highly flammable |
|
|
Health: H301, H312, H315, H319, H335 |
|
|
II (Moderately hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
endothal |
|
|
endothal |
|
|
Endothal |
|
|
endothal |
|
|
endotal |
|
|
endotal |
|
|
endothal |
|
|
endotal |
|
|
- |
|
|
- |
|
|
endothal |
|
|
- |