| Chlordimeform (Ref: ENT 27335) |
(Also known as: chlorfenamidine; HSDB 1537; chlorophenamidin; chlorophedine; chlorophenamidine; Schering 36 268; C 851) |
| Chlordimeform in an insectiicde and acaricide. It is moderately soluble in water and highly soluble in many organic solvents. It is volatile. Under normal conditions is would not be expected to leach to groundwater. It is moderately persistent in soil systems but would not be expected to persist in water systems. It is moderately toxic to mammals, a neurotoxin and has a high potential for bio-concentration. It is moderately toxic to birds and fish but less so to honeybees. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Slightly mobile
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Birds acute ecotoxicity: Moderate; Fish acute ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health High alert: Carcinogen; Neurotoxicant
 |
|
|
An obsolete substance once used on a wide variety of crops to control mites and other insects. It has also been used to control livestock external parasites and stem borers in irrigated rice., |
|
|
Mites; Ticks; Some Lepidoptera insects |
|
|
Fruit; Vegetables; Cotton |
|
|
- |
|
|
Considered obsolete but may be available in some countries |
|
|
circa 1966 |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Isomeric. Chlordimeform has one E/Z centre. |
|
|
C₁₀H₁₃ClN₂ |
|
|
CC1=C(C=CC(=C1)Cl)N=CN(C)C |
|
|
- |
|
|
STUSTWKEFDQFFZ-UHFFFAOYSA-N |
|
|
InChI=1S/C10H13ClN2/c1-8-6-9(11)4-5-10(8)12-7-13(2)3/h4-7H,1-3H3 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| chlordimeform |
- |
 |
|
|
Acaricide, Insecticide, Ovicide |
|
|
Formamidine insecticide; Formamidine scaricide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Broad spectrum acaricide that appears to interfere with the amine-mediated control of nervous and endocrine systems. An antifeed agent. |
|
|
6164-98-3 |
|
|
228-200-5 |
|
|
277 |
|
|
059701 |
|
|
22544 |
|
|
650-007-00-3 |
|
|
196.68 |
|
|
(E)-N'-(4-chloro-2-methylphenyl)-N,N-dimethylmethanimidamide |
|
|
N2-(4-chloro-o-tolyl)-N1,N1-dimethylformamidine |
|
|
N'-(4-chloro-2-methylphenyl)-N,N-dimethylmethanimidamide |
|
|
Chemical subject to PIC regulations; PAN Bad Actor; Rotterdam Convention (Class O) |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not known |
|
|
Not applicable |
|
|
Boophilus microplus, Panonychus ulmi, Tetranychus urticae |
|
|
Colourless crystalline solid |
|
|
|
|
|
|
|
|
- Ciba-Geigy
- Schering
- Quimica Estrelle
|
|
|
- Ovatoxion
- Spanone
- Galecron
- Fundal
- Bermat
|
|
|
Usually formulated as an emulsifiable concentrate of water-soluble powder |
|
|
|
|
|
|
|
270 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
Moderate |
|
|
200000 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Acetone |
- |
| 200000 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Ethyl acetate |
- |
| 200000 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Chloroform |
- |
| 200000 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Benzene |
- |
|
|
35 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
7.76 X 1002 |
Calculated |
- |
|
|
2.89 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.10 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
6.8 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
| Weak acid |
|
|
48.0 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
Highly volatile |
|
|
0.896 |
|
Moderately volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
30 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
General sources: DT₅₀ 20-40 days (R3) |
|
|
|
0.4 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 0.1-0.95 days, cotton leaves, n=3 |
|
|
|
3.6 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
|
Green tea leaves, n=1 |
|
|
|
2.0 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Moderately fast |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
V1 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 1 = Estimated data with little or no verification |
Slightly mobile |
|
|
890 |
|
|
Estimated |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
1.55 |
Calculated |
Low leachability |
|
|
|
4.01 X 10-02 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Slightly mobile |
Calculated |
- |
|
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
160 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Rat |
- |
|
|
2.0 |
- |
|
|
- |
- |
- |
|
|
> 1749 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Coturnix japonica |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 120 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 11.7 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
160 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Moderate |
|
|
263 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
- |
|
|
> 17.4 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Mammal |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List II |
- |
- |
|
|
|
- |
|
|
May be absorbed through the skin |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
✓Yes, known to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
?Possibly, status not identified |
No data found |
| Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
|
Observed links with bladder cancer and urinary bladder irritation; IARC Group 3 carcinogen; USEPA - probable human carcinogen May act as blood toxicant, |
|
|
|
|
|
Prevent generation of dust May emit toxic fumes in a fire Not expected to autoignite; Not highly flammable |
|
|
- |
|
|
Not classified: Obsolete |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
chlordimeform |
|
|
chlordimeforme |
|
|
Chlordimeform |
|
|
- |
|
|
- |
|
|
clordimeform |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |