| Diethatyl ethyl (Ref: BAY NNT 6867) |
(Also known as: Hurclules 22234) |
| Diethatyl ethyl is an obsolete herbicide. It is moderately soluble in water and has a low volatility. It may be moderately persisten in some soil systems depending on local conditions. Available ecotoxicity data is limited but that which is availble indicates it is low to moderate. Diethatyl ethyl has a low mammalian oral toxicity and is an eye irritant. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Slightly mobile; Potential for particle bound transport: Medium
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Bees acute unknown ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health Low alert
 Warning: Significant data are missing |
|
|
A largely obsolete, selective pre-emergence herbicide for used against annual grasses and some broad-leaved weeds |
|
|
Barnyardgrass; Blackgrass; Annual bluegrass; Crabgrass; Panicum: Foxtails; Ground cherry; Lovegrass; Nightshade; Pigweed; Purslane; Ryegrass; Shepherd's purse; Sowthistle |
|
|
Alfalfa (established); Vegetables including carrots, cole crops, beans, peas, spinach; Cotton; Flax; Peanuts; Potatoes; Tomatoes; Red beets; Sugarbeet; Soybeans |
|
|
- |
|
|
Considered obsolete but may be available in some countries |
|
|
1972, first reported |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₆H₂₂ClNO₃ |
|
|
CCC1=C(C(=CC=C1)CC)N(CC(=O)OCC)C(=O)CCl |
|
|
- |
|
|
WFKSADNZWSKCRZ-UHFFFAOYSA-N |
|
|
InChI=1S/C16H22ClNO3/c1-4-12-8-7-9-13(5-2)16(12)18(14(19)10-17)11-15(20)21-6-3/h7-9H,4-6,10-11H2,1-3H3 |
|
|
Yes |
|
|
Herbicide |
|
|
Chloroacetanilide herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Lipid biosynthesis inhibitor, selective absorbed primarily by the emerging growth. Inhibition of long chain fatty acid synthesis. |
|
|
38727-55-8 |
|
|
254-105-3 |
|
|
None allocated |
|
|
279500 |
|
|
38090 |
|
|
No data found |
|
|
311.5 |
|
|
- |
|
|
ethyl N-chloroacetyl-N-(2,6-diethylphenyl)glycinate |
|
|
ethyl N-(chloroacetyl)-N-(2,6-diethylpheyl)glycinate |
|
|
Possible groundwater contaminant |
|
|
- |
|
|
K3 |
|
|
15 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Clear crystalline solid |
|
|
|
|
|
- Bayer CropScience
- Aventis
- BFC Chemicals Inc, USA
- AgrEvo
- FBC
|
|
|
|
|
|
Usually supplied as an emuslfiable concentrate |
|
|
|
|
|
|
|
105 |
at 25 °C |
Moderate |
|
|
810000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
| 750000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Isopropanol |
- |
| 820000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Xylene |
- |
| 770000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Chloroform |
- |
|
|
50 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
240 |
|
- |
|
|
- |
- |
- |
|
|
|
3.98 X 1003 |
Calculated |
- |
|
|
3.6 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.38 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
0.43 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
30 |
|
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
|
Slightly mobile |
|
|
1400 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
1.26 |
Calculated |
Low leachability |
|
|
|
2.73 X 10-02 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Slightly mobile |
Calculated |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
2300 |
Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 10000 |
Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
43.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
1.82 |
Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
2300 |
Rat |
Low |
|
|
4000 |
Rabbit |
- |
|
|
> 28.0 |
Rat 4 hr |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Possible cardiovascular & blood toxicant |
|
|
|
|
|
No information available |
|
|
- |
|
|
U (Unlikely to present an acute hazard) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
diethatyl ethyl |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |