| Dichlorophen |
(Also known as: antiphen; anthifen) |
| Dichlorophen is a fungicide, herbicide, bactericide and algicide. It has a low aqueous solubility and, based on its chemical properties, it is unlikely to leach to groundwater. It is not usually persistent in soils. Dichlorophen has a low mammalian toxicity but is moderately toxic to fish, aquatic invertebrates and algae. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Potential for particle bound transport: Medium
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Fish chronic ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health Moderate alert: Possible Carcinogen; Possible Reproduction/development effects
 |
|
|
A multiple purpose pesticide used to control various infections in agricultural and horticultural crops as well as in non-crop situations . Also has some applications as a veterinary treatment. |
|
|
Red thread; Fusarium patch; Stem canker; Angular leaf spot; Cucumber wilt; Damping off; Root rot; Bulb riot; Web blotch |
|
|
Cotton; Peanuts; Potatoes; Vegetables including beans, onions, garlic; Tomatoes; Cucumbers; Ornamentals; Non-crop situations |
|
|
- |
|
|
- |
|
|
First patented 1944 USA |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Ireland |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₃H₁₀Cl₂O₂ |
|
|
C1=CC(=C(C=C1Cl)CC2=C(C=CC(=C2)Cl)O)O |
|
|
Clc1cc(c(O)cc1)Cc2cc(Cl)ccc2O |
|
|
MDNWOSOZYLHTCG-UHFFFAOYSA-N |
|
|
InChI=1S/C13H10Cl2O2/c14-10-1-3-12(16)8(6-10)5-9-7-11(15)2-4-13(9)17/h1-4,6-7,16-17H,5H2 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| dichlorophen |
- |
 |
|
|
Fungicide, Algicide, Bactericide, Veterinary substance |
|
|
Bridged diphenyl fungicide; Phenolic compound |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Contact |
|
|
97-23-4 |
|
|
202-567-1 |
|
|
325 |
|
|
055001 |
|
|
3037 |
|
|
604-019-00-0 |
|
|
269.1 |
|
|
2,2'-methylenebis(4-chlorophenol) |
|
|
4,4'-dichloro-2,2'-methylenediphenol |
|
|
2,2'-methylenebis[4-chlorophenol] |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not known |
|
|
- |
|
|
Colourless crystals |
|
|
|
|
|
|
|
|
|
|
|
Usually supplied as an emulsifiable concentrate from crop protection purposes. As an animal insecticide formulations include cutaneous sprays, tablets for oral administration and shampoos |
|
|
|
|
|
|
|
30 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data |
Low |
|
|
800000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Acetone |
- |
| 530000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Ethanol |
- |
| 540000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Isopropanol |
- |
|
|
177.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.70 X 1003 |
Calculated |
- |
|
|
3.23 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.42 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
|
7.6 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
| pKa(2) 11.6, Weak acid |
|
|
1.30 X 10-05 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
1.17 X 10-07 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
13 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Non-mobile |
|
|
4103 |
|
|
Estimated |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
0.43 |
Calculated |
Low leachability |
|
|
|
8.36 X 10-03 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Non-mobile |
Calculated |
- |
|
|
|
45.4 |
J4 J = Pesticide Action Network database (click here ) 4 = Verified data |
Low potential |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
2690 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
2000 |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.54 |
Oncorhynchus mykiss 48 hour |
Moderate |
|
|
> 0.154 |
Pimephales promelas |
Moderate |
|
|
6.2 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
10 |
Unknown species |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
2690 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
1000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Mouse |
- |
|
|
- |
- |
- |
|
|
Intravenous DT₅₀ = 17.0 mg kg⁻¹ |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Low risk to Europeans as no longer approved for use |
|
|
Low risk to Europeans as no longer approved for use |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Well absorbed and metabolised by the liver, excreted mainly in the faeces |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
|
|
|
|
Moderately toxic |
|
|
|
|
|
No information available |
|
|
Health: H302, H319 Environment: H400, H410 |
|
|
III (Slightly hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
dichlorophen |
|
|
dichlorophene |
|
|
Dichlorophen |
|
|
dichlorophen |
|
|
diclorofene |
|
|
diclorofen |
|
|
dichlorophen |
|
|
dichlorofen |
|
|
- |
|
|
- |
|
|
dichlorofeen |
|
|
- |