| Chlorimuron-ethyl (Ref: DPX F6025) |
(Also known as: chlorimuron ethyl ester; HSDB 6850) |
| Chlorimuron-ethyl is a post-emergence, foliar applied herbicide. It has a high aqueous solubility, is non-volatile and, based on its chemical properties, is mobile and can be expected to leach to groundwater. It can be moderately persistent in soil systems but will not usually persist in aquatic systems. It is generally susceptible to hydrolysis. It has a low mammalian toxicity and has a high potential to bioaccumulate. It is relatively non- toxic to most aquatic species, birds and earthworms but moderately toxic to honey bees. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability
 |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Bees acute contact ecotoxicity: Moderate
 |
Human health Moderate alert: Possible Reproduction/development effects
 |
|
|
Post-emergence, foliar applied herbicide used to control broad-leaved weeds in a range of crops including peanuts and soya beans. |
|
|
Ragweed; Pigweed; Velvetleaf; Dandelion; Yellow nutsedge; Bittercress; Deadnettle; Lambsquarters; Thistles; Pennycress |
|
|
Soybeans; Peanuts |
|
|
- |
|
|
- |
|
|
1986 |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₅H₁₅ClN₄O₆S |
|
|
CCOC(=O)C1=CC=CC=C1S(=O)(=O)NC(=O)NC2=NC(=CC(=N2)Cl)OC |
|
|
No data |
|
|
NSWAMPCUPHPTTC-UHFFFAOYSA-N |
|
|
InChI=1S/C15H15ClN4O6S/c1-3-26-13(21)9-6-4-5-7-10(9)27(23,24)20-15(22)19-14-17-11(16)8-12(18-14)25-2/h4-8H,3H2,1-2H3,(H2,17,18,19,20,22) |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| chlorimuron-ethyl |
- |
 |
|
|
Herbicide |
|
|
Sulfonylurea herbicide; Pyrimidinylsulfonylurea herbicide |
|
|
95% |
|
|
- |
|
|
Synthetic |
|
|
Inhibits plant amino acid synthesis - acetohydroxyacid synthase AHAS |
|
|
90982-32-4 |
|
|
618-690-2 |
|
|
806.202 |
|
|
128901 |
|
|
56160 |
|
|
No data found |
|
|
414.82 |
|
|
ethyl 2-{[(4-chloro-6-methoxypyrimidin-2-yl)carbamoyl]sulfamoyl}benzoate |
|
|
ethyl 2-(4-chloro-6-methoxypyrimidin-2-ylcarbamoylsulfamoyl)benzoate |
|
|
ethyl 2-[[[[(4-chloro-6-methoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]benzoate |
|
|
- |
|
|
- |
|
|
B |
|
|
2 |
|
|
Not applicable |
|
|
Not applicable |
|
|
Amaranthus hybridus, Amaranthus powellii |
|
|
Colourless to off-white crystals |
|
|
|
|
|
|
|
|
- AgroCare
- DuPont
- Cheminova
- FCC
- United Phosphorus
|
|
|
- Darban
- Twister
- Classic
- Pilarclas
- Sponsor
- Authority Broadleaf Herbicide
|
|
|
Usually supplied as a flowable dry powder and used as an aqueous spray post-emergence |
|
|
|
|
|
|
|
1200 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
70500 |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source Acetone |
- |
| 8150 |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source Benzene |
- |
| 60 |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source n-Hexane |
- |
| 2830 |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source Xylene |
- |
|
|
181 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.29 X 1000 |
Calculated |
- |
|
|
0.11 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.51 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
4.2 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
- |
| Weak acid |
|
|
4.9 X 10-07 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
1.7 X 10-10 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
40 |
|
Moderately persistent |
|
|
- |
- |
- |
|
|
28 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Literature studies give field DT₅₀ 14-42 days; Degradation takes longer at higher pH. |
|
|
|
4.7 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
|
Wheat straw, n=1 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
21 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
Non-persistent |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderately mobile |
|
|
106 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
2.86 |
Calculated |
High leachability |
|
|
|
2.15 X 10-01 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
|
- |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 4102 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Dog |
- |
|
|
250 |
- |
|
|
- |
- |
- |
|
|
> 5620 |
Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
4050 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Eisenia foetida |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
12.5 |
|
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 8.4 |
Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
> 10 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.00045 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Lemna gibba |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 4102 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
|
> 5.0 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat 4 hr |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
Occupational exposure may occur through dermal contact |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
?Possibly, status not identified |
No data found |
| Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
|
Slightly toxic Possible liver toxicant |
|
|
|
|
|
Highly flammable |
|
|
Handling: H225 Health: H319, H336 |
|
|
III (Slightly hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
chlorimuron-ethyl |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
clorimuron etil |
|
|
- |
|
|
chlorimuron etylowy |
|
|
- |
|
|
- |
|
|
- |
|
|
- |