| Difenzoquat metilsulfate (Ref: AC 84777) |
(Also known as: difenzoquat methyl sulphate; difenzoquat methyl sulfate; CL84777; BAS 450H; difenzoquat metilsulphate) |
| Difenzoquat metilsulfate is a herbicide mainly used to control wild oats. It is highly soluble in water and has a low volatility. It can be environmentally persistent depending on local conditions. It tends to be moderately toxic to biodiverrsity. Difenzoquat metilsulfate is moderately toxic to mammals vi the oral route. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Persistent; Potential for particle bound transport: High
 |
Ecotoxicity Moderate alert: Daphnia acute ecotoxicity: Moderate; Bees acute contact ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health Moderate alert: Mammals acute toxicity: Moderate
 |
|
|
A post-emergence quarternary ammonium herbicide for wild oat control |
|
|
Wild oats; Powdery mildew |
|
|
Cereals including wheat, barley; Alfalfa; Maize; Clover seed crops |
|
|
- |
|
|
Current |
|
|
1982, USA |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₈H₂₀N₂O₄S |
|
|
CN1C(=CC(=[N+]1C)C2=CC=CC=C2)C3=CC=CC=C3.COS(=O)(=O)[O-] |
|
|
- |
|
|
XQEMNBNCQVQXMO-UHFFFAOYSA-M |
|
|
InChI=1S/C17H17N2.CH4O4S/c1-18-16(14-9-5-3-6-10-14)13-17(19(18)2)15-11-7-4-8-12-15;1-5-6(2,3)4/h3-13H,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
|
|
Yes |
|
|
Herbicide, Fungicide |
|
|
Phenylpyrazole herbicide; Quarternary ammonium compound; Pyrazole herbicide |
|
|
>96% |
|
|
- |
|
|
Synthetic |
|
|
Selective, absorbed by foliage. Acts via the rapid destruction of cell membranes. |
|
|
43222-48-6 |
|
|
256-152-5 |
|
|
367 |
|
|
106401 |
|
|
39424 |
|
|
No data found |
|
|
360.43 |
|
|
1,2-dimethyl-3,5-diphenyl-1H-pyrazol-2-ium methyl sulfate |
|
|
1,2-dimethyl-3,5-diphenyl-1H-pyrazolium methyl sulfate |
|
|
1,2-dimethyl-3,5-diphenylpyrazolium methyl sulfate |
|
|
- |
|
|
- |
|
|
Z |
|
|
0 |
|
|
Not applicable |
|
|
Not known |
|
|
- |
|
|
Colourless crystals |
|
|
|
|
|
|
|
|
- Amvac Chemical Corp
- BASF
- King Tech
- American Cyanamid
|
|
|
|
|
|
Usually supplied as a water miscible liquid or soluble powder |
|
|
|
|
|
|
|
765000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
360000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Dichloromethane |
- |
| 500000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Chloroform |
- |
| 558000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
| 9800 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
|
|
157 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
82 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source (open cup) |
- |
|
|
|
2.45 X 10-01 |
Calculated |
- |
|
|
-0.61 |
T4 T = UN EPFA database. Dataset no longer available. 4 = Verified data |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.8 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
7 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
| Weak acid |
|
|
0.01 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low volatility |
|
|
5.70 X 10-11 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
90 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent |
|
|
100 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
Persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Other sources: DT₅₀ 3 months (R3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
Stable |
W4 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 4 = Verified data |
Stable |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-mobile |
|
|
30000 |
|
|
Other sources: Log Koc 4.49-5.80 |
|
|
|
166 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source (for difenzoquat) |
Non-mobile |
|
|
9702 |
|
|
1.39 |
|
|
Kf range 29-664 mL g⁻¹; Kfoc range 1740-33200 mL g⁻¹; 1/n range 1.05-1.54; Soils=9 |
|
|
- |
|
|
|
|
|
|
|
0.03 |
Calculated |
Low leachability |
|
|
|
5.31 X 10-03 |
Calculated |
- |
|
|
- |
|
|
High |
Calculated |
- |
|
|
Non-mobile |
Calculated |
- |
|
|
|
20 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Low potential |
|
|
Not available |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
373 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
|
500 |
- |
|
|
- |
- |
- |
|
|
> 4640 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Colinus virginianus |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 400 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
36 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Apis mellifera |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
694 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Low |
|
|
- |
- |
- |
|
|
2.63 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.54 |
Unknown species |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
373 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
3540 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
|
0.36 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat 4 hr |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Moderately toxic May cause irreversible eye damage |
|
|
|
|
|
Hygroscopic IMDG Transport Hazard Class 6.1 |
|
|
Health: H302 Environment: H400, H410 |
|
|
II (Moderately hazardous) |
|
|
UN2811 |
|
|
Packaging Group II (moderate danger) |
|
|
- |
|
|
|
|
|
difenzoquat metilsulfate |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |