| Chlorobenzilate (Ref: ENT 18596) |
(Also known as: chlorbenzylate; chlorobenzylate; G 23992) |
| Chlorobenzilate is an insecticide with a narrow range of uses. It has a low aqueous solubility but miscible with many organic solvents. It is volatile and has a low potential for leaching to groundwater. It is not expected to persist in soil systems. Chlorobenzilate has a low mammalian toxicity but there are some concerns regarding its potential for bio-concentration. It has a low toxicity to birds, a moderate toxicity for fish and honeybees. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Slightly mobile; Potential for particle bound transport: Medium
 |
Ecotoxicity High alert: Daphnia acute ecotoxicity: High
 |
Human health Moderate alert: Possible Carcinogen
 |
|
|
An obsolete non-systemic acaricide that was used to control mites on fruit and also in bee hives |
|
|
Mites; Ticks |
|
|
Citrus; Walnuts; Beehives; Cotton; Grapes |
|
|
- |
|
|
Considered obsolete but may be available in some countries |
|
|
circa 1953 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₆H₁₄Cl₂O₃ |
|
|
CCOC(=O)C(C1=CC=C(C=C1)Cl)(C2=CC=C(C=C2)Cl)O |
|
|
No data |
|
|
RAPBNVDSDCTNRC-UHFFFAOYSA-N |
|
|
InChI=1S/C16H14Cl2O3/c1-2-21-15(19)16(20,11-3-7-13(17)8-4-11)12-5-9-14(18)10-6-12/h3-10,20H,2H2,1H3 |
|
|
Yes |
|
|
Insecticide, Acaricide, Miticide |
|
|
Organochloride insecticide; Bridged diphenyl insecticide; Organochloride acaricide; Bridged diphenyl acaricide; Diarylmethane compound |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Nervous system toxin with contact action |
|
|
510-15-6 |
|
|
208-110-2 |
|
|
119 |
|
|
028801 |
|
|
10522 |
|
|
607-159-00-0 |
|
|
325.19 |
|
|
ethyl bis(4-chlorophenyl)hydroxyacetate |
|
|
ethyl 4,4'-dichlorobenzilate |
|
|
ethyl 4-chloro-α-(4-chlorophenyl)-a-hydroxybenzeneacetate |
|
|
Chemical subject to PIC regulations; Rotterdam Convention (Class O); Phytotoxic to some top fruit; PAN Bad Actor Chemical |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
2A |
|
|
Not applicable |
|
|
Aculus pelekassi, Panonychus ulmi, Tetranychus mcdanieli, Tetranychus urticae, Galerucella birmanica, plus others |
|
|
Colourless solid when pure |
|
|
|
|
|
- Makhteshim-Agan
- Ciba-Geigy AG
- Nippon Kayaku
|
|
|
- Folbex smoke-strips
- Kop-Mite
- Akar
- Acaraben
- Folbex
|
|
|
Usually supplied as an emulsifiable concentrate or as a wettable powder. |
|
|
|
|
|
|
|
10 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low |
|
|
Miscible |
Acetone |
- |
| Miscible |
Methanol |
- |
| 600000 |
Hexane |
- |
| Miscible |
Toluene |
- |
|
|
37 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
3.80 X 1004 |
Calculated |
- |
|
|
4.58 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
High |
|
|
|
Soluble |
|
- |
|
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
|
1.33 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
|
- |
- |
- |
| - |
|
|
0.12 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low volatility |
|
|
2.27 X 10-02 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
23 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Non-persistent |
|
|
20 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data |
|
|
|
10.8 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 4.8-18.0 days, 2 citrus crops, various matrices, n=5 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Slightly mobile |
|
|
2810 |
|
|
Best available data |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
0.72 |
Calculated |
Low leachability |
|
|
|
1.27 X 10-02 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Slightly mobile |
Calculated |
- |
|
|
|
750 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Threshold for concern |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 2784 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
2250 |
Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.01 |
|
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.7 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
0.01 |
Daphnia magna LT50 |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 2784 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.02 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List I; List II |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
IARC Group 3 carcinogen; Canada - considered to be carcinogen |
|
|
|
|
|
Incompatible with highly alkaline materials IMDG Transport Hazard Class 9 |
|
|
Health: H302 Environment: H400, H410 |
|
|
Not classified: Obsolete |
|
|
UN3077 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
chlorobenzilate |
|
|
chlorobenzilate |
|
|
Chlorbenzilat |
|
|
chlorobenzilat |
|
|
clorobenzilato |
|
|
clorbenzilato |
|
|
chlorobenzilate |
|
|
chlorobenzylat |
|
|
- |
|
|
- |
|
|
chloorbenzilaat |
|
|
- |