| Cloransulam-methyl (Ref: XDE 565) |
(Also known as: HSDB 7009; XR-565) |
| Cloransulam-methyl is a post-emergence herbicide. It has a moderate aqueous solubility, is non-volatile and, based on its chemical properties, is mobile and may leach to groundwater in some situations. It is generally non- persistent in soil systems but usually degrades quickly in aquatic systems via photolysis. It is not susceptible to hydrolysis. It has a low mammalian toxicity and has a high potential for bioaccumulation. It is a skin and eye irritant. It has a low level of toxicity to birds and aquatic invertebrates but is more toxic to fish, aquatic plants, algae, earthworms and honey bees. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Drainflow: Mobile
 |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Bees acute contact ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health Low alert
 |
|
|
Used for post-emergence control of broad-leaved weeds in soybeans |
|
|
Cocklebur; Horseweed; Lambsquarters; Mallow; Pigweed; Morning glory; Ragweed; Velvetleaf; Waterhemp |
|
|
Soybeans |
|
|
- |
|
|
- |
|
|
1998, USA |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₅H₁₃ClFN₅O₅S |
|
|
CCOC1=NC(=CC2=NC(=NN21)S(=O)(=O)NC3=C(C=CC=C3Cl)C(=O)OC)F |
|
|
- |
|
|
BIKACRYIQSLICJ-UHFFFAOYSA-N |
|
|
InChI=1S/C15H13ClFN5O5S/c1-3-27-15-18-10(17)7-11-19-14(20-22(11)15)28(24,25)21-12-8(13(23)26-2)5-4-6-9(12)16/h4-7,21H,3H2,1-2H3 |
|
|
Yes |
|
|
Herbicide |
|
|
Sulfonanilide herbicide; Triazolopyrimidine herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Inhibits plant amino acid synthesis - acetohydroxyacid synthase AHAS. |
|
|
147150-35-4 |
|
|
604-573-3 |
|
|
None allocated |
|
|
129116 |
|
|
86453 |
|
|
No data found |
|
|
429.81 |
|
|
methyl 3-chloro-2-(5-ethoxy-7-fluoro[1,2,4]triazolo[1,5-c]pyrimidine-2-sulfonamido)benzoate |
|
|
methyl 3-chloro-2-(5-ethoxy-7-fluoro[1,2,4]triazolo[1,5-c]pyrimidin-2-ylsulfonamido)benzoate |
|
|
methyl 3-chloro-2-(((5-ethoxy-7-fluoro(1,2,4)triazolo(1,5-c)pyrimidin-2-yl)sulfonyl)amino)benzoate |
|
|
- |
|
|
- |
|
|
B |
|
|
2 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Off-white powder |
|
|
|
|
|
|
|
|
|
|
184 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Moderate |
|
|
4360 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Acetone |
- |
| 6980 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Dichloromethane |
- |
| 980 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethyl acetate |
- |
| 470 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
|
|
217 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
4.32 X 10-01 |
Calculated |
- |
|
|
-0.365 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.54 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
- |
|
|
4.81 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
- |
| Weak acid |
|
|
4.0 X 10-11 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
9.35 X 10-14 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
11 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
15 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Non-persistent |
|
|
10 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Literature values lab studies DT₅₀ range 9-21 days, Field studies DT₅₀ range 4.2 to 24.1 days (R4) |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
3.9 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
|
Soybean, whole plant, n=1 |
|
|
|
0.01 |
|
Fast |
|
|
Photolysis around 20 mins |
|
|
|
175 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Persistent |
|
|
pH sensitive : >365 days at pH 5, 118-231 days at pH 7, 3 days at pH 9, 10 days in natural water at pH 8, 67 days soil slurry at pH 6.5 |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
|
Mobile |
|
|
30 |
|
|
Other sources: Koc range 12-262 mL g⁻¹ (R3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
2.52 |
Calculated |
Transition state |
|
|
|
5.71 X 10-02 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Mobile |
Calculated |
- |
|
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
|
- |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
|
- |
Rat |
- |
|
|
50 |
- |
|
|
- |
- |
- |
|
|
> 5620 |
Colinus virginianus |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
859 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 25 |
|
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 86.0 |
Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
163 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.00312 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Lemna gibba |
High |
|
|
0.042 |
Selenastrum capricornutum |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
|
3.77 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat 4 hr |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List II |
- |
- |
|
|
|
- |
|
|
Occupational exposure may occur through inhalation of dust and dermal contact |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
IMDG Transport Hazard Class 9 |
|
|
Health: H332 Environment: H400, H410 |
|
|
U (Unlikely to present an acute hazard) |
|
|
UN3077 |
|
|
Packaging Group II (minor danger) |
|
|
- |
|
|
|
|
|
cloransulam-methyl |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
cloransulam metil |
|
|
- |
|
|
chloransulam metylowy |
|
|
- |
|
|
- |
|
|
- |
|
|
- |