| Chloroneb |
(Also known as: chloronebe; terreneb; demosan) |
| Chloroneb is an obsolete fungicide seed treatment that was largely used on turf. It has a low aqueous solubility and is highly volatile and so may be prone to drift, It tends to be persistent in soil systems. It is not mobile and so will have little propensity for leaching to groundwater. It has a low to moderate toxicity to mammals, birds, fish and aquatic invertebrates. It is not highly toxic to humans but is considered to be a skin and eye irritant. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Potential for particle bound transport: High
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate
 |
Human health Low alert
 |
|
|
An obsolete seed treatment used to treat fungal diseases in a wide range of crops |
|
|
Snow mould; Blights; Brown patch; Damping-off |
|
|
Turf; Ornamentals including ferns; Sugarbeet; Soybeans; Cotton; Beans |
|
|
- |
|
|
Current |
|
|
circa 1967 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₈H₈Cl₂O₂ |
|
|
COC1=CC(=C(C=C1Cl)OC)Cl |
|
|
No data |
|
|
PFIADAMVCJPXSF-UHFFFAOYSA-N |
|
|
InChI=1S/C8H8Cl2O2/c1-11-7-3-6(10)8(12-2)4-5(7)9/h3-4H,1-2H3 |
|
|
Yes |
|
|
Fungicide |
|
|
Substituted benzene compound; Unclassified substance |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Systemic, absorbed via rots. Lipid peroxidation inhibitor. |
|
|
2675-77-6 |
|
|
220-222-3 |
|
|
None allocated |
|
|
027301 |
|
|
17581 |
|
|
No data found |
|
|
207.1 |
|
|
1,4-dichloro-2,5-dimethoxybenzene |
|
|
1,4-dichloro-2,5-dimethoxybenzene |
|
|
1,4-dichloro-2,5-dimethoxybenzene |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
14 |
|
|
- |
|
|
Colourless crystalline solid |
|
|
|
|
|
- PBI
- Kincaid
- Du Pont
- Agrisolutions
|
|
|
- Terraneb SP
- Tersan SP
- Demosan
- Chloraxyl Seed Treater
|
|
|
Usually formulated as wettable powders, flowable concentrates and as seed treatments |
|
|
|
|
|
|
|
8 |
|
Low |
|
|
115000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
| 89000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Xylene |
- |
| 133000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Dichloromethane |
- |
|
|
134 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
268 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
268 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
|
3.80 X 1003 |
Calculated |
- |
|
|
3.58 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.66 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
|
- |
- |
- |
| - |
|
|
400 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Highly volatile |
|
|
1.05 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderately volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
130 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
Persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
24.1 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 7.1-39.0 days, 3 field and undercover grown crops, various matrices, n=6 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
DW3 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 3 = Unverified data of known source |
Slightly mobile |
|
|
1650 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
1.65 |
Calculated |
Low leachability |
|
|
|
5.11 X 10-02 |
Calculated |
- |
|
|
- |
|
|
High |
Calculated |
- |
|
|
Slightly mobile |
Calculated |
- |
|
|
|
167 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Threshold for concern |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
11000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 5000 |
Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 3.3 |
Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
> 5.8 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
11000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Rat |
Low |
|
|
5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
No information available |
|
|
Not classified: Obsolete |
|
|
Not classified: Obsolete |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
chloroneb |
|
|
chloronebe |
|
|
Chloroneb |
|
|
chloroneb |
|
|
cloroneb |
|
|
cloroneb |
|
|
- |
|
|
chloroneb |
|
|
- |
|
|
- |
|
|
- |
|
|
- |