| Diniconazole (Ref: XE-779) |
(Not known by any other names) |
| Diniconazole is a triazole fungicide. It has a low aqueous solubility and a low volatility. It tends to be persistent in both soil and water systems. Whilst available ecotoxicology data is limited, diniconazole is moderately toxic to birds, fish and honeybees. It also has a moderate oral mammalian toxicity. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
Ecotoxicity Moderate alert: Birds acute ecotoxicity: Moderate; Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Bees acute contact ecotoxicity: Moderate
 |
Human health Moderate alert: Mammals acute toxicity: Moderate; Possible Reproduction/development effects
 |
|
|
A conazole fungicide used to control a range of diseases including powdery mildew |
|
|
Powdery mildew; Bunt; Smut; Septoria leaf spot |
|
|
Peanuts; Vines; Ornamentals including roses; Cereals |
|
|
- |
|
|
Current |
|
|
1987 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
France |
|
|
Expired |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
A chiral molecule. Substance is racemic. |
|
|
C₁₅H₁₇Cl₂N₃O |
|
|
CC(C)(C)C(C(=CC1=C(C=C(C=C1)Cl)Cl)N2C=NC=N2)O |
|
|
CC(C)(C)C(/C(=C\C1=C(C=C(C=C1)Cl)Cl)/N2C=NC=N2)O |
|
|
FBOUIAKEJMZPQG-AWNIVKPZSA-N |
|
|
InChI=1S/C15H17Cl2N3O/c1-15(2,3)14(21)13(20-9-18-8-19-20)6-10-4-5-11(16)7-12(10)17/h4-9,14,21H,1-3H3/b13-6+ |
|
|
Yes |
|
|
Fungicide |
|
|
Triazole fungicide; Conazole fungicide |
|
|
>=95% |
|
|
- |
|
|
Synthetic |
|
|
Systemic with curative and protective action. Inhibits the demethylation of steroids distrupting ergosterol biosynthesis. |
|
|
83657-24-3 |
|
|
617-485-5 |
|
|
690 |
|
|
- |
|
|
6436605 |
|
|
No data found |
|
|
326.22 |
|
|
rac-(1E,3R)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pent-1-en-3-ol |
|
|
(E)-(RS)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pent-1-en-3-ol |
|
|
(βE)-β-[(2,4-dichlorophenyl)methylene]-α-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol |
|
|
Chemical subject to PIC regulations |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
3 |
|
|
- |
|
|
White to off-white solid |
|
|
|
|
|
|
|
|
- AgroCare
- King Tech Corp
- BOC Sciences
|
|
|
|
|
|
Available in a variety of formulations including emulsifiable concentrates, water dispersible granules and wettable powders. |
|
|
|
|
|
|
|
4 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
120000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Acetone |
- |
| 119000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Methanol |
- |
| 14000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Xylene |
- |
| 700 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
|
|
148 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
|
501.1 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
2.00 X 1004 |
Calculated |
- |
|
|
4.3 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data |
High |
|
|
|
Likely to be soluble |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
Based on chemical group |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
1.27 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
|
- |
- |
- |
| - |
|
|
2.96 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data |
Low volatility |
|
|
4.00 X 10-02 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
1566 |
C3 C = AGRITOX dataset. Dataset is no longer available. 3 = Unverified data of known source |
Very persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
3.8 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 0.9-8.3 days, 8 field & undercover grown crops, various matrices, n=11 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
100 |
C2 C = AGRITOX dataset. Dataset is no longer available. 2 = Unverified data of unknown source |
Persistent |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
474 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
1490 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Colinus virginianus |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 20 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Apis mellifera |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
1.58 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
7.4 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
474 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
2.77 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
May be absorbed through the skin |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
No data found |
No data found |
| Eye irritant |
Phototoxicant |
|
| No data found |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
No information available |
|
|
Health: H302, H361, H370, H373 Environment: H400, H410 |
|
|
II (Moderately hazardous) |
|
|
- |
|
|
- |
|
|
Limited shelf-life. Store at -20 DegC |
|
|
|
|
|
diniconazole |
|
|
diniconazole |
|
|
Diniconazol |
|
|
diniconazol |
|
|
diniconazolo |
|
|
dinoconazol |
|
|
- |
|
|
dinikonazol |
|
|
- |
|
|
dinikonazol |
|
|
- |
|
|
- |