| Di-allate (Ref: CP 15) |
(Also known as: diallate) |
| Di-allate is a pre-emergence herbicide. It has a low aqueous solubility but is miscible with many organic solvents. It is volatile and expected to be moderately persistent in soil systems. Di-allate is moderately toxic to mammals, carcinogenic and a recognised irritant. It is moderately toxic to fish but little data is available regarding its toxicity to other species. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Moderately persistent; GUS: Transition state; Drainflow: Slightly mobile
 |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health Moderate alert: Mammals acute toxicity: Moderate; Possible Carcinogen; Possible Reproduction/development effects; Possible Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
|
An obsolete pre-emergence herbicide used to control wild oats and other grass weeds |
|
|
Wild oats; Blackgrass; Foxtails; Wild millet |
|
|
Alfalfa; Barley; Corn; Flax; Soybean; Lentils; Peas; Potatoes; Sugarbeet; |
|
|
- |
|
|
Considered obsolete but may be available in some countries |
|
|
1959, first reported |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Geometric isomers Z & E |
|
|
C₁₀H₁₇Cl₂NOS |
|
|
CC(C)N(C(C)C)C(=O)SCC(=CCl)Cl |
|
|
CC(C)N(C(C)C)C(=O)SC/C(=C/Cl)/Cl |
|
|
SPANOECCGNXGNR-UHFFFAOYSA-N |
|
|
InChI=1S/C10H17Cl2NOS/c1-7(2)13(8(3)4)10(14)15-6-9(12)5-11/h5,7-8H,6H2,1-4H3/b9-5- |
|
|
Yes |
|
|
Herbicide |
|
|
Thiocarbamate herbicide; Carbamate herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Selective, inhibits lipid metabolism and thus the development of seedling shoots and roots |
|
|
2303-16-4 |
|
|
218-961-1 |
|
|
96 |
|
|
078801 |
|
|
5284376 |
|
|
006--019-00-0 |
|
|
270.2 |
|
|
S-[(2E)-2,3-dichloroprop-2-en-1-yl] di(propan-2-yl)carbamothioate |
|
|
S-(EZ)-2,3-dichloroallyl diisopropyl(thiocarbamate) |
|
|
S-(2,3-dichloro-2-propenyl) bis(1-methylethyl)carbamothioate |
|
|
Marine Pollutant |
|
|
- |
|
|
K3 |
|
|
15 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Amber coloured liquid |
|
|
|
|
|
|
|
|
|
|
|
Usually formulated as an emulsifiable concentrate or as granules |
|
|
|
|
|
|
|
14 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low |
|
|
Miscible |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
| Miscible |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethanol |
- |
| Miscible |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethyl acetate |
- |
| Miscible |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Xylene |
- |
|
|
25 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
97 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.95 X 1003 |
Calculated |
- |
|
|
3.29 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
High |
|
|
|
Soluble |
|
- |
|
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
|
1.18 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
|
- |
- |
- |
| - |
|
|
20 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Highly volatile |
|
|
3.86 X 10-01 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Moderately volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
30 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderately persistent |
|
|
- |
- |
- |
|
|
30 |
|
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Other literature data: Persistent DT₅₀ 10-90 days |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Slightly mobile |
|
|
500 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
1.92 |
Calculated |
Transition state |
|
|
|
6.53 X 10-02 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Slightly mobile |
Calculated |
- |
|
|
|
750 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Threshold for concern |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
395 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 8.2 |
Rasbora heteromorpha |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
395 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Moderate |
|
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Low risk to Europeans as no longer approved for use |
|
|
Low risk to Europeans as no longer approved for use |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
?Possibly, status not identified |
?Possibly, status not identified |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Exposure may cause irritability, hyperactivity and mild cardiac changes |
|
|
|
|
|
IMDG Transport Hazard Class 3 |
|
|
Health: H302, H351 Environment: H400, H410 |
|
|
II (Moderately hazardous) |
|
|
UN3005 |
|
|
- |
|
|
- |
|
|
|
|
|
di-allate |
|
|
diallate |
|
|
Diallat |
|
|
diallat |
|
|
diallate |
|
|
diallate; dialato |
|
|
di-allate |
|
|
dialat |
|
|
- |
|
|
- |
|
|
diallaat |
|
|
- |