| Chinomethionat (Ref: ENT 25606) |
(Also known as: oxythioquinox; quinomethionate; chinomethionate; Bayer 36205; Bayer SAS2074) |
| Chinomethionat is a multi-use pest control substance. It has a low aqueous solubiltiy, a low volatility and, based on its chemical properties, would not normally be expected to leach to groundwater. It does not normally persist in soil or aquatic systems. Whilst chinomethionat is a skin and eye irritant, it is not highly toxic and no serious health issues have been identified. It is highly toxic to fish and algae but moderately toxic to most other species. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability; Drainflow: Mobile
 |
Ecotoxicity High alert: Fish acute ecotoxicity: High; Fish chronic ecotoxicity: High
 |
Human health Moderate alert: Possible Carcinogen; Possible Reproduction/development effects
 |
|
|
A quinoxaline fungicide, miticide and acaricide used to control various pests and diseases |
|
|
Spidermites; Powder mildew; Pear psylla; Mite eggs; Whiteflies; Aphids |
|
|
Fruit including, citrus, apples, pears, plums, peaches; Vegetables; Walnuts; ornamentals |
|
|
- |
|
|
Current |
|
|
1960, first reported; 1968, first registered USA |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Germany |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₀H₆N₂OS₂ |
|
|
CC1=CC2=C(C=C1)N=C3C(=N2)SC(=O)S3 |
|
|
- |
|
|
FBQQHUGEACOBDN-UHFFFAOYSA-N |
|
|
InChI=1S/C10H6N2OS2/c1-5-2-3-6-7(4-5)12-9-8(11-6)14-10(13)15-9/h2-4H,1H3 |
|
|
Yes |
|
|
Fungicide, Acaricide, Miticide, Insecticide |
|
|
Quinoxaline acaricide; Quinoxaline insecticide; Quinoxaline fungicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Selective, non-systemic contact action with protective and curative properties. Multi-site activity. |
|
|
2439-01-2 |
|
|
219-455-3 |
|
|
172 |
|
|
054101 |
|
|
17109 |
|
|
696-036-00-9 |
|
|
234.30 |
|
|
6-methyl-2H-[1,3]dithiolo[4,5-b]quinoxalin-2-one |
|
|
6-methyl-1,3-dithiolo[4,5-b]quinoxalin-2-one |
|
|
6-methyl-1,3-dithiolo[4,5-b]quinoxalin-2-one |
|
|
Phytotoxic to specific varieties of top fruit, currants and some ornamentals; Chemical subject to PIC regulations; PAN Bad Actor |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
UN |
|
|
M10 |
|
|
- |
|
|
Yellow crystals |
|
|
|
|
|
|
|
|
|
|
|
Available in a variety of formulations including dustable powders, suspension concentrates and wettable powders. |
|
|
|
|
|
|
|
1 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
25000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Toluene |
- |
| 40000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Dichloromethane |
- |
| 1800 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
| 900 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Cyclohexanone |
- |
|
|
170 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
6.03 X 1003 |
Calculated |
- |
|
|
3.78 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.56 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
0.026 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
6.09 X 10-03 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
- |
- |
- |
|
|
30 |
|
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Other data: field DT₅₀ 2.0-3.6 days (H3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
4.0 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
|
Strawberry fruit, n=1 |
|
|
|
4 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderately fast |
|
|
Other source: 0.5 days (H3) |
|
|
|
3.3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
pH sensitive: DT₅₀ 10 days at pH 4, 3.75 hours at pH 9 all at 22 °C |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
Mobile |
|
|
38 |
|
|
Other data source: 2300 mL g⁻¹ (US3); 28235 (H3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
3.57 |
Calculated |
High leachability |
|
|
|
5.34 X 10-01 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Mobile |
Calculated |
- |
|
|
|
3000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Threshold for concern |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
|
40 |
- |
|
|
- |
- |
- |
|
|
196 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Colinus virginianus |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Apis mellifera |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
Harmful at dose 150 g ha⁻¹ |
AA3 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 3 = Unverified data of known source Chrysoperla carnea |
- |
|
|
- |
- |
- |
|
|
Harmful at dose 150 g ha⁻¹ |
AA3 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 3 = Unverified data of known source Typhlodromus pyri |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.0334 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Lepomis macrochirus |
High |
|
|
> 0.002 |
Oncorhynchus mykiss 96 day |
High |
|
|
0.12 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
0.01 |
daphnia magna |
Moderate |
|
|
0.0085 |
Americamysis bahia |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.0069 |
Scenedesmus subspicatus |
High |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
2.2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
0.006 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Some bystanders may experience a skin reaction |
|
|
Occupational exposure may occur through inhalation and dermal contact |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Potential for serious eye damage |
|
|
|
|
|
No information available |
|
|
Health: H302, H312, H317, H319, H332, H361f, H373 Environment: H400, H410 |
|
|
III (Slightly hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
chinomethionat |
|
|
chinométhionate |
|
|
Chinomethionat |
|
|
chinomethionat |
|
|
chinometionato |
|
|
chinometionato |
|
|
chinomethionat |
|
|
chinometionat |
|
|
- |
|
|
- |
|
|
chinomethionat |
|
|
- |