| Diflufenzopyr (Ref: HSDB 7010) |
(Also known as: BAS 654H; SAN 835H) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Moderately mobile
 |
Ecotoxicity Moderate alert: Daphnia acute ecotoxicity: Moderate; Bees acute contact ecotoxicity: Moderate
 |
Human health High alert: Endocrine distrupter
 |
|
|
Used, post-emergence, to control annual broad-leaved and perennial weeds in a variety of crops |
|
|
Knotweed; Lambsquarters; Mallow; Buckweed; Nightshade; Morning glory; Bindweed; Ragweed; Smartweed; Sowthistle; Johnson grass; Milkweed |
|
|
Pasture; No-tlll burndown (Corn; Soybeans); Non-cropped land including rangeland, fallow |
|
|
- |
|
|
Current |
|
|
1999, USA and Canada |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Isomeric |
|
|
C₁₅H₁₂F₂N₄O₃ |
|
|
CC(=NNC(=O)NC1=CC(=CC(=C1)F)F)C2=C(C=CC=N2)C(=O)O |
|
|
C/C(=N\NC(=O)NC1=CC(=CC(=C1)F)F)/C2=C(C=CC=N2)C(=O)O |
|
|
IRJQWZWMQCVOLA-DNTJNYDQSA-N |
|
|
InChI=1S/C3H2F4O2.Na/c4-1(5)3(6,7)2(8)9;/h1H,(H,8,9);/q;+1/p-1 |
|
|
Yes |
|
|
Herbicide |
|
|
Semicarbazone herbicide, Urea herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Systemic, works by inhibiting auxin transport |
|
|
109293-97-2 |
|
|
600-910-3 |
|
|
None allocated |
|
|
005107 |
|
|
6125184 |
|
|
No data found |
|
|
334.28 |
|
|
2-[(1E)-1-{2-[(3,5-difluorophenyl)carbamoyl]hydrazinylidene}ethyl]pyridine-3-carboxylic acid |
|
|
2-{(EZ)-1-[4-(3,5-difluorophenyl)semicarbazono]ethyl}nicotinic acid |
|
|
2-[1-[[[(3,5-difluorophenyl)amino]carbonyl]hydrazono]ethyl]-3-pyridinecarboxylic acid |
|
|
Marine polluant |
|
|
- |
|
|
P |
|
|
19 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Off-white coloured granular solid |
|
|
|
|
|
|
|
|
|
|
|
Usually supplied as wettable granules for ground application using standard commercial sprayers |
|
|
|
|
|
|
|
5850 |
|
High |
|
|
- |
- |
- |
|
|
135.5 |
|
- |
|
|
- |
- |
- |
|
|
155 |
|
- |
|
|
- |
- |
- |
|
|
|
1.23 X 1001 |
Calculated |
- |
|
|
1.09 |
|
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.24 |
|
- |
|
|
3.18 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
| Weak acid |
|
|
0.1 |
|
Low volatility |
|
|
7.0 X 10-05 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
14 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
- |
- |
- |
|
|
4.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
General literature DT₅₀ range 8-18 days |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
17 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Slow |
|
|
pH sensitive: DT₅₀ 7 days at pH 5, 13 days at pH 9 |
|
|
|
24 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
pH sensitive: DT₅₀ 13 days at pH 5, 26 days at pH 9 |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderately mobile |
|
|
87 |
|
|
General literature Koc range 18-156 mL g⁻¹ |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
1.35 |
Calculated |
Low leachability |
|
|
|
3.63 X 10-03 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
|
- |
- |
| Known soil and groundwater metabolites |
|
None
|
|
|
|
|
|
| 8-methyl-5-hydroxy-pyrido(2,3-d)-pyridazine |
- |
- |
- |
- |
| 3,5-difluoroaniline |
- |
- |
- |
- |
| 6-((3,5-difluorophenyl) carbamoyl)-8-methyl-pyrido (2,3-d)-5-pyridazinone |
carbamoyl phthalazinone |
- |
- |
- |
| 2-acetyl nicotinic acid |
- |
- |
- |
- |
| N-(3,5-difluorophenyl)carbamate |
- |
- |
- |
- |
| 8-methylpyrido[2,3-d]pyridazine-2,5(1H, 6H)-dione |
- |
- |
- |
- |
| 8-hydroxymethyl-5(6H)pyrido[2,3-d]pyridazinone |
- |
- |
- |
- |
| 8-hydroxymethylpyrido[2,3-d]pyridazine-2,5(1H,6H)-dione |
- |
- |
- |
- |
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
Rat |
Low |
|
|
|
26.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Dog |
High |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 2250 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Colinus virginianus |
Low |
|
|
> 16970 mg/Kg BW |
Colinus virginianus |
- |
|
|
- |
- |
- |
|
|
> 1000 |
Eisenia foetida |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 75.0 |
|
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
106 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Low |
|
|
- |
- |
- |
|
|
15.0 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 0.35 |
Lemna gibba |
Moderate |
|
|
> 0.1 |
Pseudokirchneriella subcapitata |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 5000 |
Rat |
Low |
|
|
5000 |
Rat |
- |
|
|
> 2.93 |
Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List II |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
✓Yes, known to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
?Possibly, status not identified |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
XNo, known not to cause a problem |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Possible testicular, kidney, lung, spleen and brain toxicant |
|
|
|
|
|
IMDG Transport Hazard Class 9 |
|
|
Health: H319, H332 |
|
|
Not listed |
|
|
UN3077 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
diflufenzopyr |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
diflufenzopir |
|
|
- |
|
|
diflufenzopyr |
|
|
- |
|
|
- |
|
|
- |
|
|
- |