| Chlorthion (Ref: BAY 22/190 ) |
(Also known as: methyl chlorothion ; chlortion; compd 22/190) |
| Chlorthion is an organophosphate insecticide. It has a low aqueous solubility and not considered to be volatile. Chlorthion is not persistent in soil systems and based on its physico-chemical properties it is only slightly mobile and not expected to leach to groundwater. It is moderately toxic to most biodiversity but there may be a higherr risk for bees. It has a moderate mammalian toxicity, is a cholinesterase inhibitor and a neurotoxin. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Slightly mobile; Potential for particle bound transport: Medium
 Warning: Significant data are missing |
Ecotoxicity High alert: Bees acute unknown ecotoxicity: High
 |
Human health High alert: Acetyl cholinesterase inhibitor; Neurotoxicant
 Warning: Significant data are missing |
|
|
An obsolete insecticide that was once used to control a wide range of agricultural and domestic insects |
|
|
Boll weevil; Blowfly larvae; Mosquito larvae; Aphids |
|
|
Fruit; Vines; Forestry |
|
|
- |
|
|
Considered obsolete but may be available in some countries |
|
|
1954, first reported |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₈H₉O₅NSCIP |
|
|
COP(=S)(OC)OC1=CC(=C(C=C1)[N+](=O)[O-])Cl |
|
|
- |
|
|
NZNRRXXETLSZRO-UHFFFAOYSA-N |
|
|
InChI=1S/C8H9ClNO5PS/c1-13-16(17,14-2)15-6-3-4-8(10(11)12)7(9)5-6/h3-5H,1-2H3 |
|
|
Yes |
|
|
Insecticide, Larvicide |
|
|
Organophosphate insecticide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Cholinesterase inhibitor. Broad spectrum with contact, stomach and respiratory action |
|
|
500-28-7 |
|
|
207-902-5 |
|
|
None allocated |
|
|
034501 |
|
|
10372 |
|
|
015-042-00-5 |
|
|
297.66 |
|
|
- |
|
|
O,O-dimethyl-O-3-chloro-4-nitrophenyl phosphorothionate |
|
|
O,O-dimethyl-O-(3-chloro-4-nitrophenyl)-phosphorothioate |
|
|
PAN Bad Actor Chemical |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
1B |
|
|
Not applicable |
|
|
- |
|
|
Yellow crystalline solid |
|
|
|
|
|
|
|
|
|
|
|
Usually formulated as a wettable powder or dusts |
|
|
|
|
|
|
|
40 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source at 25 °C |
Low |
|
|
Miscible |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Benzene |
- |
| Miscible |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Methanol |
- |
| Miscible |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Ethanol |
- |
| Miscible |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Ether |
- |
|
|
21 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
125 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
176 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
|
2.82 X 1003 |
Calculated |
- |
|
|
3.45 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.44 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
5.33 X 1006 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
Highly volatile |
|
|
3.97 X 10-03 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
15 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
V1 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 1 = Estimated data with little or no verification |
Slightly mobile |
|
|
1800 |
|
|
Estimated |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
0.88 |
Calculated |
Low leachability |
|
|
|
1.46 X 10-02 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Slightly mobile |
Calculated |
- |
|
|
|
31.6 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Low potential |
|
|
<0.5 |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 880 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
280 |
R4 R = Peer reviewed scientific publications 4 = Verified data median of 3 species |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
500 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.2 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Expert judgement |
High |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.71 |
Lepomis macrochirus |
Moderate |
|
|
- |
- |
- |
|
|
4.2 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 880 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
1500 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
None allocated |
JMPR 1965 |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List I |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
No data found |
No data found |
| Eye irritant |
Phototoxicant |
|
| No data found |
No darta |
|
|
|
|
No further information available |
|
|
|
|
|
IMDG Transport Hazard Class 6.1 Emits toxic fumes when heated to decomposition |
|
|
- |
|
|
Not listed |
|
|
UN3278 |
|
|
- |
|
|
- |
|
|
|
|
|
chlorthion |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
chloorthion |
|
|
- |