| DNOC sodium |
(Not known by any other names) |
| DNOC sodium is a multiuse pesticide. Data specific to the sodium salt is scarce but as DNOC it is highly soluble in water and is moderately volatile. It is not expected to be persistent in the environment. DNOC is moderately toxic to fish, aquatic invertebrates, algae and earthworms. It has a low oral toxicity to honeybees. It is highly toxic to mammals if ingested and is an irritant. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Moderately mobile
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Fish chronic ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health High alert: Mammals acute toxicity: High; Neurotoxicant
 |
|
|
A multi-use substance used to control insect and weed pests in agricultural crops. |
|
|
Aphids; Suckers; Tortrix & winder moths; Thrips; Locusts; Spider mites; Annual broad-leaved weeds |
|
|
Cereals; Potatoes; Dormant fruit trees |
|
|
- |
|
|
Considered obsolete but may be available in some countries |
|
|
1892 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
France |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₇H₅N₂NaO₅ |
|
|
- |
|
|
- |
|
|
JQYJSVBNPUHHKB-UHFFFAOYSA-M |
|
|
InChI=1S/C7H6N2O5.Na/c1-4-2-5(8(11)12)3-6(7(4)10)9(13)14;/h2-3,10H,1H3;/q;+1/p-1 |
|
|
Yes |
|
|
Herbicide, Insecticide, Acaricide, Fungicide |
|
|
Dinitrophenol pesticide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Non-systemic, with contact and stomach action. Cell membrane disruption. Uncoupler of oxidative phosphorylation via disruption of proton gradient. |
|
|
2312-76-7 |
|
|
No data found |
|
|
19 |
|
|
- |
|
|
- |
|
|
609-020-00-X |
|
|
220.11 |
|
|
sodium 4,6-dinitro-o-cresolate |
|
|
sodium 4,6-dinitro-o-cresolate |
|
|
sodium 2-methyl-4,6-dinitrophenolate |
|
|
Chemical subject to PIC regulations; Marine Pollutant; Rotterdam Convention (Class Ib); Strongly phytotoxic |
|
|
- |
|
|
M |
|
|
24 |
|
|
13 |
|
|
29 |
|
|
None identified |
|
|
Crystalline solid |
|
|
|
|
|
|
|
|
- Cerexagri Inc.
- Blue Spruce
- AH Marks
- Pennwalt Holland
|
|
|
- Sinox
- Trifocide
- Trifrina
- Detal
- Dekrysil
- Lipan
- Nitrador
|
|
|
Usually supplied as soluble flakes, flowable concentrates and wettable powders |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
General literature for DNOC DT₅₀ range 4-13 days (R3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source as DNOC |
Moderately mobile |
|
|
300 |
|
|
Other sources: 408 mL g⁻¹ (DW3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
25 |
Rat as DNOC |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
3977 |
Coturnix japonica as DNOC |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
16.0 |
Eisenia foetida as DNOC |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
204 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data as DNOC |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 0.23 |
Lepomis macrochirus as DNOC |
Moderate |
|
|
> 1.11 |
Pimephales promelas as DNOC |
Moderate |
|
|
> 1.1 |
Daphnia magna as DNOC |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 3.4 |
Scenedesmus subspicatus as DNOC |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
25 |
Rat as DNOC |
High |
|
|
187 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Mouse as DNOC |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Main risk of exposure is thought to be from residues on treated crops |
|
|
Operator exposure is a concern even with PPE/PPC |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E1 E = Unspecified genotoxicity type (miscellaneous data source) 1 = Positive |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Mutagenic potential Very toxic by inhalation, skin contact and ingestion Easily absorbed through the skin |
|
|
|
|
|
Combustable Explosive when dry IMDG Transport Hazard Class 6.1 |
|
|
Health: H300, H310, H315, H317, H318, H330, H341 Environment: H400, H410 |
|
|
Ib (Highly hazardous) |
|
|
UN1598 |
|
|
Packaging Group II (moderate danger) |
|
|
- |
|
|
|
|
|
DNOC sodium |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |