| Dithiopyr (Ref: RH 101664) |
(Also known as: MON 15100; MON 7200) |
| Dithiopyr is a pre-emergence herbicide. It has a low aqueous solubility and, based on its chemical properties, is not expected to leach to groundwater. It is usually persistent in both soil and aquatic systems. It has a low toxicity to mammals and birds but is moderately toxic to most aquatic life, honey bees and earthworms. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Moderately persistent; Drainflow: Slightly mobile
 |
Ecotoxicity High alert: Fish chronic ecotoxicity: High
 |
Human health Low alert
 |
|
|
A pre-emergence and early post-emergence herbicide used for the control of grasses and broad-leaved weeds |
|
|
Crabgrass; Annual bluegrass; Bermudagrass; Chickweed; Common knotweed; Purslane; Woodsorrel; Spotted spurge |
|
|
Residential and ornametal lawns; Turf areas including golf courses, sports fields |
|
|
- |
|
|
Current |
|
|
1991, USA |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₅H₁₆F₅NO₂S₂ |
|
|
CC(C)CC1=C(C(=NC(=C1C(=O)SC)C(F)(F)F)C(F)F)C(=O)SC |
|
|
No data |
|
|
YUBJPYNSGLJZPQ-UHFFFAOYSA-N |
|
|
InChI=1S/C15H16F5NO2S2/c1-6(2)5-7-8(13(22)24-3)10(12(16)17)21-11(15(18,19)20)9(7)14(23)25-4/h6,12H,5H2,1-4H3 |
|
|
Yes |
|
|
Herbicide |
|
|
Pyridine herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Inhibits cell division - a mitotic inhibitor of normal cell division in susceptible plants. Thought to alter microtubule polymerization. |
|
|
97886-45-8 |
|
|
No data found |
|
|
None allocated |
|
|
128994 |
|
|
91757 |
|
|
No data found |
|
|
401.42 |
|
|
S3,S5-dimethyl 2-(difluoromethyl)-4-(2-methylpropyl)-6-(trifluoromethyl)pyridine-3,5-dicarbothioate |
|
|
S,S'-dimethyl 2-difluoromethyl-4-isobutyl-6-trifluoromethylpyridine-3,5-dicarbothioate |
|
|
S,S'-dimethyl 2-(difluoromethyl)-4-(2-methylpropyl)-6-(trifluoromethyl)-3,5-pyridinedicarbothioate |
|
|
- |
|
|
- |
|
|
K1 |
|
|
3 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Off-white coloured powder with sulphurous odour |
|
|
|
|
|
|
|
|
- Dimension
- Crab-buster
- Dictran
|
|
|
- |
|
|
|
|
|
|
|
1.38 |
|
Low |
|
|
33000 |
Hexane |
- |
| 250000 |
Toluene |
- |
| 500000 |
Diethyl ether |
- |
| 120000 |
Ethanol |
- |
|
|
65 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
7.59 X 1005 |
Calculated |
- |
|
|
5.88 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.413 |
|
- |
|
|
N/a |
|
- |
| No dissociation |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
39 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent |
|
|
- |
- |
- |
|
|
39 |
|
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
General literature values DT₅₀ range 17-61 days; Other sources: DT₅₀ 400 days (US3) |
|
|
|
3.6 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
|
Turfgrass, n=1 |
|
|
|
3.9 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
|
Perennial ryegrass, n=1 |
|
|
|
19.1 |
|
Slow |
|
|
- |
|
|
|
Stable |
|
Stable |
|
|
Not pH sensitive |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
|
Slightly mobile |
|
|
801 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
1.74 |
Calculated |
Low leachability |
|
|
|
5.38 X 10-02 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Slightly mobile |
Calculated |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 5620 |
Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 53 |
|
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.36 |
Oncorhynchus mykiss |
Moderate |
|
|
0.052 |
Oncorhynchus mykiss |
Moderate |
|
|
14 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
0.47 |
Americamysis bahia |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.02 |
Pseudokirchneriella subcapitata |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 5000 |
Rat |
Low |
|
|
5000 |
Rat |
- |
|
|
> 5.98 |
Rat 4 hr (nose only) |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
a=0.25, b=0.75 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source mg m³ a=TWA b=STEL |
- |
|
|
- |
- |
- |
|
|
List II |
- |
- |
|
|
|
- |
|
|
PPE/PPC required to mitigate risks of exposure |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Do not inhale Possible blood, kidney and liver toxicant |
|
|
|
|
|
No information available |
|
|
Environment: H400, H410 |
|
|
U (Unlikely to present an acute hazard) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
dithiopyr |
|
|
dithiopyr |
|
|
Dithiopyr |
|
|
dithiopyr |
|
|
dithiopyr |
|
|
ditiopir |
|
|
- |
|
|
ditiopyr |
|
|
- |
|
|
- |
|
|
- |
|
|
- |