| Dodemorph |
(Also known as: doazine) |
| Dodemorph is a morpholine fungicide which is currently approved for use in both the UK and the EU. It is moderately soluble in water and most organic solvents. It is moderately persistent in soil and is non-mobile. Based on its physico-chemical parameters, dodemorph is not expected to leach to groundwater. It demonstrates a low toxicity to mammals but a moderate level of toxicity to bees, fish and aquatic invertebrates. Limited data is available on its toxicity to humans but some reports suggest it is a possible reproduction/developmental toxin as well as an irritant. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Potential for particle bound transport: High
 |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Bees acute contact ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health High alert: Reproduction/development effects
 |
|
|
A fungicide for powdery mildew control |
|
|
Powdery mildews |
|
|
Ornamentals including greenhouse and field-grown roses |
|
|
Roses/Powdery mildew=High |
|
|
Current |
|
|
circa 1967 |
|
|
Approved |
|
|
31/08/2025 |
|
|
No data |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Netherlands/Italy |
|
|
31/08/2023 |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
✓ |
|
✓ |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
✓ |
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
✓ |
|
|
|
|
|
|
|
|
|
|
|
|
A molecule with 2 chiral centres, dodemorph consists of a cis-trans isomeric mixture |
|
|
C₁₈H₃₅NO |
|
|
CC1CN(CC(O1)C)C2CCCCCCCCCCC2 |
|
|
No data |
|
|
JMXKCYUTURMERF-UHFFFAOYSA-N |
|
|
InChI=1S/C18H35NO/c1-16-14-19(15-17(2)20-16)18-12-10-8-6-4-3-5-7-9-11-13-18/h16-18H,3-15H2,1-2H3 |
|
|
Yes |
|
|
Fungicide |
|
|
Morpholine fungicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Systemic with protective and curative action. Inhibits sterol biosynthesis in membranes |
|
|
1593-77-7 |
|
|
216-474-9 |
|
|
300 |
|
|
268600 |
|
|
61899 |
|
|
613-057-00-7 |
|
|
281.48 |
|
|
4-cyclododecyl-2,6-dimethylmorpholine |
|
|
4-cyclododecyl-2,6-dimethylmorpholine |
|
|
4-cyclododecyl-2,6-dimethylmorpholine |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
5 |
|
|
- |
|
|
Colourless solid (cis-isomer) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Usually supplied as an emulsifiable concentrate |
|
|
|
|
|
|
|
100 |
|
Moderate |
|
|
50000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethanol |
- |
| 1000000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Chloroform |
- |
| 57000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
| 185000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethyl acetate |
- |
|
|
41.5 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
3.98 X 1004 |
Calculated |
- |
|
|
4.6 |
|
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.89 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
|
8.08 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
| Weak acid |
|
|
0.48 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
7.70 X 10-01 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
41 |
W4 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 4 = Verified data |
Moderately persistent |
|
|
41 |
|
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
EU dossier lab studies DT₅₀ range 24 (loamy sand) - 125 (sandy loam) days |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
53 |
|
Moderately fast |
|
|
1.3 |
|
Moderately fast |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
|
224 |
|
Non-mobile |
|
|
25200 |
|
|
0.855 |
|
|
EU dossier kf range 54-336, 1/n range 0.742-0.945, Soils=4 - EU dossier value for dodemorph acetate. Research literature range 4200-48000 mL g⁻¹ |
|
|
- |
|
|
|
|
|
|
|
-0.65 |
Calculated |
Low leachability |
|
|
|
5.35 X 10-03 |
Calculated |
- |
|
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW |
|
|
High |
Calculated |
- |
|
|
Non-mobile |
Calculated |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 4100 |
Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 76.6 |
Apis mellifera |
Moderate |
|
|
> 106.3 |
Apis mellifera |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
2.2 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Poecilia reticulata |
Moderate |
|
|
- |
- |
- |
|
|
3.34 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
17.9 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Unknown species |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 4100 |
Rat |
Low |
|
|
1640 |
Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.082 |
Dog SF=100 |
- |
|
|
0.33 |
Rabbit SF=100 |
- |
|
|
- |
- |
- |
|
|
0.033 |
Dog SF=100 |
- |
|
|
2.7-20.0 |
concentration dependent |
- |
|
|
- |
- |
- |
|
|
|
Negligible risk to bystanders |
|
|
Risk to operators and other farm works acceptable when PPE/PPC is used |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
0.1 |
EU Dir 89/778/EC limit; Calc MAC=2.5 µg l⁻¹ |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Some potential as a skin sensitiser |
|
|
|
|
|
Corrosive |
|
|
Health: H314, H317, H373, H361d Environment: H400, H410 |
|
|
III (Slightly hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
dodemorph |
|
|
dodemorphe |
|
|
Dodemorph |
|
|
dodemorph |
|
|
dodemorf |
|
|
dodemorf |
|
|
dodemorph |
|
|
dodemorf |
|
|
- |
|
|
- |
|
|
dodemorf |
|
|
- |