| Cyhexatin (Ref: OMS 3029) |
(Also known as: tricyclohexyltin hydroxide; ENT 27395-X) |
| Cyhexatin is an acaricide used mainly on fruit crops. It has a low water solubility and is non-volatile. It is moderately persistent in soil systems. The risk of it leaching to groundwater, based on its physico-chemical properties, is low. Cyhexatin tends to be highly toxic to most biodiversity. It is moderately toxic to mammals if ingested. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Potential for particle bound transport: High
 |
Ecotoxicity High alert: Fish acute ecotoxicity: High; Daphnia acute ecotoxicity: High
 |
Human health Moderate alert: Mammals acute toxicity: Moderate; Possible Reproduction/development effects
 |
|
|
An acaricide used to control mites on a variety of crops. Can also be a pesticide transformation product |
|
|
European red mite; Citrus mite; Two-spotted spider mite |
|
|
Fruit including apples, pears, citrus, peaches, plums, nectarines, strawberries; Ornamentals; Hops; Almonds; Walnuts |
|
|
- |
|
|
- |
|
|
circa 1970 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Italy |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₈H₃₄OSn |
|
|
C1CCC(CC1)[Sn](C2CCCCC2)C3CCCCC3.O |
|
|
- |
|
|
WCMMILVIRZAPLE-UHFFFAOYSA-M |
|
|
InChI=1S/3C6H11.H2O.Sn/c3*1-2-4-6-5-3-1;;/h3*1H,2-6H2;1H2;/q;;;;+1/p-1/rC18H34OSn/c19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h16-19H,1-15H2 |
|
|
Yes |
|
|
Insecticide, Acaricide, Metabolite |
|
|
Soil |
|
|
Organotin insecticide; Organotin acaricide; Organometal insecticide; Organometal acaricide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Non-systemic with contact action, acts by inhibiting oxidative phosphorylation. Inhibitor of mitochondrial ATP synthase. |
|
|
13121-70-5 |
|
|
236-049-1 |
|
|
289 |
|
|
101601 |
|
|
6327054 |
|
|
050-002-00-0 |
|
|
385.17 |
|
|
tricyclohexylstannanol |
|
|
tricyclohexyltin hydroxide |
|
|
tricyclohexylhydroxystannane |
|
|
OSPAR soc; Severe Marine Pollutant; Chemical subject to PIC regulations |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
12B |
|
|
Not applicable |
|
|
Panonychus ulmi, Tetranychus mcdanieli, Tetranychus urticae, Tetranychus kanzawai, Tetranychus pacificus |
|
|
Solid |
|
|
|
|
|
- Chemia SPA ITALY
- Cerexagri
- Oxon Italia SpA
- Dow Chemicals
|
|
|
- Citran 500 SC
- Plictran
- Aracnol F
|
|
|
Usually supplied as a suspension concentrate or wettable powder. |
|
|
|
|
|
|
|
1.0 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low |
|
|
216000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Chloroform |
- |
| 37000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
| 16000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Benzene |
- |
| 10000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Toluene |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
6.92 X 1004 |
Calculated |
- |
|
|
4.84 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
1.15 X 10-03 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
Low volatility |
|
|
2.00 X 10-02 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
50 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Moderately persistent |
|
|
50 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderately persistent |
|
|
50 |
|
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
Degraded by UV light |
|
|
|
Stable |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data |
Stable |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Non-mobile |
|
|
4365 |
|
|
Best available data |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
0.61 |
Calculated |
Low leachability |
|
|
|
1.18 X 10-02 |
Calculated |
- |
|
|
- |
|
|
High |
Calculated |
- |
|
|
Non-mobile |
Calculated |
- |
|
|
|
10000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
High potential |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
265 |
Rat |
Moderate |
|
|
|
1 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
High |
|
|
- |
- |
|
|
- |
- |
- |
|
|
520 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Colinus virginianus |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
32 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Apis mellifera |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Moderately harmful |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Typhlodromus pyri |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.06 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Perciformes |
High |
|
|
- |
- |
- |
|
|
0.0002 |
C3 C = AGRITOX dataset. Dataset is no longer available. 3 = Unverified data of known source Daphnia magna |
High |
|
|
- |
- |
- |
|
|
0.00032 |
Americamysis bahia |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.000018 |
Scenedesmus subspicutus |
High |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
265 |
Rat |
Moderate |
|
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.003 |
|
- |
|
|
0.02 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List I; List II |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Highly toxic |
|
|
|
|
|
IMDG Transport Hazard Class 6.1 |
|
|
Health: H302, H312, H332 Environment: H400, H410 |
|
|
II (Moderately hazardous) |
|
|
UN2786 |
|
|
- |
|
|
- |
|
|
|
|
|
cyhexatin |
|
|
cyhexatin |
|
|
Cyhexatin |
|
|
cyhexatin |
|
|
ciexatin |
|
|
cihexatin |
|
|
- |
|
|
cyheksatyna |
|
|
- |
|
|
cyhexatin |
|
|
cyhexatin |
|
|
- |