| Dinoterb acetate |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
Ecotoxicity High alert: Fish acute ecotoxicity: High
 Warning: Significant data are missing |
Human health High alert: Mammals acute toxicity: High; Reproduction/development effects
 Warning: Significant data are missing |
|
|
A herbicide used for pre-emergence control of annual broad-leaved weeds in a variety of crops |
|
|
Aphids; Scale insects; Red spider mite; Rust mite; Nematodes |
|
|
Apples; Grapes; Cereals; Legumes; Maize; Cotton |
|
|
- |
|
|
- |
|
|
1965, dinoterb first reported |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
France |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₂H₁₄N₂O₆ |
|
|
CC(=O)OC1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(C)(C)C |
|
|
- |
|
|
BMJYKXALMDAIEG-UHFFFAOYSA-N |
|
|
InChI=1S/C12H14N2O6/c1-7(15)20-11-9(12(2,3)4)5-8(13(16)17)6-10(11)14(18)19/h5-6H,1-4H3 |
|
|
Yes |
|
|
Herbicide |
|
|
Dinitrophenol herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Selective, non-systemic with contact action. Uncoupler of oxidative phosphorylation via disruption of proton gradient - membrane distruption. |
|
|
3204-27-1 |
|
|
220-560-1 |
|
|
238 |
|
|
- |
|
|
- |
|
|
No data found |
|
|
282.25 |
|
|
2-tert-butyl-4,6-dinitrophenyl acetate |
|
|
2-tert-butyl-4,6-dinitrophenyl acetate |
|
|
2-(1,1-dimethylethyl)-4,6-dinitrophenyl acetate |
|
|
- |
|
|
- |
|
|
M |
|
|
24 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
|
|
|
|
- |
|
|
Available in a variety of formulations including emulsifiable concentrates, wettable powders and soluble liquids. |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
8.13 X 1001 |
Calculated |
- |
|
|
1.91 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source as dinoterb |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
20 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source as dinoterb |
Highly volatile |
|
|
1.07 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source as dinoterb |
Moderately volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
10 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data as dinoterb |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
General literarure dinoterb DT₅₀: 9.2-10.4 days (R3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
192 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Threshold for concern |
|
|
Not available |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
25 |
Rat as dinoterb |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Toxic |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.0034 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss as dinoterb |
High |
|
|
- |
- |
- |
|
|
0.47 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Unknown species as dinoterb |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
7.4 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Unknown species as dinoterb |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
25 |
Rat as dinoterb |
High |
|
|
150 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Guinea pig as dinoterb |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
98% excreted in faeces and urine |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
XNo, known not to cause a problem |
No dats |
| Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No dsts |
|
|
|
|
Highly toxic |
|
|
|
|
|
Caustic agent, corrosive to metals IMDG Transport Hazard Class 6.1 |
|
|
Health: H300, H311, H319, H360D Environment: H400, H410 |
|
|
Ib (Highly hazardous) |
|
|
UN2779 |
|
|
- |
|
|
- |
|
|
|
|
|
dinoterb acetate |
|
|
dinoterbe-acétate |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |