| Dinex (Ref: DN-111) |
(Also known as: pedinex; DNOCHP; ENT 157) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
Ecotoxicity High alert: Birds acute ecotoxicity: High
 Warning: Significant data are missing |
Human health High alert: Mammals acute toxicity: High; Reproduction/development effects; Neurotoxicant
 Warning: Significant data are missing |
|
|
An obsolete insecticide and acaricide that was used to control mites and other sucking insects |
|
|
Red mites; Spider mites; Aphids; Scale insects; Thrips; Snails; Winter moths; Apple blosson weevil |
|
|
Citrus; Apples; Pears |
|
|
- |
|
|
Considered obsolete but may be available in some countries |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₂H₁₄N₂O₅ |
|
|
C1CCC(CC1)C2=CC(=CC(=C2O)[N+](=O)[O-])[N+](=O)[O-] |
|
|
- |
|
|
QJYHUJAGJUHXJN-UHFFFAOYSA-N |
|
|
InChI=1S/C12H14N2O5/c15-12-10(8-4-2-1-3-5-8)6-9(13(16)17)7-11(12)14(18)19/h6-8,15H,1-5H2 |
|
|
Yes |
|
|
Insecticide, Acaricide, Molluscicide |
|
|
Dinitrophenol insecticide; Dinitrophenol acaricide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Non-systemic activity, Uncoupler of oxidative phosphorylation via disruption of proton gradient. |
|
|
131-89-5 |
|
|
205-042-5 |
|
|
None allocated |
|
|
037501 |
|
|
8540 |
|
|
609-028-00-3 |
|
|
266.26 |
|
|
2-cyclohexyl-4,6-dinitrophenol |
|
|
2-cyclohexyl-4,6-dinitrophenol |
|
|
2-cyclohexyl-4,6-dinitrophenol |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not known |
|
|
Not applicable |
|
|
- |
|
|
Pale yellow crystalline solid |
|
|
|
|
|
|
|
|
- Dow Chemical Company
- Dow Elanco
- DN-111
|
|
|
|
|
|
Usually forumated as a wettable powder |
|
|
|
|
|
|
|
15.0 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
|
107 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.32 X 1004 |
Calculated |
- |
|
|
4.12 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
65 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
76.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Gallus domesticus |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
65 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Intraperitoneal LD₅₀ = 25.0 mg kg⁻¹ |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Mouse |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
May be absorbed through the skin - PPE/PPC required |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
No data found |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Toxic by ingestion, skin contact and inhalation Potential liver and kidney toxicant Metabolic stimulant May cause dermatitis |
|
|
|
|
|
Corrosive Will release toxic fumes in a fire Explosive risk in a fire Not compatible with oxidising agents and combustible substances IMDG Transport Hazard Class 6.1b |
|
|
- |
|
|
Not classified: Obsolete |
|
|
UN2779 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
dinex |
|
|
pedinex |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |