| Cycloate (Ref: R 2063) |
(Also known as: hexylthiocarbam) |
| Cycloate is a herbicide used to control grasses and some broad-leaved weeds. It is moderately soluble in water but insoluble in many organic solvents. It is a highly volatile substance. Cycloate may be moderately persistent in soil and water systems depending on environmental conditions. It is moderately toxic to mammals, a chilinesterase inhibitor and neurotoxin. It is also moderately toxic to most fauna and flora. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Moderately persistent; GUS: Transition state; Drainflow: Moderately mobile; Potential for particle bound transport: Medium
 |
Ecotoxicity Moderate alert: Birds acute ecotoxicity: Moderate; Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Bees acute unknown ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health High alert: Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
|
A herbicide used to control annual grass weeds and some broad-leaved weeds |
|
|
Ryegrass; Crabgrass; Foxtail; Nightshade; Lambsquarters; Velvetleaf; Pigweed; Nutgrass |
|
|
Spinach; Sugarbeet; Red beet; Mangels; |
|
|
- |
|
|
Current |
|
|
circa 1966 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₁H₂₁NOS |
|
|
CCN(C1CCCCC1)C(=O)SCC |
|
|
No data |
|
|
DFCAFRGABIXSDS-UHFFFAOYSA-N |
|
|
InChI=1S/C11H21NOS/c1-3-12(11(13)14-4-2)10-8-6-5-7-9-10/h10H,3-9H2,1-2H3 |
|
|
Yes |
|
|
Herbicide |
|
|
Thiocarbamate herbicide; Carbamate herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Selective, systemic absorbed by roots and coleoptiles. Lipid synthesis inhibitor.. |
|
|
1134-23-2 |
|
|
214-482-7 |
|
|
214 |
|
|
041301 |
|
|
14337 |
|
|
No data found |
|
|
215.36 |
|
|
S-ethyl cyclohexyl(ethyl)carbamothioate |
|
|
S-ethyl cyclohexyl(ethyl)thiocarbamate |
|
|
S-ethyl cyclohexylethylcarbamothioate |
|
|
Potential groundwater contaminant |
|
|
- |
|
|
K3 |
|
|
15 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Colourless liquid |
|
|
|
|
|
- Helm Agro
- Tri-Ag
- AgroSan
- Stauffer
|
|
|
- Ro-Neet
- Eurex
- Zephyr
- Etsan
- Ronit
|
|
|
Usually supplied as an emulsifiable concentrate or as granules |
|
|
|
|
|
|
|
75 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderate |
|
|
- |
- |
- |
|
|
11.5 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
145 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
- |
|
|
- |
- |
- |
|
|
100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
|
1.29 X 1004 |
Calculated |
- |
|
|
4.11 |
T4 T = UN EPFA database. Dataset no longer available. 4 = Verified data |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.02 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
830 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Highly volatile |
|
|
6.12 X 10-03 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
61 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderately persistent |
|
|
30 |
DW3 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 3 = Unverified data of known source |
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
General literature DT₅₀: 9.4-133 days (R3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
30 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderately persistent |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Moderately mobile |
|
|
272 |
|
|
Best available data |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
2.31 |
Calculated |
Transition state |
|
|
|
1.09 X 10-01 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
55 |
- |
|
|
- |
- |
- |
|
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Coturnix japonica |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
250 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
11 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
4.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
24 |
J4 J = Pesticide Action Network database (click here ) 4 = Verified data Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
|
4.7 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
IMDG Transport Hazard Class 3 |
|
|
Health: H317, H332 Environment: H400, H410 |
|
|
III (Slightly hazardous) |
|
|
UN2772 |
|
|
- |
|
|
- |
|
|
|
|
|
cycloate |
|
|
cycloate |
|
|
Cycloat |
|
|
cycloate |
|
|
cicloato |
|
|
cicloato |
|
|
- |
|
|
cykloat |
|
|
- |
|
|
cycloate |
|
|
- |
|
|
- |