| Dibromochloropropane (Ref: OS1897) |
(Also known as: DBPC; oxy DBCP ; dibromo-3-chloropropane; BBC12) |
| Dibromochloropropane is an obsolete soil fumigant for the control of nematodes. It is highly soluble in water and highly volatile. It may be persistent in some soil systems depending on local conditions. Based on its chemical properties there may be a risk of leaching. It is moderately toxic to fish. Other ecotoxicity data is missing. Dibromochloropropane is moderately toxic o mammals via the oral route. There are also concerns that this substance may damage reproduction and/or fertility, is a neurotoxin and irritant. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health High alert: Carcinogen; Reproduction/development effects; Neurotoxicant
 |
|
|
A largely obsolete soil fumigant used to protect field crops, vegetables and fruits from nematodes |
|
|
Nematodes |
|
|
Fruit including berries, grapes, citrus; Peanuts; Cotton, Soybeans; Turf; Ornamentals |
|
|
- |
|
|
Considered obsolete but may be available in some countries |
|
|
1955, first reported |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Substance is racemic |
|
|
C₃H₅Br₂Cl |
|
|
C(C(CBr)Br)Cl |
|
|
- |
|
|
WBEJYOJJBDISQU-UHFFFAOYSA-N |
|
|
InChI=1S/C3H5Br2Cl/c4-1-3(5)2-6/h3H,1-2H2 |
|
|
Yes |
|
|
Nematicide, Insecticide, Fumigant, Fungicide |
|
|
Organochloride insecticide; Organochloride nematicide; Fumigant pesticide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Respiratory action, highly toxic |
|
|
96-12-8 |
|
|
202-479-3 |
|
|
None allocated |
|
|
011301 |
|
|
7280 |
|
|
602-021-00-6 |
|
|
236.36 |
|
|
- |
|
|
(RS)-1,2-dibromo-3-chloropropane |
|
|
1,2-dibromo-3-chloropropane |
|
|
Pan Dirty Dozen; VOC |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not known |
|
|
Not known |
|
|
- |
|
|
Colourless to amber-brown liquid with pungent odour |
|
|
|
|
|
- Dow Chemical Co
- DowElanco: Shell Development Company
- Amvac
|
|
|
|
|
|
Was available in a range of formulations including emulsifiable concentrates. |
|
|
|
|
|
|
|
1230 |
|
High |
|
|
Miscible |
Ethanol |
- |
| Miscible |
Isopropanol |
- |
| Miscible |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Dichloropropane |
- |
|
|
6 |
|
- |
|
|
196 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
2.69 X 1002 |
Calculated |
- |
|
|
2.43 |
|
Low |
|
|
|
Likely to be soluble |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
Based on chemical group |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
2.093 |
|
- |
|
|
- |
- |
- |
| - |
|
|
10000 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Highly volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
360 |
|
Persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Data for DT₅₀ varies on literature from 70 to 450 days |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
Stable |
|
Stable |
|
|
Stable pH 4 to pH 9 |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
|
Moderately mobile |
|
|
100 |
|
|
Other sources range 70-125 mL g⁻¹ |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
5.11 |
Calculated |
High leachability |
|
|
|
6.13 X 1000 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
11 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Low potential |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 170 |
Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Non-toxic |
|
Non-toxic |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
20 |
Micropterus salmoides |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 170 |
Rat |
Moderate |
|
|
1420 |
Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
Exposure to DBCP most likely results from the inhalation of contaminated air, but also via skin contact and ingestion |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
Non-statutory WHO drinking water guideline 0.001 mg l⁻¹ |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes UK EA QS database 2018 |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
✓Yes, known to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E1 E = Unspecified genotoxicity type (miscellaneous data source) 1 = Positive |
?Possibly, status not identified |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
May cause male infertility Liver and kidney toxicant May cause pulmonary edema |
|
|
|
|
|
Flammable Corrosive to metals |
|
|
- |
|
|
Ia (Extremely hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
dibromochloropropane |
|
|
- |
|
|
Dibromchlorpropan |
|
|
- |
|
|
1,2-dibromo-cloro-propano |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
1,2-dibroom-3-chloorpropaan |
|
|
- |