| DDT (Ref: OMS 16) |
(Also known as: clofenotane; dichlorodiphenyltrichloroethane; dicofane; chlorophenothane; NCI C00464) |
| DDT is a banned organochlorine insecticide. It has a low aqueous solubility, is relatively volatile and has a low potential to leach to groundwater. It is highly persistent in soil and non-mobile. It is moderately toxic by the oral route in humans and other mammals but is a carcinogen and endocrine disrupter. It shows a high to moderate level of toxicity to most animals and insects although it is relatively non-toxic to birds |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Very persistent; Potential for particle bound transport: High
 |
Ecotoxicity High alert: Daphnia acute ecotoxicity: High; Bees acute contact ecotoxicity: High
 |
Human health High alert: Endocrine distrupter; Reproduction/development effects; Neurotoxicant
 |
|
|
An obsolete and banned insecticide that was used to control insect vectors of disease, especially malaria |
|
|
Mosquitoes; Houseflies; Body lice; Colarado beetles; Gypsy moths |
|
|
Agricultural crops; Domestic houses; Offices, commercial and industrial situations; Non-cropped sites including roads, rights-of-way; parkland |
|
|
Not applicable |
|
|
Considered obsolete but may be available in some countries; Banned in many countries |
|
|
1944 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Isomer mix containing roughly 75-85% p,p'-DDT, 10-15% o,p'-DDT and a small amount of o,o'-DDT. Any balance is comprised of transformation products dichlorodiphenyldichloroethylene (DDE) and dichlorodiphenyldichloroethane (DDD). |
|
|
C₁₄H₉Cl₅ |
|
|
C1=CC(=CC=C1C(C2=CC=C(C=C2)Cl)C(Cl)(Cl)Cl)Cl (for p,p'-DDT) |
|
|
No data |
|
|
YVGGHNCTFXOJCH-UHFFFAOYSA-N (for p,p'-DDT) |
|
|
InChI=1S/C14H9Cl5/c15-11-5-1-9(2-6-11)13(14(17,18)19)10-3-7-12(16)8-4-10/h1-8,13H (for p,p'-DDT) |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| o,p'-DDT |
Isomer |
 |
| DDT |
Unstated isomer |
 |
|
|
Insecticide, Acaricide |
|
|
Organochloride insecticide; Organochloride acaricide; Bridged diphenyl insecticide; Bridged diphenyl acaricide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Non-systemic stomach and contact action. Sodium channel modulator. |
|
|
50-29-3 |
|
|
200-024-3 |
|
|
3 |
|
|
029201 |
|
|
3036 |
|
|
No data found |
|
|
354.49 |
|
|
1,1'-(2,2,2-trichloroethane-1,1-diyl)bis(4-chlorobenzene) |
|
|
1,1,1-trichloro-2,2-bis(4-chlorophenyl)ethane |
|
|
1,1'-(2,2,2-trichloroethylidene)bis(4-chlorobenzene) |
|
|
WFD priority substance; Subject to PIC regulations; POP - regulated by Stockholm Convention; LRTAP Annex I; PAN Dirty Dozen; OSPAR soc; Marine Pollutant; Rotterdam Convention (Class II) |
|
|
EU Directive 2008/105/EC EQS for total DDT surface waters: annual average 0.025 µg l⁻¹ UK statutory standard for protection of aquatic life for inland, coastal & territorial surface waters: 0.025 µg l⁻¹ as annual mean conc |
|
|
Not applicable |
|
|
Not applicable |
|
|
3B |
|
|
Not applicable |
|
|
Wide variety of insects are resistant, Aedes aegypti, Aedes vittatus, Amblyseius fallacis, Apis mellifera, many varieties of mosquito |
|
|
White crystalline powder |
|
|
|
|
|
|
|
|
- King Tech
- Hindustan Insecticides Ltd.
|
|
|
- Hildit
- Heliotox
- Didigam
- Dinocide
- Digmar
- Genitox
- Pentachlorin
- Rukseam
|
|
|
DDT was available in many different formats including aerosols, dustable powders, emulsifiable concentrates, granules and wettable powders |
|
|
|
|
|
|
|
0.006 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Low |
|
|
1000000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Cyclohexanone |
- |
| 850000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Dichloromethane |
- |
| 770000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Benzene |
- |
| 600000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Xylene |
- |
|
|
109 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
185 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
8.13 X 1006 |
Calculated |
- |
|
|
6.91 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
High |
|
|
|
Soluble |
|
- |
|
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
|
0.99 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
0.025 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low volatility |
|
|
8.43 X 10-01 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Moderately volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
6200 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Very persistent |
|
|
2000 |
|
Very persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data, PIC DGD; DT₅₀; Other sources: DT₅₀ 3 months in tropical regions, 4-30 years temperate regions. |
|
|
|
6.0 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 1.6-10.8 days, 4 field crops, various matrices, n=5 |
|
|
|
20.2 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 3.4-44.0 days, 8 field crops, various matrices, n=13 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Non-mobile |
|
|
151000 |
|
|
Log Koc given as 5.18 |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
-3.89 |
Calculated |
Low leachability |
|
|
|
5.35 X 10-03 |
Calculated |
- |
|
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW |
|
|
High |
Calculated |
- |
|
|
Non-mobile |
Calculated |
- |
|
|
|
3173 |
(Other literature Log BCF values range 1.9-5.5 (R3)) |
Threshold for concern |
|
|
Not available |
- |
| Known groundwater metabolites |
|
|
|
|
|
|
|
|
Relevancy unknown |
- |
- |
|
|
Relevancy unknown |
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
113 |
Rat |
Moderate |
|
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 160 day |
- |
|
|
1 |
- |
|
|
- |
- |
- |
|
|
> 2240 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1000 |
Eisenia foetida 56 day |
Low |
|
|
280 |
Eisenia foetida as EC10 |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
176.0 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Folsomia candida as EC10 |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
0.54 |
Apis mellifera |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
0.556 |
R4 R = Peer reviewed scientific publications 4 = Verified data Megachile rotundata |
High |
|
|
Contact |
|
|
|
0.0074 |
R4 R = Peer reviewed scientific publications 4 = Verified data Nomia melanderi |
High |
|
|
Contact |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Moderately harmful |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Typhlodromus pyri |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 2.5 |
Oncorhynchus mykiss |
Moderate |
|
|
0.13 |
Oncorhynchus mykiss |
Moderate |
|
|
> 0.005 |
J4 J = Pesticide Action Network database (click here ) 4 = Verified data Daphnia magna |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 0.0027 |
Chironomus riparius 1 day |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
113 |
Rat |
Moderate |
|
|
2510 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List I; List II |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
Non-statutory WHO drinking water guideline 0.001 mg l⁻¹ |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes UK EA QS database 2018 |
- |
|
|
- |
- |
- |
|
|
Mainly excreted in the urine but some also occurs by way of faeces (via biliary excretion) |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E2 E = Unspecified genotoxicity type (miscellaneous data source) 2 = Mixed/ambiguous results |
✓Yes, known to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
|
Highly toxic by ingestion, inhalation and via skin absorption Strong links with breast and womb cancer Endocrine issues - Competitive binding to androgen receptors |
|
|
|
|
|
IMDG Transport Hazard Class 6.1 |
|
|
Health: H301, H351, H372 Environment: H400, H410 |
|
|
II (Moderately hazardous) |
|
|
UN2761 |
|
|
- |
|
|
- |
|
|
|
|
|
DDT |
|
|
DDT |
|
|
DDT |
|
|
DDT |
|
|
DDT |
|
|
DDT |
|
|
DDT |
|
|
DDT |
|
|
DDT |
|
|
DDT |
|
|
DDT |
|
|
- |