| Di-1-p-menthene |
(Also known as: di1pmenthene; pinolene; silicol; menthene) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Low alert: Drainflow: Non-mobile
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health Low alert
 |
|
|
Substance without pesticidal activity that is sometimes added to formulations or to spray mix as a non-ionic plant wetting agent. Often used with herbicide safeners. |
|
|
Current |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
- |
|
|
C₂₀H₃₆ |
|
|
C(CC(C)(C)C1CCC(C)=CC1)C1CCC(C)=CC1 |
|
|
C([C@@H]1CCC(C)=CC1)(C)C.C([C@@H]1CCC(C)=CC1)(C)C |
|
|
GEEMIUONIWYDTI-UHFFFAOYSA-N |
|
|
InChI=1/C20H34/c1-15-6-10-18(11-7-15)17(3)14-20(4,5)19-12-8-16(2)9-13-19/h6,8,17-19H,7,9-14H2,1-5H3 |
|
|
Yes |
|
|
Other substance, Adjuvant, Biocide |
|
|
Wetting agent, Antitranspirant |
|
|
Unclassified substance |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Physical - reduces surface tension in spray water droplets improving spreading properties of the formulation |
|
|
34363-01-4 |
|
|
83648-84-4 |
|
|
417-870-6 |
|
|
- |
|
|
- |
|
|
- |
|
|
275.0 |
|
|
- |
|
|
- |
|
|
2,4-bis(4-methylcyclohex-3-enyl)2-methylpentane |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Off-white to pale yellow emulsion |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
200 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
|
7.24 X 1004 |
Calculated |
- |
|
|
4.86 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.99 |
E2 E = Manufacturers safety data sheets 2 = Unverified data of unknown source |
- |
|
|
- |
- |
- |
| - |
|
|
20 |
E2 E = Manufacturers safety data sheets 2 = Unverified data of unknown source |
Highly volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
E2 E = Manufacturers safety data sheets 2 = Unverified data of unknown source |
Non-mobile |
|
|
25000 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1000 |
E2 E = Manufacturers safety data sheets 2 = Unverified data of unknown source |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
200 |
E2 E = Manufacturers safety data sheets 2 = Unverified data of unknown source |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
20 |
E2 E = Manufacturers safety data sheets 2 = Unverified data of unknown source Unknown species |
Moderate |
|
|
- |
- |
- |
|
|
55 |
C3 C = AGRITOX dataset. Dataset is no longer available. 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
3 |
E2 E = Manufacturers safety data sheets 2 = Unverified data of unknown source Unknown species |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
Intermediate (class II) |
- |
- |
|
|
> 5000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
Low |
|
|
20000 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source Rat |
- |
|
|
1.105 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source Rat 4 hr |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
May cause an allergic skin reaction |
|
|
|
|
|
Combustable liquid IMDG Transport Hazard Class 9 |
|
|
Health: H315, H317 Environment: H400, H410 |
|
|
None - not a ppp |
|
|
UN3082 |
|
|
- |
|
|
- |
|
|
|
|
|
di-1-p-menthene |
|
|
di-1-p-menthene |
|
|
Di-1-p-menthen |
|
|
di-1-p-menthen |
|
|
pinolene |
|
|
di-1-p-menthen |
|
|
- |
|
|
di-1-p-menten |
|
|
- |
|
|
- |
|
|
- |
|
|
- |