| Cybutryne |
(Not known by any other names) |
| Cybutyrn is a phytoxic biocide. It has a low aqueous solubility and is non-volatile. It is moderately toxic to fish, aquatic invertebrates and plant. It is highly toxic to algae. No information is available on its impact on human health. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Slightly mobile
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health High alert: Reproduction/development effects
 |
|
|
An effective herbicidal biocide mainly used as an antifouling agent in paints for boats and other water vessels |
|
|
Slimes; Moulds; Mosses; Algae |
|
|
- |
|
|
- |
|
|
Current |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₁H₁₉N₅S |
|
|
CC(C)(C)NC1=NC(=NC(=N1)NC2CC2)SC |
|
|
- |
|
|
HDHLIWCXDDZUFH-UHFFFAOYSA-N |
|
|
InChI=1S/C11H19N5S/c1-11(2,3)16-9-13-8(12-7-5-6-7)14-10(15-9)17-4/h7H,5-6H2,1-4H3,(H2,12,13,14,15,16) |
|
|
Yes |
|
|
Algistat, Herbicide, Other substance |
|
|
Biocide, Antifoulant |
|
|
Triazine biocide; Triazine herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Reduces plant photosynthetic ability; Highly phytotoxic |
|
|
28159-98-0 |
|
|
248-872-3 |
|
|
None allocated |
|
|
128996 |
|
|
91590 |
|
|
No data found |
|
|
253.37 |
|
|
N2-tert-butyl-N4-cyclopropyl-6-(methylsulfanyl)-1,3,5-triazine-2,4-diamine |
|
|
N2-tert-butyl-N4-cyclopropyl-6-methylthio-1,3,5-triazine-2,4-diamine |
|
|
N-cyclopropyl-N-(1,1-dimethylethyl)-6-(methylthio)-1,3,5-triazine-2,4-diamine |
|
|
Marine pollutant |
|
|
- |
|
|
Not known |
|
|
Not known |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
White crystalline powder |
|
|
|
|
|
- Zhejiang Zhongshan
- Ciba Speciality Chemicals
|
|
|
|
|
|
- |
|
|
|
|
|
|
|
7.0 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Low |
|
|
- |
- |
- |
|
|
128 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
8.91 X 1003 |
Calculated |
- |
|
|
3.95 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
0.088 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Low volatility |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
14 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Slow |
|
|
Around 2 weeks in natural waters |
|
|
|
Stable |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Stable |
|
|
Stable at all relevant pH values |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Slightly mobile |
|
|
1569 |
|
|
Koc literature values range 548 to 2590 g l⁻¹ |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
160 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Threshold for concern |
|
|
nd |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.86 |
R4 R = Peer reviewed scientific publications 4 = Verified data Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
2.40 |
R4 R = Peer reviewed scientific publications 4 = Verified data Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.011 |
R4 R = Peer reviewed scientific publications 4 = Verified data Lemna gibba |
Moderate |
|
|
0.0023 |
R4 R = Peer reviewed scientific publications 4 = Verified data Selenastrum capricornutum |
High |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
0.1 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
?Possibly, status not identified |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
No data found |
No data found |
| Eye irritant |
Phototoxicant |
|
| No data found |
No data found |
|
|
|
|
Possible liver and spleen toxicant |
|
|
|
|
|
No information available |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
cybutryne |
|
|
cybutryne |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |