| Chlorthal |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Persistent; GUS: High leachability; Drainflow: Very mobile
 |
Ecotoxicity Low alert: Fish acute ecotoxicity: Low; Daphnia acute ecotoxicity: Low
 Warning: Significant data are missing |
Human health Moderate alert: Possible Carcinogen; Possible Reproduction/development effects
 |
|
|
A residual benzoic acid herbicide for pre-emergent control of annual grasses and some annual broad-leaved weeds |
|
|
Barnyardgrass; Bindweed; Nightshade; Chickweed; Crabgrass; Fat-hen; Pigweed; Redshank; Fescue; Stinging nettle; Petty spurge; Ryegrass |
|
|
Vegetables including brassicas, peas & beans, onions, carrots, turnips; Strawberries; Cotton; Lucerne; Ornamentals; Lawns |
|
|
- |
|
|
Current |
|
|
circa 1960 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Greece |
|
|
Expired |
|
|
Not applicable |
|
|
Yes (as dimethyl variant) |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₈H₂Cl₄O₄ |
|
|
C1(=C(C(=C(C(=C1Cl)Cl)C(=O)O)Cl)Cl)C(=O)O |
|
|
- |
|
|
KZCBXHSWMMIEQU-UHFFFAOYSA-N |
|
|
InChI=1S/C8H2Cl4O4/c9-3-1(7(13)14)4(10)6(12)2(5(3)11)8(15)16/h(H,13,14)(H,15,16) |
|
|
Yes |
|
|
Herbicide |
|
|
Soil |
|
|
Benzenedicarboxylic acid herbicide; Phthalic acid herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Selective, non-systemic, acts by inhibiting seed germination. Microtubule assembly inhibition. |
|
|
2136-79-0 |
|
|
No data found |
|
|
328 |
|
|
078702 |
|
|
16493 |
|
|
No data found |
|
|
303.91 |
|
|
2,3,5,6-tetrachlorobenzene-1,4-dicarboxylic acid |
|
|
tetrachloroterephthalic acid |
|
|
2,3,5,6-tetrachloro-1,4-benzenedicarboxylic acid |
|
|
Chemical subject to PIC regulations; PAN Bad Actor Chemical |
|
|
- |
|
|
K1 |
|
|
3 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
|
- |
|
|
- |
|
|
Usually supplied as a wettable powder or granular formulation |
|
|
|
|
|
|
|
5780 |
|
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
154 |
|
Persistent |
|
|
154 |
|
Persistent |
|
|
- |
- |
- |
|
|
1765 |
|
Very persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
EU dossier Lab studies DT₅₀ range 100-1286 days; DT₉₀ range 333-4270 days |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
0 |
|
Very mobile |
|
|
0 |
|
|
No measurable absorption except in organic soils and then values are low |
|
|
|
0 |
|
Very mobile |
|
|
0 |
|
|
0.96 |
|
|
No measurable absorption except in organic soils and then values are low |
|
|
- |
|
|
|
|
|
|
|
13.13 |
Calculated |
High leachability |
|
|
|
1.21 X 1002 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Very mobile |
Calculated |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 3000 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 100 |
Oncorhynchus mykiss |
Low |
|
|
- |
- |
- |
|
|
> 100 |
Daphnia magna |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
8.73 |
Selenastrum capricornutum |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 3000 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Negligible risk to the public |
|
|
Acceptable risk with PPE/PPC |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B2 B = DNA damage/repair (EFSA database) 2 = Mixed/ambiguous results ; C3 C = Gene mutation (EFSA database) 3 = Negative ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
?Possibly, status not identified |
No data found |
| Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
|
Possible liver, thyroid & lung toxicant USEPA - possible human carcinogen |
|
|
|
|
|
Not explosive or oxidising Not expected to autoignite; Not highly flammable IMDG Transport Hazard Class 6.1 |
|
|
Environment: H400, H410 |
|
|
III (Slightly hazardous) |
|
|
UN2811 |
|
|
- |
|
|
- |
|
|
|
|
|
chlorthal |
|
|
chlorthal |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |