| Dinitramine (Ref: USB 3584) |
(Also known as: diethamine) |
| Dinitramine is a soil incorporated pre-plant herbicide. It has a low aqueous solubility and a low volatility. Depending on local conditions it may be moderately persistent in soils. Based on its physico-chemical properties it is not expected to leach to groundwater. Available ecotoxicological data is very limited but dinitramine is moderately toxic to birds and fish. Dinitramine has a low oral mammalian toxicity. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Moderately persistent; Potential for particle bound transport: Medium
 |
Ecotoxicity Moderate alert: Birds acute ecotoxicity: Moderate; Fish acute ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health Low alert
 Warning: Significant data are missing |
|
|
A soil incorporated pre-plant herbicide used to control many annual grasses and broad-leaved weeds |
|
|
Crab grass; Barnyard grass; Couch grass |
|
|
Peas; Soybeans; Cotton; Sunflowers; Tomatoes; Rice; Legumes |
|
|
- |
|
|
- |
|
|
1973, USA |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₁H₁₃F₃N₄O₄ |
|
|
CCN(CC)C1=C(C=C(C(=C1[N+](=O)[O-])N)C(F)(F)F)[N+](=O)[O-] |
|
|
No data |
|
|
OFDYMSKSGFSLLM-UHFFFAOYSA-N |
|
|
InChI=1S/C11H13F3N4O4/c1-3-16(4-2)9-7(17(19)20)5-6(11(12,13)14)8(15)10(9)18(21)22/h5H,3-4,15H2,1-2H3 |
|
|
Yes |
|
|
Herbicide |
|
|
Dinitroaniline herbicide; Phenylenediamine herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Selective, absorbed by roots and shoots. Microtubule assembly inhibition. |
|
|
29091-05-2 |
|
|
249-419-2 |
|
|
None allocated |
|
|
102301 |
|
|
34468 |
|
|
No data found |
|
|
322.24 |
|
|
N1,N1-diethyl-2,6-dinitro-4-(trifluoromethyl)benzene-1,3-diamine |
|
|
N1,N1-diethyl-2,6-dinitro-4-trifluoromethyl-m-phenylenediamine |
|
|
N3,N3-diethyl-2,4-dinitro-6-(trifluoromethyl)-1,3-benzenediamine |
|
|
- |
|
|
- |
|
|
K1 |
|
|
3 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Yellow crystals |
|
|
|
|
|
|
|
|
|
|
|
Usually formulated as an emulsifiable concentrate |
|
|
|
|
|
|
|
1.1 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low |
|
|
1040000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
| 473000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Benzene |
- |
| 227000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Xylene |
- |
| 6700 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source n-Hexane |
- |
|
|
98.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
200 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
30.5 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
|
2.00 X 1004 |
Calculated |
- |
|
|
4.3 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.47 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
|
- |
- |
- |
| - |
|
|
0.479 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low volatility |
|
|
1.40 X 10-01 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Moderately volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
38 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent |
|
|
30 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Non-mobile |
|
|
4000 |
|
|
Best available data |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
0.59 |
Calculated |
Low leachability |
|
|
|
1.12 X 10-02 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Non-mobile |
Calculated |
- |
|
|
|
235 |
J4 J = Pesticide Action Network database (click here ) 4 = Verified data |
Threshold for concern |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 3000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
2000 |
- |
|
|
- |
- |
- |
|
|
1200 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Colinus virginianus |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.753 |
Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 3000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
6800 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
0.16 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List II |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
No data found |
No data found |
| Eye irritant |
Phototoxicant |
|
| No data found |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
No information available |
|
|
Health: H312 Environment: H400, H410 |
|
|
III (Slightly hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
dinitramine |
|
|
dinitramine |
|
|
Dinitramin |
|
|
dinitramin |
|
|
dinitramina |
|
|
dinitramina |
|
|
- |
|
|
dinitramina |
|
|
- |
|
|
- |
|
|
- |
|
|
- |