| Difenzoquat (Ref: BAS 450H) |
(Not known by any other names) |
| Difenzoquat is a post-emergence herbicide. Little data is available regarding its environmental fate. It has a low avian toxicity but appears to be more toxic to aquatic species. it is moderately toxic to mammals if ingested and is thought to be an eye irritant. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Low alert: Drainflow: Non-mobile
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate
 |
Human health Moderate alert: Mammals acute toxicity: Moderate
 |
|
|
A post-emergence quarternary ammonium herbicide for wild oat control |
|
|
Wild oats |
|
|
Alfalfa; Cereals including wheat, barley |
|
|
- |
|
|
Current |
|
|
1975, USA |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₇H₁₇N₂ |
|
|
CN1C(=CC(=[N+]1C)C2=CC=CC=C2)C3=CC=CC=C3 |
|
|
No data |
|
|
LBGPXIPGGRQBJW-UHFFFAOYSA-N |
|
|
InChI=1S/C17H17N2/c1-18-16(14-9-5-3-6-10-14)13-17(19(18)2)15-11-7-4-8-12-15/h3-13H,1-2H3/q+1 |
|
|
Yes |
|
|
Herbicide, Fungicide |
|
|
Phenylpyrazole herbicide; Quarternary ammonium compound; Pyrazole herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Selective, absorbed by foliage. Acts via the rapid destruction of cell membranes. |
|
|
49866-87-7 |
|
|
256-505-3 |
|
|
367 |
|
|
106402 |
|
|
39425 |
|
|
No data found |
|
|
249.33 |
|
|
1,2-dimethyl-3,5-diphenyl-1H-pyrazol-2-ium |
|
|
1,2-dimethyl-3,5-diphenylpyrazolium |
|
|
1,2-dimethyl-3,5-diphenyl-1H-pyrazolium |
|
|
- |
|
|
- |
|
|
Z |
|
|
0 |
|
|
Not applicable |
|
|
Not known |
|
|
- |
|
|
Colourless, odourless crystals |
|
|
|
|
|
|
|
|
- Amvac Chemical Corp
- BASF
- King Tech
|
|
|
|
|
|
Usually supplied as a water miscible liquid |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
155 |
|
- |
|
|
Decomposes before boiling |
|
- |
|
|
160 |
|
- |
|
|
- |
- |
- |
|
|
|
5.13 X 1000 |
Calculated |
- |
|
|
0.710 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
|
166.1 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Non-mobile |
|
|
9702 |
|
|
1.386 |
|
|
Literature values: Kf range 29-664 mL g⁻¹, Kfoc range 1740-33200 mL g⁻¹, 1/n range 1.23-1.59, soils=8 |
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
470 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
10338 |
Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
76 |
Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
2.6 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
470 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Moderately toxic May cause irreversible eye damage |
|
|
|
|
|
IMDG Transport Hazard Class 6.1 |
|
|
Not classified: Obsolete |
|
|
II (Moderately hazardous) |
|
|
UN2588 |
|
|
Packaging Group II (moderate danger) |
|
|
- |
|
|
|
|
|
difenzoquat |
|
|
difenzoquat |
|
|
Difenzoquat |
|
|
difenzoquat |
|
|
difenzoquat |
|
|
difenzocuat |
|
|
- |
|
|
difenzokwat |
|
|
- |
|
|
- |
|
|
- |
|
|
- |