| Chlorthiophos (Ref: ENT 27635) |
(Also known as: chlorthiofos; CM S-2957; celathion; OMS 1342; S 2597) |
| Chlorthiophos is an obsolete organophosphate insecticide used mainly for the control of ants and mites. The substance has not been extensively studied and so very little data is available. Chlorthiophos is non-volatile and considered to be non-mobile. It is highly toxic to mammals, is a cholinesterase inhibitor and a neurotoxin. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Low alert: Drainflow: Non-mobile
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health High alert: Mammals acute toxicity: High; Acetyl cholinesterase inhibitor; Neurotoxicant
 Warning: Significant data are missing |
|
|
An obsolete organophosphate insecticide used mainly for the control of ants and mites |
|
|
Ants; Termites; Mites including varroa mite, phytophagous mites, spidermites; Thrips |
|
|
Cotton; Citrus |
|
|
- |
|
|
Considered obsolete but may be available in some countries |
|
|
1971, first reported |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Reaction mix of three isomers |
|
|
C₁₁H₁₅Cl₂O₃PS₂ |
|
|
CCOP(=S)(OCC)OC1=CC(=C(C=C1Cl)Cl)SC |
|
|
- |
|
|
WIQNXNHXIZXZFM-UHFFFAOYSA-N |
|
|
InChI=1S/C11H15Cl2O3PS2/c1-4-14-17(18,15-5-2)16-8-6-9(12)11(13)10(7-8)19-3/h6-7H,4-5H2,1-3H3 |
|
|
Yes |
|
|
Insecticide, Acaricide, Miticide |
|
|
Organophosphate insecticide; Organophosphate acaricide; Organothiophosphate insecticide; Organothiophosphate acaricide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Acetylcholinesterase (AChE) inhibitor. |
|
|
21923-23-9 |
|
|
60238-56-4 |
|
|
244-663-6 |
|
|
None allocated |
|
|
111814 |
|
|
30859 |
|
|
015-115-00-1 |
|
|
361.25 |
|
|
reaction mixture of the three isomers: (i) O-[2,4-dichloro-5-(methylsulfanyl)phenyl] O,O-diethyl phosphorothioate; (ii) O-[2,5-dichloro-4-(methylsulfanyl)phenyl] O,O-diethyl phosphorothioate (major component); and (iii) O-[4,5-dichloro-2-(methylsulfanyl)phenyl] O,O-diethyl phosphorothioate |
|
|
mix of (i) O-2,4-dichlorophenyl-5-methylthiophenyl O,O-diethyl phosphorothioate; (ii) O-2,5-dichlorophenyl-4-methylthiophenyl O,O-diethyl phosphorothioate (major component); and (iii) O-4,5-dichlorophenyl-2-methylthiophenyl O,O-diethyl phosphorothioate |
|
|
O-[dichloro(methylthio)phenyl] O,O-diethyl phosphorothioate |
|
|
Marine Pollutant; PAN Bad Actor Chemical |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
1B |
|
|
Not applicable |
|
|
Culex pipiens pipiens |
|
|
Yellow-brown liquid |
|
|
|
|
|
|
|
|
|
|
|
Was available in a wide variety of formulations including emulsifiable concentrates, dry powders, granules and wettable powders |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
2.19 X 1004 |
Calculated |
- |
|
|
4.34 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.46 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
|
- |
- |
- |
| - |
|
|
0.122 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Low volatility |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
Q1 Q = Miscellaneous data from online sources 1 = Estimated data with little or no verification |
Non-mobile |
|
|
5461 |
|
|
Estimated |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
7.8 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
1.3 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Lepomis macrochirus |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
7.8 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
High |
|
|
153 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
Absorbed by the skin, as well as by the respiratory and gastrointestinal tracts |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
No data found |
No data found |
| Eye irritant |
Phototoxicant |
|
| No data found |
No data found |
|
|
|
|
Extremely hazardous May cause conjunctival congestion and diminished vision May cause gastrointestinal symptoms |
|
|
|
|
|
May generate highly toxic and flammable phosphine gas under certain conditions Corrosive |
|
|
Health: H300, H311 Environment: H400, H410 |
|
|
Ia (Extremely hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
chlorthiophos |
|
|
- |
|
|
- |
|
|
- |
|
|
clortiofos |
|
|
- |
|
|
- |
|
|
chlortiofos |
|
|
- |
|
|
- |
|
|
- |
|
|
- |